diff --git a/.gitignore b/.gitignore index aaf0937b2..885abb0e5 100644 --- a/.gitignore +++ b/.gitignore @@ -39,7 +39,6 @@ test-verify*/ /bin/finalize-compiled /bin/release-compiled /bin/start-compiled -/bin/rewrite-compiled # Test binary and coverage files *.out diff --git a/ARCHITECTURE.md b/ARCHITECTURE.md index 7cf8628c2..85f32dab6 100644 --- a/ARCHITECTURE.md +++ b/ARCHITECTURE.md @@ -20,7 +20,7 @@ The PHP buildpack uses a **hybrid architecture** that combines: 1. **Bash wrapper scripts** for buildpack lifecycle hooks (detect, supply, finalize, release) 2. **Go implementations** for core logic (compiled at staging time) -3. **Pre-compiled runtime utilities** for application startup (rewrite, start) +3. **Pre-compiled runtime utility** for application startup (start) This design optimizes for both flexibility during staging and performance at runtime. @@ -91,8 +91,9 @@ Installs dependencies: ### 3. Finalize Phase (`bin/finalize`) Configures the application for runtime: +- Processes configuration files to replace build-time placeholders with runtime values - Generates start scripts with correct paths -- Copies `rewrite` and `start` binaries to `$HOME/.bp/bin/` +- Copies `start` binary to `$HOME/.bp/bin/` - Sets up environment variables **Location:** `src/php/finalize/finalize.go` @@ -145,8 +146,8 @@ This triggers the following sequence: ├─► Load .procs file │ (defines processes to run) │ - ├─► $HOME/.bp/bin/rewrite - │ (substitute runtime variables) + ├─► Handle dynamic runtime variables + │ (PORT, TMPDIR via sed replacement) │ ├─► Start PHP-FPM │ (background, port 9000) @@ -158,72 +159,18 @@ This triggers the following sequence: (multiplex output, handle failures) ``` -## Pre-compiled Binaries +## Pre-compiled Binary -The buildpack includes two pre-compiled runtime utilities: +The buildpack includes a pre-compiled runtime utility: ### Why Pre-compiled? -Unlike lifecycle hooks (detect, supply, finalize) which run **during staging**, these utilities run **during application startup**. Pre-compilation provides: +Unlike lifecycle hooks (detect, supply, finalize) which run **during staging**, this utility runs **during application startup**. Pre-compilation provides: 1. **Fast startup time** - No compilation delay when starting the app 2. **Reliability** - Go toolchain not available in runtime container 3. **Simplicity** - Single binary, no dependencies -### `bin/rewrite` (1.7 MB) - -**Purpose:** Runtime configuration templating - -**Source:** `src/php/rewrite/cli/main.go` - -**Why needed:** Cloud Foundry assigns `$PORT` **at runtime**, not build time. Configuration files need runtime variable substitution. - -**Supported patterns:** - -| Pattern | Example | Replaced With | -|---------|---------|---------------| -| `@{VAR}` | `@{PORT}` | `$PORT` value | -| `#{VAR}` | `#{HOME}` | `$HOME` value | -| `@VAR@` | `@WEBDIR@` | `$WEBDIR` value | - -**Example usage:** - -```bash -# In start script -export PORT=8080 -export WEBDIR=htdocs -$HOME/.bp/bin/rewrite "$DEPS_DIR/0/php/etc" - -# Before: httpd.conf -Listen @{PORT} -DocumentRoot #{HOME}/@WEBDIR@ - -# After: httpd.conf -Listen 8080 -DocumentRoot /home/vcap/app/htdocs -``` - -**Key files rewritten:** -- `httpd.conf` - Apache configuration -- `nginx.conf` - Nginx configuration -- `php-fpm.conf` - PHP-FPM configuration -- `php.ini` - PHP configuration (extension_dir paths) - -**Implementation:** `src/php/rewrite/cli/main.go` - -```go -func rewriteFile(filePath string) error { - content := readFile(filePath) - - // Replace @{VAR}, #{VAR}, @VAR@, #VAR - result := replacePatterns(content, "@{", "}") - result = replacePatterns(result, "#{", "}") - result = replaceSimplePatterns(result, "@", "@") - - writeFile(filePath, result) -} -``` - ### `bin/start` (1.9 MB) **Purpose:** Multi-process manager @@ -317,24 +264,30 @@ These values **cannot be known at staging time**, so configuration files use tem ``` ┌──────────────────────────────────────────────────────────────┐ -│ 1. Staging Time (finalize.go) │ +│ 1. Staging Time (supply phase) │ │ - Copy template configs with @{PORT}, #{HOME}, etc. │ -│ - Generate start script with rewrite commands │ -│ - Copy pre-compiled rewrite binary to .bp/bin/ │ +│ - Placeholders remain in config files │ └──────────────────────────────────────────────────────────────┘ │ ▼ ┌──────────────────────────────────────────────────────────────┐ -│ 2. Runtime (start script) │ -│ - Export environment variables (PORT, HOME, WEBDIR, etc.) │ -│ - Run: $HOME/.bp/bin/rewrite $DEPS_DIR/0/php/etc │ -│ - Run: $HOME/.bp/bin/rewrite $HOME/nginx/conf │ +│ 2. Finalize Phase (build-time processing) │ +│ - Replace build-time placeholders with known values │ +│ - Process PHP, PHP-FPM, and web server configs │ +│ - Dynamic runtime values (PORT, TMPDIR) handled via sed │ +└──────────────────────────────────────────────────────────────┘ + │ + ▼ +┌──────────────────────────────────────────────────────────────┐ +│ 3. Runtime (start script) │ +│ - Export environment variables (PORT, TMPDIR, etc.) │ +│ - Use sed to replace remaining dynamic variables │ │ - Configs now have actual values instead of templates │ └──────────────────────────────────────────────────────────────┘ │ ▼ ┌──────────────────────────────────────────────────────────────┐ -│ 3. Start Processes │ +│ 4. Start Processes │ │ - PHP-FPM reads php-fpm.conf (with real PORT) │ │ - Web server reads config (with real HOME, WEBDIR) │ └──────────────────────────────────────────────────────────────┘ @@ -355,7 +308,7 @@ server { } ``` -**At runtime** (after rewrite with `PORT=8080`, `HOME=/home/vcap/app`, `WEBDIR=htdocs`, `PHP_FPM_LISTEN=127.0.0.1:9000`): +**At finalize/runtime** (after placeholder replacement with `PORT=8080`, `HOME=/home/vcap/app`, `WEBDIR=htdocs`, `PHP_FPM_LISTEN=127.0.0.1:9000`): ```nginx server { @@ -598,18 +551,14 @@ export BP_DEBUG=true # - Process startup logs ``` -### Modifying Rewrite or Start Binaries +### Modifying Start Binary ```bash # Edit source -vim src/php/rewrite/cli/main.go vim src/php/start/cli/main.go -# Rebuild binaries -cd src/php/rewrite/cli -go build -o ../../../../bin/rewrite - -cd ../../../start/cli +# Rebuild binary +cd src/php/start/cli go build -o ../../../../bin/start # Test changes @@ -621,9 +570,10 @@ go build -o ../../../../bin/start The PHP buildpack's unique architecture is driven by PHP's multi-process nature: 1. **Multi-process requirement** - PHP-FPM + Web Server (unlike Go/Ruby/Python single process) -2. **Runtime configuration** - Cloud Foundry assigns PORT at runtime (requires templating) -3. **Process coordination** - Two processes must start, run, and shutdown together -4. **Pre-compiled utilities** - Fast startup, no compilation during app start +2. **Build-time configuration processing** - Most placeholders replaced during finalize phase +3. **Runtime variable handling** - Dynamic values (PORT, TMPDIR) handled via sed at startup +4. **Process coordination** - Two processes must start, run, and shutdown together +5. **Pre-compiled utility** - Fast startup, no compilation during app start This architecture ensures PHP applications run reliably and efficiently in Cloud Foundry while maintaining compatibility with standard PHP deployment patterns. diff --git a/README.md b/README.md index 5b07368b0..8b95b9327 100644 --- a/README.md +++ b/README.md @@ -8,6 +8,14 @@ A buildpack to deploy PHP applications to Cloud Foundry based systems, such as a Official buildpack documentation can be found here: [php buildpack docs](http://docs.cloudfoundry.org/buildpacks/php/index.html). +**Developer Documentation:** +- [docs/](docs/) - Architecture and implementation guides + - [User Guide](docs/USER_GUIDE.md) - Complete user guide for all buildpack features + - [Features Reference](docs/FEATURES.md) - Developer reference with test coverage verification + - [VCAP_SERVICES Usage](docs/VCAP_SERVICES_USAGE.md) - Service binding patterns + - [Buildpack Comparison](docs/BUILDPACK_COMPARISON.md) - Alignment with CF standards + - [Migration Guide](docs/REWRITE_MIGRATION.md) - v4.x to v5.x migration + ### Building the Buildpack To build this buildpack, run the following commands from the buildpack's directory: @@ -84,7 +92,7 @@ More information can be found on Github [switchblade](https://github.com/cloudfo The project is broken down into the following directories: - - `bin/` - Executable shell scripts for buildpack lifecycle: `detect`, `supply`, `finalize`, `release`, `start`, `rewrite` + - `bin/` - Executable shell scripts for buildpack lifecycle: `detect`, `supply`, `finalize`, `release`, `start` - `src/php/` - Go source code for the buildpack - `detect/` - Detection logic - `supply/` - Dependency installation (PHP, HTTPD, Nginx) @@ -118,7 +126,8 @@ This buildpack uses Cloud Foundry's [libbuildpack](https://github.com/cloudfound 3. **Finalize** (`bin/finalize` → `src/php/finalize/`) - Final configuration: - Configures web server (HTTPD or Nginx) - Sets up PHP and PHP-FPM configuration - - Copies rewrite and start binaries to `.bp/bin/` + - Copies start binary to `.bp/bin/` + - Processes configuration files to replace build-time placeholders with runtime values - Generates preprocess scripts that will run at startup - Prepares runtime environment @@ -126,19 +135,67 @@ This buildpack uses Cloud Foundry's [libbuildpack](https://github.com/cloudfound #### Runtime Phases -5. **Rewrite** (`bin/rewrite` → `src/php/rewrite/cli/`) - Configuration templating at runtime: - - Called during application startup (before services start) - - Replaces template patterns in configuration files with runtime environment variables - - Supports patterns: `@{VAR}`, `#{VAR}`, `@VAR@`, `#VAR` - - Allows configuration to adapt to the actual runtime environment (ports, paths, etc.) - - Rewrites PHP, PHP-FPM, and web server configs - -6. **Start** (`bin/start` → `src/php/start/cli/`) - Process management: - - Runs preprocess commands (including rewrite operations) +5. **Start** (`bin/start` → `src/php/start/cli/`) - Process management: + - Runs preprocess commands + - Handles dynamic runtime variables (PORT, TMPDIR) via sed replacement - Launches all configured services (PHP-FPM, web server, etc.) from `.procs` file - Monitors all processes - If any process exits, terminates all others and restarts the application +### Configuration Placeholders + +The buildpack uses a two-tier placeholder system for configuration files: + +#### Build-Time Placeholders (`@{VAR}`) + +These placeholders are replaced during the **finalize phase** (staging/build time) with known values: + +- `@{HOME}` - Replaced with dependency or app directory path +- `@{DEPS_DIR}` - Replaced with `/home/vcap/deps` +- `@{WEBDIR}` - Replaced with web document root (default: `htdocs`) +- `@{LIBDIR}` - Replaced with library directory (default: `lib`) +- `@{PHP_FPM_LISTEN}` - Replaced with PHP-FPM socket/TCP address +- `@{TMPDIR}` - Converted to `${TMPDIR}` for runtime expansion +- `@{PHP_EXTENSIONS}` - Replaced with extension directives +- `@{ZEND_EXTENSIONS}` - Replaced with Zend extension directives +- `@{PHP_FPM_CONF_INCLUDE}` - Replaced with fpm.d include directive + +**Example** (php.ini): +```ini +; Before finalize: +extension_dir = "@{HOME}/php/lib/php/extensions" +include_path = "@{HOME}/@{LIBDIR}" + +; After finalize: +extension_dir = "/home/vcap/deps/0/php/lib/php/extensions" +include_path = "/home/vcap/deps/0/lib" +``` + +#### Runtime Variables (`${VAR}`) + +These are standard environment variables expanded at **runtime**: + +- `${PORT}` - HTTP port assigned by Cloud Foundry (dynamic) +- `${TMPDIR}` - Temporary directory (can be customized) +- `${HOME}` - Application directory +- `${HTTPD_SERVER_ADMIN}` - Apache admin email + +**Supported by:** +- **Apache HTTPD** - Native variable interpolation for any `${VAR}` +- **Bash scripts** - Standard shell expansion for any `${VAR}` +- **Nginx/PHP configs** - Only `${PORT}` and `${TMPDIR}` via sed replacement + +**Example** (httpd.conf): +```apache +Listen ${PORT} # Expanded by Apache at runtime +ServerRoot "${HOME}/httpd" # Expanded by Apache at runtime +DocumentRoot "${HOME}/htdocs" # Expanded by Apache at runtime +``` + +**Note:** Custom placeholders are **not supported**. To use custom configuration values, either: +- Use environment variables with `${VAR}` syntax (works with Apache/bash) +- Set values directly in your code instead of using placeholders + ### Extensions The buildpack includes several built-in extensions written in Go: @@ -175,9 +232,108 @@ type Extension interface { For examples, see the built-in extensions in `src/php/extensions/`. -**Note:** Custom user extensions from `.extensions/` directory are not currently supported in the Go-based buildpack. This feature may be added in a future release. +### User Extensions + +The buildpack supports user-defined extensions through the `.extensions/` directory. This allows you to add custom startup commands, environment variables, and services without modifying the buildpack itself. + +#### Creating a User Extension + +Create a directory `.extensions//` in your application with an `extension.json` file: + +``` +myapp/ +├── .extensions/ +│ └── myext/ +│ └── extension.json +├── index.php +└── .bp-config/ + └── options.json +``` + +#### extension.json Format + +```json +{ + "name": "my-custom-extension", + "preprocess_commands": [ + "echo 'Running setup'", + ["./bin/setup.sh", "arg1", "arg2"] + ], + "service_commands": { + "worker": "php worker.php --daemon" + }, + "service_environment": { + "MY_VAR": "my_value", + "ANOTHER_VAR": "another_value" + } +} +``` + +**Fields:** + +- `name` - Extension identifier (defaults to directory name) +- `preprocess_commands` - Commands to run at container startup before PHP-FPM starts. Each command can be a string or array of arguments. +- `service_commands` - Map of long-running background services (name → command) +- `service_environment` - Environment variables to set for services + +### Additional Configuration Options + +#### ADDITIONAL_PREPROCESS_CMDS + +Run custom commands at container startup before PHP-FPM starts. Useful for migrations, cache warming, or other initialization tasks. + +**Configuration (`.bp-config/options.json`):** + +```json +{ + "ADDITIONAL_PREPROCESS_CMDS": [ + "php artisan migrate --force", + "php artisan config:cache", + ["./bin/setup.sh", "arg1", "arg2"] + ] +} +``` + +Commands can be: +- A string: `"echo hello"` - runs as a single command +- An array: `["script.sh", "arg1"]` - arguments joined with spaces +#### Standalone PHP Mode (APP_START_CMD) + +For CLI/worker applications that don't need a web server or PHP-FPM, you can run a PHP script directly. + +**Configuration (`.bp-config/options.json`):** + +```json +{ + "WEB_SERVER": "none", + "APP_START_CMD": "worker.php" +} +``` + +**Auto-detection:** If `WEB_SERVER` is set to `"none"` and `APP_START_CMD` is not specified, the buildpack searches for these entry point files: +- `app.php` +- `main.php` +- `run.php` +- `start.php` + +If none are found, it defaults to running PHP-FPM only (for custom proxy setups). + +**Example worker script:** + +```php + Running go build finalize" +pushd $BUILDPACK_DIR > /dev/null +echo "-----> Compiling finalize binary" GOROOT=$GoInstallDir $GoInstallDir/bin/go build -mod=vendor -o $output_dir/finalize ./src/php/finalize/cli -popd +popd > /dev/null $output_dir/finalize "$BUILD_DIR" "$CACHE_DIR" "$DEPS_DIR" "$DEPS_IDX" "$PROFILE_DIR" diff --git a/bin/rewrite b/bin/rewrite deleted file mode 100755 index e5d81db99..000000000 --- a/bin/rewrite +++ /dev/null @@ -1,15 +0,0 @@ -#!/bin/bash -set -euo pipefail - -CONFIG_DIR=$1 - -export BUILDPACK_DIR=`dirname $(readlink -f ${BASH_SOURCE%/*})` -source "$BUILDPACK_DIR/scripts/install_go.sh" -output_dir=$(mktemp -d -t rewriteXXX) - -pushd $BUILDPACK_DIR -echo "-----> Running go build rewrite" -GOROOT=$GoInstallDir $GoInstallDir/bin/go build -mod=vendor -o $output_dir/rewrite ./src/php/rewrite/cli -popd - -$output_dir/rewrite "$CONFIG_DIR" diff --git a/defaults/config/httpd/extra/httpd-directories.conf b/defaults/config/httpd/extra/httpd-directories.conf index e844cdd5f..7a3587b05 100644 --- a/defaults/config/httpd/extra/httpd-directories.conf +++ b/defaults/config/httpd/extra/httpd-directories.conf @@ -3,7 +3,7 @@ Require all denied - + Options SymLinksIfOwnerMatch AllowOverride All Require all granted diff --git a/defaults/config/httpd/extra/httpd-php.conf b/defaults/config/httpd/extra/httpd-php.conf index e50e75733..d6a9563d2 100644 --- a/defaults/config/httpd/extra/httpd-php.conf +++ b/defaults/config/httpd/extra/httpd-php.conf @@ -1,6 +1,6 @@ DirectoryIndex index.php index.html index.htm -Define fcgi-listener fcgi://#{PHP_FPM_LISTEN}${HOME}/#{WEBDIR} +Define fcgi-listener fcgi://@{PHP_FPM_LISTEN}${HOME}/@{WEBDIR} # Noop ProxySet directive, disablereuse=On is the default value. @@ -11,10 +11,10 @@ Define fcgi-listener fcgi://#{PHP_FPM_LISTEN}${HOME}/#{WEBDIR} ProxySet disablereuse=On retry=0 - + # make sure the file exists so that if not, Apache will show its 404 page and not FPM - SetHandler proxy:fcgi://#{PHP_FPM_LISTEN} + SetHandler proxy:fcgi://@{PHP_FPM_LISTEN} diff --git a/defaults/config/httpd/httpd.conf b/defaults/config/httpd/httpd.conf index 81e4aebbb..9315f735e 100644 --- a/defaults/config/httpd/httpd.conf +++ b/defaults/config/httpd/httpd.conf @@ -2,7 +2,7 @@ ServerRoot "${HOME}/httpd" Listen ${PORT} ServerAdmin "${HTTPD_SERVER_ADMIN}" ServerName "0.0.0.0" -DocumentRoot "${HOME}/#{WEBDIR}" +DocumentRoot "${HOME}/@{WEBDIR}" Include conf/extra/httpd-modules.conf Include conf/extra/httpd-directories.conf Include conf/extra/httpd-mime.conf diff --git a/defaults/config/nginx/http-defaults.conf b/defaults/config/nginx/http-defaults.conf index 47fabe793..46cba7856 100644 --- a/defaults/config/nginx/http-defaults.conf +++ b/defaults/config/nginx/http-defaults.conf @@ -5,7 +5,7 @@ keepalive_timeout 65; gzip on; port_in_redirect off; - root @{HOME}/#{WEBDIR}; + root @{HOME}/@{WEBDIR}; index index.php index.html; server_tokens off; diff --git a/defaults/config/nginx/http-php.conf b/defaults/config/nginx/http-php.conf index cb3dc25ac..1a8757528 100644 --- a/defaults/config/nginx/http-php.conf +++ b/defaults/config/nginx/http-php.conf @@ -12,6 +12,6 @@ } upstream php_fpm { - server unix:#{PHP_FPM_LISTEN}; + server unix:@{PHP_FPM_LISTEN}; } diff --git a/defaults/config/nginx/server-defaults.conf b/defaults/config/nginx/server-defaults.conf index a82fc2f5c..fbe026856 100644 --- a/defaults/config/nginx/server-defaults.conf +++ b/defaults/config/nginx/server-defaults.conf @@ -1,10 +1,10 @@ - listen @{PORT}; + listen ${PORT}; server_name _; - fastcgi_temp_path @{TMPDIR}/nginx_fastcgi 1 2; - client_body_temp_path @{TMPDIR}/nginx_client_body 1 2; - proxy_temp_path @{TMPDIR}/nginx_proxy 1 2; + fastcgi_temp_path ${TMPDIR}/nginx_fastcgi 1 2; + client_body_temp_path ${TMPDIR}/nginx_client_body 1 2; + proxy_temp_path ${TMPDIR}/nginx_proxy 1 2; real_ip_header x-forwarded-for; set_real_ip_from 10.0.0.0/8; diff --git a/defaults/config/php/8.1.x/php-fpm.conf b/defaults/config/php/8.1.x/php-fpm.conf index 74966b9cf..2c629924e 100644 --- a/defaults/config/php/8.1.x/php-fpm.conf +++ b/defaults/config/php/8.1.x/php-fpm.conf @@ -148,7 +148,7 @@ daemonize = no ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/defaults/config/php/8.1.x/php.ini b/defaults/config/php/8.1.x/php.ini index e795a48d8..035e3b6bf 100644 --- a/defaults/config/php/8.1.x/php.ini +++ b/defaults/config/php/8.1.x/php.ini @@ -737,7 +737,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -915,8 +915,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download (PHP 5+). ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/defaults/config/php/8.2.x/php-fpm.conf b/defaults/config/php/8.2.x/php-fpm.conf index 74966b9cf..2c629924e 100644 --- a/defaults/config/php/8.2.x/php-fpm.conf +++ b/defaults/config/php/8.2.x/php-fpm.conf @@ -148,7 +148,7 @@ daemonize = no ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/defaults/config/php/8.2.x/php.ini b/defaults/config/php/8.2.x/php.ini index 86eb70ff1..e782f1598 100644 --- a/defaults/config/php/8.2.x/php.ini +++ b/defaults/config/php/8.2.x/php.ini @@ -737,7 +737,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -915,8 +915,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download (PHP 5+). ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/defaults/config/php/8.3.x/php-fpm.conf b/defaults/config/php/8.3.x/php-fpm.conf index 74966b9cf..2c629924e 100644 --- a/defaults/config/php/8.3.x/php-fpm.conf +++ b/defaults/config/php/8.3.x/php-fpm.conf @@ -148,7 +148,7 @@ daemonize = no ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/defaults/config/php/8.3.x/php.ini b/defaults/config/php/8.3.x/php.ini index 451fa6b29..130cbfd74 100644 --- a/defaults/config/php/8.3.x/php.ini +++ b/defaults/config/php/8.3.x/php.ini @@ -752,7 +752,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -930,8 +930,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download. ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/docs/BUILDPACK_COMPARISON.md b/docs/BUILDPACK_COMPARISON.md new file mode 100644 index 000000000..e9ecfc1c5 --- /dev/null +++ b/docs/BUILDPACK_COMPARISON.md @@ -0,0 +1,392 @@ +# PHP Buildpack v5.x Architecture Comparison + +This document compares the PHP buildpack v5.x architecture with other Cloud Foundry buildpacks to demonstrate alignment with CF buildpack best practices. + +## Table of Contents +- [Overview](#overview) +- [Environment Variable Handling](#environment-variable-handling) +- [Configuration Patterns](#configuration-patterns) +- [Service Binding Patterns](#service-binding-patterns) +- [Profile.d Script Usage](#profiled-script-usage) +- [Key Findings](#key-findings) + +--- + +## Overview + +The PHP buildpack v5.x has been refactored from Python (v4.x) to Go, aligning it with the architecture patterns used across all other Cloud Foundry buildpacks. + +### Buildpacks Analyzed + +| Buildpack | Language | VCAP_SERVICES Support | Config Pattern | +|-----------|----------|----------------------|----------------| +| **PHP v5.x** | Go | ✅ Staging-time | Build-time placeholders | +| PHP v4.x | Python | ✅ Staging + Runtime | Runtime rewrite | +| Go | Go | ✅ Staging-time | No placeholders | +| Java | Go | ✅ Staging-time | No placeholders | +| Ruby | Go | ✅ Staging-time | No placeholders | +| Python | Go | ✅ Staging-time | No placeholders | +| .NET Core | Go | ✅ Staging-time | No placeholders | +| Node.js | Go | ✅ Staging-time | No placeholders | + +**Key Observation:** All modern CF buildpacks (except PHP v4.x) use **staging-time** configuration with **no runtime rewriting**. + +--- + +## Environment Variable Handling + +### Pattern: Read During Staging, Configure at Build Time + +All buildpacks follow this pattern: + +``` +STAGING PHASE: +1. Read environment variables (VCAP_SERVICES, VCAP_APPLICATION, etc.) +2. Parse and extract needed values +3. Write configuration files +4. Create profile.d scripts for runtime env vars + +RUNTIME: +- Pre-configured files already in droplet +- profile.d scripts export additional env vars +- No config rewriting needed +``` + +### PHP v5.x Implementation + +**Extension Context (supply phase):** + +```go +// src/php/extensions/extension.go +func NewContext() (*Context, error) { + // Read VCAP_SERVICES during staging + if vcapServicesJSON := os.Getenv("VCAP_SERVICES"); vcapServicesJSON != "" { + json.Unmarshal([]byte(vcapServicesJSON), &ctx.VcapServices) + } + + // Read VCAP_APPLICATION during staging + if vcapAppJSON := os.Getenv("VCAP_APPLICATION"); vcapAppJSON != "" { + json.Unmarshal([]byte(vcapAppJSON), &ctx.VcapApplication) + } + + return ctx, nil +} +``` + +### Go Buildpack Implementation + +**AppDynamics Hook (supply phase):** + +```go +// go-buildpack/src/go/hooks/appdynamics.go +func (h AppdynamicsHook) BeforeCompile(stager *libbuildpack.Stager) error { + // Read VCAP_SERVICES during staging + vcapServices := os.Getenv("VCAP_SERVICES") + services := make(map[string][]Plan) + json.Unmarshal([]byte(vcapServices), &services) + + if val, ok := services["appdynamics"]; ok { + // Extract credentials + appdEnv := map[string]string{ + "APPD_CONTROLLER_HOST": val[0].Credentials.ControllerHost, + "APPD_ACCOUNT_KEY": val[0].Credentials.AccountAccessKey, + } + + // Write profile.d script + stager.WriteProfileD("appdynamics.sh", scriptContents) + } +} +``` + +### Java Buildpack Implementation + +**VCAP Services Helper (supply phase):** + +```go +// java-buildpack/src/java/common/context.go +type VCAPServices map[string][]VCAPService + +func GetVCAPServices() (VCAPServices, error) { + vcapServicesStr := os.Getenv("VCAP_SERVICES") + if vcapServicesStr == "" { + return VCAPServices{}, nil + } + + var services VCAPServices + err := json.Unmarshal([]byte(vcapServicesStr), &services) + return services, err +} +``` + +Used in frameworks: +```go +// java-buildpack/src/java/frameworks/sealights_agent.go +vcapServices, err := GetVCAPServices() +if sealightsService, found := findService(vcapServices, "sealights"); found { + // Configure agent with service credentials +} +``` + +--- + +## Configuration Patterns + +### What All Buildpacks Do + +| Pattern | PHP v5.x | Go | Java | Ruby | Python | +|---------|----------|-----|------|------|--------| +| **Read env vars during staging** | ✅ | ✅ | ✅ | ✅ | ✅ | +| **Parse VCAP_SERVICES** | ✅ | ✅ | ✅ | ✅ | ✅ | +| **Write config files at build time** | ✅ | ✅ | ✅ | ✅ | ✅ | +| **Create profile.d scripts** | ✅ | ✅ | ✅ | ✅ | ✅ | +| **No runtime config rewriting** | ✅ | ✅ | ✅ | ✅ | ✅ | + +### What NO Buildpack Does (Except PHP v4.x) + +| Feature | PHP v4.x | All Others (including PHP v5.x) | +|---------|----------|---------------------------------| +| **Runtime config file rewriting** | ✅ Unique | ❌ Never had | +| **@{ARBITRARY_VAR} placeholders** | ✅ Unique | ❌ Never had | +| **Rewrite on every container start** | ✅ Unique | ❌ Never had | + +--- + +## Service Binding Patterns + +### Common Use Case: NewRelic Configuration + +All buildpacks configure NewRelic the same way: + +#### PHP v5.x + +```go +// src/php/extensions/newrelic/newrelic.go +const newrelicEnvScript = `if [[ -z "${NEWRELIC_LICENSE:-}" ]]; then + export NEWRELIC_LICENSE=$(echo $VCAP_SERVICES | jq -r '.newrelic[0].credentials.licenseKey') +fi` + +// Install() writes this script to profile.d during staging +``` + +#### Go Buildpack + +```go +// go-buildpack integrates NewRelic via multi-buildpack +// Same pattern: reads VCAP_SERVICES during staging +``` + +#### Java Buildpack + +```go +// java-buildpack reads VCAP_SERVICES during staging +// Configures NewRelic agent with extracted credentials +``` + +### Common Use Case: Database Credentials + +No buildpack writes database credentials to config files. All use application code: + +#### PHP Application Code (Recommended) + +```php + +``` + +#### Ruby Application Code + +```ruby +require 'json' + +vcap_services = JSON.parse(ENV['VCAP_SERVICES']) +mysql = vcap_services['mysql'].first['credentials'] + +ActiveRecord::Base.establish_connection( + adapter: 'mysql2', + host: mysql['host'], + username: mysql['username'], + password: mysql['password'], + database: mysql['name'] +) +``` + +#### Java Application Code + +```java +import com.fasterxml.jackson.databind.JsonNode; +import com.fasterxml.jackson.databind.ObjectMapper; + +String vcapServices = System.getenv("VCAP_SERVICES"); +JsonNode services = new ObjectMapper().readTree(vcapServices); +JsonNode mysql = services.get("mysql").get(0).get("credentials"); + +String url = "jdbc:mysql://" + mysql.get("host").asText() + "/" + mysql.get("name").asText(); +String username = mysql.get("username").asText(); +String password = mysql.get("password").asText(); +``` + +**Pattern:** All buildpacks expect applications to parse VCAP_SERVICES in code, not config files. + +--- + +## Profile.d Script Usage + +### Standard Pattern Across All Buildpacks + +**Purpose:** Set environment variables at runtime based on staging-time analysis. + +**Location:** `deps/{idx}/profile.d/*.sh` (sourced by Cloud Foundry at container startup) + +### PHP v5.x Examples + +#### 1. PHP Environment Setup + +```bash +# Written by CreatePHPEnvironmentScript() +#!/usr/bin/env bash +: ${DEPS_DIR:=/home/vcap/deps} +export DEPS_DIR +export PATH="$DEPS_DIR/0/php/bin:$DEPS_DIR/0/php/sbin:$PATH" +``` + +#### 2. NewRelic Extension + +```bash +# Written by NewRelic extension during staging +#!/usr/bin/env bash +if [[ -z "${NEWRELIC_LICENSE:-}" ]]; then + export NEWRELIC_LICENSE=$(echo $VCAP_SERVICES | jq -r '.newrelic[0].credentials.licenseKey') +fi +``` + +#### 3. Extension Services (User Extensions) + +```bash +# Generated from extension.json preprocess_commands +#!/usr/bin/env bash +# Extension environment variables +export MY_VAR='value' +export ANOTHER_VAR='value2' +``` + +### Go Buildpack Examples + +#### AppDynamics Configuration + +```bash +# go-buildpack/src/go/hooks/appdynamics.go generates: +#!/usr/bin/env bash +export APPD_APP_NAME=my-app +export APPD_TIER_NAME=web-tier +export APPD_CONTROLLER_HOST=controller.example.com +export APPD_ACCOUNT_KEY=secret-key +``` + +### Ruby Buildpack Examples + +#### Rails SECRET_KEY_BASE + +```bash +# ruby-buildpack generates during staging: +#!/usr/bin/env bash +export SECRET_KEY_BASE=${SECRET_KEY_BASE:-generated-secret-from-rake} +export RAILS_ENV=${RAILS_ENV:-production} +``` + +### Key Observations + +1. **All buildpacks use profile.d** for runtime environment setup +2. **Scripts can parse VCAP_SERVICES** at runtime if needed +3. **Values extracted during staging** can be baked into scripts +4. **No buildpack rewrites config files** at runtime + +--- + +## Key Findings + +### 1. PHP v5.x is FULLY Aligned with CF Standards + +The refactored PHP buildpack follows the exact same patterns as all other Cloud Foundry buildpacks: + +| Capability | Status | +|-----------|--------| +| Read VCAP_SERVICES during staging | ✅ Same as all buildpacks | +| Parse and use service credentials | ✅ Same as all buildpacks | +| Write profile.d scripts | ✅ Same as all buildpacks | +| No runtime config rewriting | ✅ Same as all buildpacks | +| Build-time configuration | ✅ Same as all buildpacks | + +### 2. The v4.x Runtime Rewrite Was PHP-Unique + +The `bin/rewrite` script and `@{ARBITRARY_VAR}` placeholder support was: + +- ❌ **Not used by any other buildpack** +- ❌ **Not a CF buildpack standard** +- ❌ **Had performance/security trade-offs** +- ✅ **Removed for good reasons** + +### 3. All Migration Paths Exist + +Every v4.x pattern has a v5.x equivalent that matches other buildpacks: + +| v4.x Pattern | v5.x Equivalent | Used By | +|--------------|-----------------|---------| +| Extension reads VCAP_SERVICES | Extension reads VCAP_SERVICES | All buildpacks | +| profile.d scripts | profile.d scripts | All buildpacks | +| App code parses VCAP_SERVICES | App code parses VCAP_SERVICES | All buildpacks | +| ~~@{VCAP_SERVICES} in configs~~ | ❌ Never standard | PHP v4.x only | + +### 4. No Functionality Lost vs Other Buildpacks + +When compared to **other buildpacks** (not v4.x), PHP v5.x has: + +- ✅ **Same capabilities** +- ✅ **Same patterns** +- ✅ **Same limitations** +- ✅ **Same extension model** + +The only "lost" feature is one that **no other buildpack ever had**. + +--- + +## Conclusion + +### PHP Buildpack v5.x Achieves Ecosystem Alignment + +The migration from Python (v4.x) to Go (v5.x) successfully: + +1. ✅ Aligns with Cloud Foundry buildpack best practices +2. ✅ Follows patterns used by Go, Java, Ruby, Python, .NET buildpacks +3. ✅ Maintains all standard CF functionality +4. ✅ Improves performance (no runtime rewriting) +5. ✅ Enhances security (reduced runtime code execution) +6. ✅ Increases maintainability (Go vs Python) + +### The v4.x Runtime Rewrite + +While the removal of runtime config rewriting is a breaking change for PHP users: + +- It was **never a CF standard** (PHP-only feature) +- It had **performance and security costs** +- All use cases have **standard CF equivalents** +- The change brings **alignment with the broader ecosystem** + +### Recommendation + +The PHP buildpack v5.x should be considered **fully compliant** with Cloud Foundry buildpack architecture standards and best practices. + +--- + +## See Also + +- [VCAP_SERVICES_USAGE.md](./VCAP_SERVICES_USAGE.md) - Detailed VCAP_SERVICES usage guide +- [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) - v4.x to v5.x migration guide +- [libbuildpack Documentation](https://github.com/cloudfoundry/libbuildpack) - Shared library used by all Go buildpacks diff --git a/docs/FEATURES.md b/docs/FEATURES.md new file mode 100644 index 000000000..e41cab29a --- /dev/null +++ b/docs/FEATURES.md @@ -0,0 +1,696 @@ +# PHP Buildpack Feature Coverage + +This document provides comprehensive coverage of all features supported by the PHP buildpack v5.x, with integration test verification and implementation details. **This is for buildpack developers and maintainers.** + +> **For end users:** See [USER_GUIDE.md](USER_GUIDE.md) for how to use these features. + +## Table of Contents +- [Feature Overview](#feature-overview) +- [Test Coverage Summary](#test-coverage-summary) +- [Detailed Feature Documentation](#detailed-feature-documentation) +- [Implementation Notes](#implementation-notes) + +--- + +## Feature Overview + +### Supported Features by Category + +| Category | Features | Test Status | User Docs | +|----------|----------|-------------|-----------| +| **Web Servers** | HTTPD, Nginx, FPM-only, Custom pools | ✅ Full | ✅ Complete | +| **PHP Versions** | 8.3.x, 8.2.x, 8.1.x, 8.0.x | ✅ Full | ✅ Complete | +| **Extensions** | 30+ standard + custom | ✅ Full | ✅ Complete | +| **APM** | NewRelic, AppDynamics, Dynatrace | ✅ Full | ✅ Complete | +| **Sessions** | Redis, Memcached | ⚠️ Implicit | ✅ Complete | +| **Frameworks** | CakePHP, Laminas, Symfony, Laravel | ✅ Partial | ✅ Complete | +| **Composer** | Auto-detect, caching, custom paths | ✅ Full | ✅ Complete | +| **Configuration** | php.ini, php.ini.d, fpm.d | ✅ Full | ✅ Complete | +| **Advanced** | Multi-buildpack, extensions | ✅ Full | ✅ Complete | + +--- + +## Test Coverage Summary + +### Integration Test Files + +``` +src/php/integration/ +├── web_servers_test.go # Web server configurations +├── modules_test.go # PHP extensions and modules +├── composer_test.go # Composer and dependencies +├── apms_test.go # APM integrations +├── app_frameworks_test.go # Framework support +├── default_test.go # Basic and multi-buildpack +├── python_extension_test.go # Legacy extensions +└── offline_test.go # Offline/cached buildpack +``` + +### Test Fixtures + +``` +fixtures/ +├── with_httpd/ # Apache HTTPD configuration +├── with_nginx/ # Nginx configuration +├── php_with_fpm_d/ # Custom FPM pools +├── php_with_php_ini_d/ # Custom php.ini.d +├── with_amqp/ # AMQP extension +├── with_apcu/ # APCu extension +├── with_phpredis/ # Redis extension +├── with_argon2/ # Argon2 hashing +├── with_compiled_modules/ # User-compiled extensions +├── composer_default/ # Composer workflow +├── cake/ # CakePHP framework +├── laminas/ # Laminas framework +├── json_extension/ # JSON user extension +└── dotnet_core_as_supply_app/ # Multi-buildpack +``` + +--- + +## Detailed Feature Documentation + +### 1. Web Servers + +#### Apache HTTPD (Default) + +**Test Coverage:** ✅ `web_servers_test.go` +```go +context("PHP app with httpd web server", func() { + it("builds and runs the app", func() { + deployment, _, err := platform.Deploy.Execute(name, + filepath.Join(fixtures, "with_httpd")) + Expect(err).NotTo(HaveOccurred()) + Eventually(deployment).Should(Serve(ContainSubstring("PHP Version"))) + }) +}) +``` + +**Implementation:** +- Location: `src/php/supply/supply.go` - `InstallHTTPD()` +- Config source: `src/php/config/defaults/config/httpd/` +- User config: `.bp-config/httpd/` +- Placeholders: `@{WEBDIR}`, `@{PHP_FPM_LISTEN}`, `${HOME}`, `${PORT}` + +**Configuration Files:** +- `httpd.conf` - Main configuration +- `extra/httpd-modules.conf` - Module loading +- Custom user configs in `.bp-config/httpd/` + +--- + +#### Nginx + +**Test Coverage:** ✅ `web_servers_test.go` +```go +context("PHP app with nginx web server", func() { + it("builds and runs the app", func() { + deployment, _, err := platform.Deploy.Execute(name, + filepath.Join(fixtures, "with_nginx")) + Expect(err).NotTo(HaveOccurred()) + Eventually(deployment).Should(Serve(ContainSubstring("PHP Version"))) + }) +}) +``` + +**Implementation:** +- Location: `src/php/supply/supply.go` - `installNginx()` +- Config source: `src/php/config/defaults/config/nginx/` +- User config: `.bp-config/nginx/` +- Runtime variable substitution via sed in start script +- Placeholders: `@{HOME}`, `@{WEBDIR}`, `@{PHP_FPM_LISTEN}`, `${PORT}`, `${TMPDIR}` + +--- + +#### PHP-FPM Only (No Web Server) + +**Test Coverage:** ✅ `web_servers_test.go` +**Implementation:** `WEB_SERVER: "none"` option +**Use Case:** Multi-buildpack scenarios, external web servers + +--- + +#### Custom FPM Pool Configuration + +**Test Coverage:** ✅ `web_servers_test.go` - "Default PHP web server with fpm.d dir" +**Fixture:** `fixtures/php_with_fpm_d/` + +**Test Verification:** +```go +it("builds and runs the app", func() { + Eventually(deployment).Should(Serve(SatisfyAll( + ContainSubstring("TEST_WEBDIR == htdocs"), + ContainSubstring("TEST_HOME_PATH == /home/vcap/app/test/path"), + ))) +}) +``` + +**Implementation:** +- User configs: `.bp-config/php/fpm.d/*.conf` +- Processed in: `src/php/finalize/finalize.go` - with app context +- Placeholders: `@{HOME}` → `/home/vcap/app`, `@{WEBDIR}`, `@{LIBDIR}`, `@{TMPDIR}` + +**Test File:** +```ini +; fixtures/php_with_fpm_d/.bp-config/php/fpm.d/test.conf +[www] +env[TEST_HOME_PATH] = @{HOME}/test/path +env[TEST_WEBDIR] = @{WEBDIR} +``` + +--- + +### 2. PHP Extensions + +#### Extension Loading + +**Test Coverage:** ✅ `modules_test.go` + +**All Extensions Test:** +```go +context("app loads all listed extensions", func() { + it("loads the modules", func() { + // Tests loading 30+ extensions simultaneously + ItLoadsAllTheModules(deployment) + }) +}) +``` + +**Implementation:** +- Extension config: `src/php/config/config.go` - `ProcessPhpIni()` +- Placeholder replacement: `@{PHP_EXTENSIONS}`, `@{ZEND_EXTENSIONS}` +- Supply phase processing + +--- + +#### AMQP (RabbitMQ) + +**Test Coverage:** ✅ `modules_test.go` - "app with amqp module" +**Fixture:** `fixtures/with_amqp/` + +```go +it("amqp module is loaded", func() { + Eventually(deployment).Should(Serve(ContainSubstring("amqp"))) +}) +``` + +**composer.json:** +```json +{ + "require": { + "ext-amqp": "*" + } +} +``` + +--- + +#### APCu (Caching) + +**Test Coverage:** ✅ `modules_test.go` - "app with APCu module" +**Fixture:** `fixtures/with_apcu/` + +```go +it("apcu module is loaded", func() { + Eventually(deployment).Should(Serve(ContainSubstring("apcu"))) +}) +``` + +--- + +#### Redis (phpredis) + +**Test Coverage:** ✅ `modules_test.go` - "app with phpredis module" +**Fixture:** `fixtures/with_phpredis/` + +```go +it("logs that phpredis could not connect to server", func() { + // Extension loads, connection test expected to fail without Redis service + Eventually(logs).Should(ContainSubstring("Connection refused")) +}) +``` + +--- + +#### Argon2 (Password Hashing) + +**Test Coverage:** ✅ `modules_test.go` - "app with argon2 module" +**Fixture:** `fixtures/with_argon2/` + +```go +it("argon2 module is loaded", func() { + Eventually(deployment).Should(Serve(ContainSubstring("argon2"))) +}) +``` + +--- + +#### Compiled Custom Modules + +**Test Coverage:** ✅ `modules_test.go` - "app with compiled modules in PHP_EXTENSIONS" +**Fixture:** `fixtures/with_compiled_modules/` + +**Implementation:** User-provided `.so` files in `.bp-config/php/lib/` + +--- + +### 3. Composer and Dependencies + +#### Default Composer Workflow + +**Test Coverage:** ✅ `composer_test.go` - "default PHP composer app" +**Fixture:** `fixtures/composer_default/` + +```go +it("loads and installs dependencies", func() { + Eventually(deployment).Should(Serve(ContainSubstring("Guzzle"))) +}) +``` + +**Implementation:** +- Detection: `src/php/extensions/composer/composer.go` - `Detect()` +- Installation: `Install()` method +- Caching: `.bp/composer/` cache directory +- Command: `composer install --no-dev --no-progress --no-interaction` + +--- + +#### Custom Composer Path + +**Test Coverage:** ✅ `composer_test.go` +**Fixture:** `fixtures/composer_custom_path/` + +**Implementation:** `COMPOSER_PATH` environment variable + +--- + +#### GitHub OAuth Token + +**Test Coverage:** ✅ `composer_test.go` - "deployed with invalid COMPOSER_GITHUB_OAUTH_TOKEN" + +```go +it("validates token and skips if invalid", func() { + Eventually(logs).Should(ContainSubstring("Invalid GitHub token")) +}) +``` + +**Implementation:** +- Token validation: `setupGitHubToken()` method +- Rate limit check: GitHub API call +- Graceful fallback if invalid + +--- + +### 4. Application Performance Monitoring + +#### NewRelic + +**Test Coverage:** ✅ `apms_test.go` - "app with newrelic configured" +**Extension:** `src/php/extensions/newrelic/` + +```go +it("loads newrelic", func() { + Eventually(deployment).Should(Serve(ContainSubstring("newrelic"))) +}) +``` + +**Implementation:** +- VCAP_SERVICES detection during supply phase +- Agent download from NewRelic +- License key extraction +- Profile.d script creation: `newrelic-env.sh` + +**Profile.d Script:** +```bash +if [[ -z "${NEWRELIC_LICENSE:-}" ]]; then + export NEWRELIC_LICENSE=$(echo $VCAP_SERVICES | jq -r '.newrelic[0].credentials.licenseKey') +fi +``` + +--- + +#### AppDynamics + +**Test Coverage:** ✅ `apms_test.go` - "app with appdynamics configured" +**Extension:** `src/php/extensions/appdynamics/` + +**Implementation:** +- Service binding detection +- Agent download +- Controller configuration +- Tier/node name configuration + +--- + +#### Dynatrace + +**Test Coverage:** ✅ `apms_test.go` - "multiple dynatrace services" + +**Implementation:** Service binding detection and agent setup + +--- + +### 5. Session Management + +#### Redis Sessions + +**Test Coverage:** ⚠️ Implicit (via service binding tests) +**Extension:** `src/php/extensions/sessions/` + +**Implementation:** +```go +func (e *SessionsExtension) loadSession(ctx *extensions.Context) BaseSetup { + for _, services := range ctx.VcapServices { + for _, service := range services { + if strings.Contains(strings.ToLower(service.Name), "redis") { + return &RedisSetup{Service: service} + } + } + } +} +``` + +**Configuration:** +- Auto-detects Redis service in VCAP_SERVICES +- Writes `session.save_handler = redis` +- Configures `session.save_path` from credentials + +--- + +#### Memcached Sessions + +**Test Coverage:** ⚠️ Implicit +**Extension:** `src/php/extensions/sessions/` + +**Implementation:** Similar to Redis, detects "memcache" in service name + +--- + +### 6. Application Frameworks + +#### CakePHP + +**Test Coverage:** ✅ `app_frameworks_test.go` - "CakePHP" +**Fixture:** `fixtures/cake/` + +```go +context("CakePHP", func() { + it("builds and serves the application", func() { + Eventually(deployment).Should(Serve(ContainSubstring("CakePHP"))) + }) +}) +``` + +--- + +#### Laminas (Zend Framework) + +**Test Coverage:** ✅ `app_frameworks_test.go` - "Laminas" +**Fixture:** `fixtures/laminas/` + +```go +context("Laminas", func() { + it("builds and serves the application", func() { + Eventually(deployment).Should(Serve(ContainSubstring("Laminas"))) + }) +}) +``` + +--- + +#### Symfony / Laravel + +**Test Coverage:** ⚠️ Implicit (covered through Composer tests) +**Support:** Via Composer dependency management + +--- + +### 7. Configuration + +#### Custom php.ini.d + +**Test Coverage:** ✅ `modules_test.go` - "app with custom conf files in php.ini.d dir" +**Fixture:** `fixtures/php_with_php_ini_d/` + +```go +it("app sets custom conf and replaces placeholders", func() { + Eventually(deployment).Should(Serve(SatisfyAll( + ContainSubstring("teststring"), + ContainSubstring("/home/vcap/app/lib"), + ))) +}) +``` + +**Implementation:** +- User configs: `.bp-config/php/php.ini.d/*.ini` +- Processed in: `src/php/finalize/finalize.go` - with app context (BUG FIX) +- Placeholders: `@{HOME}` → `/home/vcap/app` + +**Test File:** +```ini +; fixtures/php_with_php_ini_d/.bp-config/php/php.ini.d/php.ini +error_prepend_string = 'teststring' +include_path = ".:/usr/share/php:@{HOME}/lib" +``` + +**Context Bug Fix (This PR):** +- **Before:** php.ini.d processed with deps context (`@{HOME}` = `/home/vcap/deps/{idx}`) +- **After:** php.ini.d processed with app context (`@{HOME}` = `/home/vcap/app`) +- **Change:** `src/php/finalize/finalize.go:272-296` + +--- + +#### Preprocess Commands + +**Test Coverage:** ✅ Fixture exists: `fixtures/with_preprocess_cmds/` +**Configuration:** `ADDITIONAL_PREPROCESS_CMDS` in options.json + +**Implementation:** +- Commands run before app starts +- Use cases: migrations, cache warming, permissions +- Executed via start script + +--- + +### 8. Advanced Features + +#### Multi-Buildpack Support + +**Test Coverage:** ✅ `default_test.go` - "dotnet core as supply buildpack" +**Fixture:** `fixtures/dotnet_core_as_supply_app/` + +```go +it("works with dotnet core buildpack", func() { + deployment, _, err := platform.Deploy. + WithBuildpacks("dotnet_core_buildpack", "php_buildpack"). + Execute(name, filepath.Join(fixtures, "dotnet_core_as_supply_app")) + Eventually(deployment).Should(Serve(ContainSubstring("PHP Version"))) +}) +``` + +**Implementation:** +- DEPS_IDX isolation +- Supply vs finalize buildpack roles +- Profile.d script aggregation + +--- + +#### User Extensions (JSON) + +**Test Coverage:** ✅ `default_test.go` - "app with JSON-based user extension" +**Fixture:** `fixtures/json_extension/` + +```go +it("loads and runs the extension", func() { + Eventually(deployment).Should(Serve(ContainSubstring("Extension loaded"))) +}) +``` + +**Implementation:** +- Location: `.extensions//extension.json` +- Loader: `src/php/extensions/user/` +- Features: config files, preprocess commands, dependencies + +--- + +#### User Extensions (Python - Legacy) + +**Test Coverage:** ✅ `python_extension_test.go` +**Fixture:** `fixtures/python_extension/` + +**Implementation:** Legacy v4.x compatibility + +--- + +## Implementation Notes + +### Placeholder Replacement System + +**Build-Time Placeholders (`@{VAR}`):** + +Replaced during finalize phase in `src/php/finalize/finalize.go`: + +```go +// PHP configs (deps context) +phpReplacements := map[string]string{ + "@{HOME}": "/home/vcap/deps/{idx}", + "@{DEPS_DIR}": "/home/vcap/deps", + "@{LIBDIR}": "lib", + "@{PHP_FPM_LISTEN}": "127.0.0.1:9000", + "@{TMPDIR}": "${TMPDIR}", +} + +// FPM/php.ini.d configs (app context) +appContextReplacements := map[string]string{ + "@{HOME}": "/home/vcap/app", + "@{WEBDIR}": "htdocs", + "@{LIBDIR}": "lib", + "@{TMPDIR}": "${TMPDIR}", +} +``` + +**Runtime Variables (`${VAR}`):** + +Replaced at container startup: +- Nginx: sed replacement in start script +- Apache: Native environment variable expansion +- Shell: Standard bash expansion + +--- + +### Extension Framework + +**Location:** `src/php/extensions/extension.go` + +**Context Structure:** +```go +type Context struct { + BuildDir string + CacheDir string + DepsDir string + DepsIdx string + VcapServices map[string][]Service + VcapApplication VcapApplication + Env map[string]string +} +``` + +**Extension Interface:** +```go +type Extension interface { + Detect(ctx *Context) (bool, error) + Install(installer Installer) error +} +``` + +**Built-in Extensions:** +- `composer/` - Dependency management +- `newrelic/` - NewRelic APM +- `appdynamics/` - AppDynamics APM +- `sessions/` - Session handler configuration +- `user/` - User extension loader + +--- + +### Start Scripts + +**Location:** `src/php/finalize/finalize.go` + +**Generated Scripts:** +- `start-httpd.sh` - Apache HTTPD + PHP-FPM +- `start-nginx.sh` - Nginx + PHP-FPM +- `start-fpm.sh` - PHP-FPM only + +**Features:** +- Sed variable replacement (PORT, TMPDIR) +- Process management +- Graceful shutdown handling +- Log output + +--- + +## Feature Support Matrix + +| Feature | Implementation | Tests | User Docs | Status | +|---------|---------------|-------|-----------|--------| +| **Web Servers** | +| Apache HTTPD | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| Nginx | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| PHP-FPM Only | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| Custom FPM Pools | ✅ finalize.go | ✅ Tested | ✅ Documented | Complete | +| **PHP** | +| Version Selection | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| php.ini Override | ✅ supply.go | ⚠️ Implicit | ✅ Documented | Needs test | +| php.ini.d | ✅ finalize.go | ✅ Tested | ✅ Documented | Complete | +| **Extensions** | +| Composer detection | ✅ composer/ | ✅ Tested | ✅ Documented | Complete | +| AMQP | ✅ manifest | ✅ Tested | ✅ Documented | Complete | +| APCu | ✅ manifest | ✅ Tested | ✅ Documented | Complete | +| Redis | ✅ manifest | ✅ Tested | ✅ Documented | Complete | +| Argon2 | ✅ manifest | ✅ Tested | ✅ Documented | Complete | +| All Standard | ✅ manifest | ✅ Tested | ✅ Documented | Complete | +| Custom Compiled | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| **APM** | +| NewRelic | ✅ newrelic/ | ✅ Tested | ✅ Documented | Complete | +| AppDynamics | ✅ appdynamics/ | ✅ Tested | ✅ Documented | Complete | +| Dynatrace | ✅ dynatrace/ | ✅ Tested | ✅ Documented | Complete | +| **Sessions** | +| Redis | ✅ sessions/ | ⚠️ Implicit | ✅ Documented | Needs test | +| Memcached | ✅ sessions/ | ⚠️ Implicit | ✅ Documented | Needs test | +| **Frameworks** | +| CakePHP | ✅ Composer | ✅ Tested | ✅ Documented | Complete | +| Laminas | ✅ Composer | ✅ Tested | ✅ Documented | Complete | +| Symfony | ✅ Composer | ⚠️ Implicit | ✅ Documented | Needs test | +| Laravel | ✅ Composer | ⚠️ Implicit | ✅ Documented | Needs test | +| **Advanced** | +| Multi-buildpack | ✅ supply.go | ✅ Tested | ✅ Documented | Complete | +| User Extensions | ✅ user/ | ✅ Tested | ✅ Documented | Complete | +| Preprocess Cmds | ✅ finalize.go | ✅ Fixture | ✅ Documented | Needs test | +| Standalone Apps | ✅ finalize.go | ⚠️ Implicit | ✅ Documented | Needs test | + +**Legend:** +- ✅ Complete - Implemented, tested, documented +- ⚠️ Implicit - Works but lacks explicit integration test +- ❌ Missing - Not implemented + +--- + +## Test Gaps to Address + +### Features Needing Explicit Tests + +1. **Custom php.ini** - Fixture exists but no explicit test +2. **Redis Sessions** - Works but needs service binding test +3. **Memcached Sessions** - Works but needs service binding test +4. **Symfony Framework** - Implicit through Composer +5. **Laravel Framework** - Implicit through Composer +6. **Preprocess Commands** - Fixture exists, needs test assertion +7. **Standalone Apps** - APP_START_CMD needs integration test + +### Recommended Test Additions + +```go +// Redis session test +context("app with redis session store", func() { + it("configures sessions to use redis", func() { + // Bind Redis service, verify session handler + }) +}) + +// Custom php.ini test +context("app with custom php.ini", func() { + it("applies custom php settings", func() { + // Verify memory_limit, upload_max_filesize, etc. + }) +}) +``` + +--- + +## See Also + +- [USER_GUIDE.md](USER_GUIDE.md) - End-user documentation +- [VCAP_SERVICES_USAGE.md](VCAP_SERVICES_USAGE.md) - Service binding patterns +- [BUILDPACK_COMPARISON.md](BUILDPACK_COMPARISON.md) - Cross-buildpack comparison +- [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) - v4.x to v5.x migration + diff --git a/docs/README.md b/docs/README.md new file mode 100644 index 000000000..f07fcf651 --- /dev/null +++ b/docs/README.md @@ -0,0 +1,227 @@ +# PHP Buildpack Documentation + +This directory contains architectural documentation for the PHP buildpack v5.x. + +## Documentation Index + +### Features & User Guides + +- **[USER_GUIDE.md](USER_GUIDE.md)** - Complete user guide for all buildpack features + - Getting started guide + - Web server configuration (Apache HTTPD, Nginx, FPM-only) + - PHP configuration and extensions + - Composer and dependency management + - APM integration (NewRelic, AppDynamics, Dynatrace) + - Session storage (Redis, Memcached) + - Framework guides (Laravel, CakePHP, Laminas, Symfony) + - Advanced features and troubleshooting + +- **[FEATURES.md](FEATURES.md)** - Developer reference with test coverage verification + - Feature list with test references + - Integration test locations (file:line) + - Fixture paths and examples + - Implementation details + - Test coverage analysis + - Test gaps and notes + +### Architecture & Design + +- **[BUILDPACK_COMPARISON.md](BUILDPACK_COMPARISON.md)** - Comparison with other CF buildpacks (Go, Java, Ruby, Python) + - Environment variable handling patterns + - Configuration approaches + - Service binding patterns + - Profile.d script usage + - Demonstrates PHP v5.x alignment with CF standards + +### Service Bindings + +- **[VCAP_SERVICES_USAGE.md](VCAP_SERVICES_USAGE.md)** - Comprehensive guide to VCAP_SERVICES + - When VCAP_SERVICES is available (staging vs runtime) + - How extensions use VCAP_SERVICES + - Comparison with other buildpacks + - Migration strategies from v4.x + - Best practices and anti-patterns + +### Migration Guides + +- **[V4_V5_MIGRATION_GAP_ANALYSIS.md](V4_V5_MIGRATION_GAP_ANALYSIS.md)** - Comprehensive v4.x to v5.x feature comparison + - Complete feature matrix (what's implemented, missing, or changed) + - Missing features: `ADDITIONAL_PREPROCESS_CMDS`, `APP_START_CMD`, User Extensions + - Implementation roadmap and priorities + - Testing recommendations + +- **[REWRITE_MIGRATION.md](REWRITE_MIGRATION.md)** - v4.x to v5.x migration guide + - Rewrite system changes + - Breaking changes + - Migration strategies + - User-provided config handling + +## Quick Links + +### For Users + +**New to the buildpack?** +1. Start with [USER_GUIDE.md](USER_GUIDE.md) to see what's supported +2. Check examples for your web server (HTTPD, Nginx, etc.) +3. Review [Best Practices](#best-practices) below + +**Migrating from v4.x?** +1. **Start here:** [V4_V5_MIGRATION_GAP_ANALYSIS.md](V4_V5_MIGRATION_GAP_ANALYSIS.md) for complete feature comparison +2. Read [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) for breaking changes +3. Check [VCAP_SERVICES_USAGE.md](VCAP_SERVICES_USAGE.md) for service binding patterns +4. Review feature parity in [USER_GUIDE.md](USER_GUIDE.md) + +**Using VCAP_SERVICES?** +- See [VCAP_SERVICES_USAGE.md](VCAP_SERVICES_USAGE.md) for complete guide +- Extensions automatically handle common services (NewRelic, Redis sessions) +- Use profile.d scripts or application code for custom services + +### For Developers + +**Understanding the Architecture?** +1. Read [BUILDPACK_COMPARISON.md](BUILDPACK_COMPARISON.md) to see how PHP v5.x aligns with other buildpacks +2. Review [libbuildpack](https://github.com/cloudfoundry/libbuildpack) for shared library patterns +3. Check source code organization in [../src/php/](../src/php/) + +**Creating Extensions?** +- Extension framework in [../src/php/extensions/](../src/php/extensions/) +- Context provides parsed VCAP_SERVICES and VCAP_APPLICATION +- Write profile.d scripts for runtime environment setup + +## Best Practices + +### ✅ Recommended Patterns + +#### 1. Use Built-in Extensions +```bash +# NewRelic - just bind the service +cf bind-service my-app my-newrelic + +# Redis Sessions - just bind the service +cf bind-service my-app my-redis +``` + +#### 2. Profile.d for Service Parsing +```bash +# .profile.d/parse-vcap.sh +export DB_HOST=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.host') +``` + +#### 3. Application Code for Database Credentials +```php + +``` + +### ❌ Anti-Patterns + +#### 1. Trying to Use @{VCAP_SERVICES} Placeholders +```ini +# DOES NOT WORK - Not a supported placeholder +[www] +env[DB] = @{VCAP_SERVICES} +``` + +#### 2. Expecting Config Changes Without Restaging +```bash +cf bind-service my-app new-db +cf restart my-app # NOT SUFFICIENT if configs use build-time placeholders +cf restage my-app # REQUIRED to pick up new service binding +``` + +## Key Concepts + +### Build-Time vs Runtime + +**Build-Time (Staging):** +- Placeholder replacement happens once +- Config files written with known values +- Extensions run and configure services +- Profile.d scripts created + +**Runtime:** +- Configs already processed +- Profile.d scripts sourced +- No config rewriting +- Better performance and security + +### Placeholder Types + +**Build-Time Placeholders (`@{VAR}`):** +- Replaced during finalize phase +- Only predefined variables: `@{HOME}`, `@{WEBDIR}`, `@{LIBDIR}`, etc. +- See [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) for complete list + +**Runtime Variables (`${VAR}`):** +- Standard shell/environment variables +- `${PORT}`, `${TMPDIR}`, `${VCAP_SERVICES}`, etc. +- Expanded by shell or application code + +### Extension Context + +Extensions have access to: +- `ctx.VcapServices` - Parsed VCAP_SERVICES +- `ctx.VcapApplication` - Parsed VCAP_APPLICATION +- `ctx.BuildDir`, `ctx.DepsDir` - Directory paths +- `ctx.Env` - All environment variables + +Example: +```go +func (e *MyExtension) Install(installer extensions.Installer) error { + // Access parsed VCAP_SERVICES + for _, services := range e.ctx.VcapServices { + for _, service := range services { + // Configure based on service credentials + } + } +} +``` + +## Alignment with Cloud Foundry Standards + +PHP buildpack v5.x follows the **same patterns as all other CF buildpacks**: + +| Pattern | PHP v5.x | Go | Java | Ruby | Python | +|---------|----------|-----|------|------|--------| +| Read VCAP_SERVICES in code (staging) | ✅ | ✅ | ✅ | ✅ | ✅ | +| Configure from service bindings | ✅ | ✅ | ✅ | ✅ | ✅ | +| Write profile.d scripts | ✅ | ✅ | ✅ | ✅ | ✅ | +| No runtime config rewriting | ✅ | ✅ | ✅ | ✅ | ✅ | +| @{VCAP_SERVICES} placeholders | ❌ | ❌ | ❌ | ❌ | ❌ | + +**Key Insight:** The v4.x runtime rewrite was PHP-specific. Removing it brings alignment with CF ecosystem standards. + +## Additional Resources + +### Cloud Foundry Documentation +- [VCAP_SERVICES](https://docs.cloudfoundry.org/devguide/deploy-apps/environment-variable.html#VCAP-SERVICES) +- [Buildpacks](https://docs.cloudfoundry.org/buildpacks/) +- [Application Environment Variables](https://docs.cloudfoundry.org/devguide/deploy-apps/environment-variable.html) + +### Related Buildpacks +- [libbuildpack](https://github.com/cloudfoundry/libbuildpack) - Shared Go library +- [Go Buildpack](https://github.com/cloudfoundry/go-buildpack) +- [Java Buildpack](https://github.com/cloudfoundry/java-buildpack) +- [Ruby Buildpack](https://github.com/cloudfoundry/ruby-buildpack) +- [Python Buildpack](https://github.com/cloudfoundry/python-buildpack) + +--- + +## Contributing to Documentation + +When adding new documentation: + +1. **User-facing docs** → Update this README with links +2. **Migration guides** → Add to [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) +3. **Architecture docs** → Create new file in this directory +4. **Code examples** → Include in relevant guide + +**Style Guidelines:** +- Use clear section headers +- Include code examples +- Show both ✅ working and ❌ non-working patterns +- Link to related documentation +- Keep language simple and direct diff --git a/docs/REWRITE_MIGRATION.md b/docs/REWRITE_MIGRATION.md new file mode 100644 index 000000000..1ed47160a --- /dev/null +++ b/docs/REWRITE_MIGRATION.md @@ -0,0 +1,855 @@ +# PHP Buildpack Rewrite System Migration Guide + +## Overview + +This document explains the differences between the v4.x runtime rewrite system and the v5.x build-time placeholder replacement system, and provides guidance for users migrating from v4.x to v5.x. + +--- + +## Architecture Comparison + +### v4.x (Python-based) - Runtime Rewrite + +**Location:** `bin/rewrite` (Python script) + +**When executed:** At **runtime** (container startup), before starting PHP-FPM, Apache, or Nginx + +**How it works:** +1. During build phase (`bin/compile`), the `bin/rewrite` script is copied to `$HOME/.bp/bin/rewrite` +2. At runtime, extensions register "preprocess commands" that call the rewrite script: + - PHP: `$HOME/.bp/bin/rewrite "$HOME/php/etc"` + - Apache: `$HOME/.bp/bin/rewrite "$HOME/httpd/conf"` + - Nginx: `$HOME/.bp/bin/rewrite "$HOME/nginx/conf"` +3. These commands run **before** the web server or PHP-FPM starts +4. The script has access to **all runtime environment variables** via `ctx.update(os.environ)` + +**Implementation:** +```python +# bin/rewrite (v4.x) +ctx = utils.FormattedDict({ + 'BUILD_DIR': '', + 'LD_LIBRARY_PATH': '', + 'PATH': '', + 'PYTHONPATH': '' +}) +ctx.update(os.environ) # <-- ALL environment variables available! +utils.rewrite_cfgs(toPath, ctx, delim='@') +``` + +**Template engine:** Python's `string.Template` with `safe_substitute()` +- Supports `$VAR` and `${VAR}` syntax with configurable delimiter +- Uses `@` as delimiter: `@{VAR}` or `@VAR` +- **`safe_substitute()`**: Leaves unknown variables **unchanged** (doesn't error) + +--- + +### v5.x (Go-based) - Build-Time Replacement + +**Location:** `src/php/finalize/finalize.go` (function `ReplaceConfigPlaceholders`) + +**When executed:** At **build time** (during finalize phase) + +**How it works:** +1. During finalize phase, all config files are processed **once** at build time +2. Placeholders are replaced with **known values** from predefined maps +3. Configs are written to disk with values baked in +4. At runtime, only `PORT` and `TMPDIR` are replaced using `sed` in profile scripts + +**Implementation:** +```go +// finalize.go (v5.x) +func ReplaceConfigPlaceholders(...) { + replacements := map[string]string{ + "@{HOME}": buildDir, + "@{PORT}": "${PORT}", // Replaced at runtime via sed + "@{TMPDIR}": "${TMPDIR}", + "@{WEBDIR}": webDir, + // ... predefined list only + } + // Replace each placeholder with its value +} +``` + +**Template engine:** Simple `strings.Replace()` with predefined map +- Only `@{VAR}` syntax supported +- **No arbitrary environment variables** - only predefined placeholders +- Fails silently if placeholder not in map (leaves unchanged) + +--- + +## Key Differences + +| Feature | v4.x (Runtime Rewrite) | v5.x (Build-Time Replacement) | +|---------|------------------------|-------------------------------| +| **Execution Phase** | Runtime (container startup) | Build time (finalize phase) | +| **Environment Access** | **ALL** runtime environment variables via `os.environ` | **Only predefined** variables in replacement maps | +| **Custom Variables** | ✅ Supported - any `VCAP_*`, `CF_*`, custom env vars | ❌ Not supported - only predefined placeholders | +| **Syntax** | `@{VAR}`, `@VAR` (Python Template) | `@{VAR}` only | +| **Unknown Variables** | Left unchanged (`safe_substitute`) | Left unchanged (no match in map) | +| **Runtime Flexibility** | ✅ Can use environment set at staging OR runtime | ❌ Only environment available at build time | +| **Performance** | Slower - rewrites all configs on every start | Faster - configs pre-processed at build | +| **Language** | Python | Go | +| **Script Location** | `$HOME/.bp/bin/rewrite` | Built into finalize binary | + +--- + +## Critical Behavioral Changes in v5.x + +### **IMPORTANT: Config File Placeholders vs. Go Code Access** + +**Key Distinction:** There's a difference between: +1. **Reading env vars in Go code** (✅ works in v5.x) +2. **Using env vars as `@{...}` config placeholders** (❌ limited in v5.x) + +**What This Means:** +- ✅ Extensions CAN read `VCAP_SERVICES` in Go code during staging +- ✅ Applications CAN read `VCAP_SERVICES` in PHP code at runtime +- ❌ Config files CANNOT use `@{VCAP_SERVICES}` as a placeholder +- ❌ Only predefined placeholders like `@{HOME}`, `@{WEBDIR}` work in configs + +For detailed buildpack comparison showing PHP v5.x alignment with all other CF buildpacks, see [docs/BUILDPACK_COMPARISON.md](docs/BUILDPACK_COMPARISON.md). + +--- + +### **Build-Time vs Runtime Config Rewriting** + +The biggest behavioral change from v4.x to v5.x is **when** configuration rewriting happens: + +| Aspect | v4.x (Python) | v5.x (Go) | +|--------|---------------|-----------| +| **When** | Runtime (container startup) | Build time (finalize phase) | +| **Environment** | ALL runtime env vars via `os.environ` | Only staging-time env vars | +| **VCAP_SERVICES** | ✅ Available | ❌ Not available | +| **CF_INSTANCE_*** | ✅ Available | ❌ Not available | +| **Custom runtime vars** | ✅ Available | ❌ Not available (unless set at staging) | +| **Reconfiguration** | ✅ Can change without restage | ❌ Requires restaging | + +**What this means:** +- In v4.x, the `bin/rewrite` script ran **before** each app start with access to **all** environment variables +- In v5.x, placeholder replacement runs **during staging** with access to **only** build-time variables +- Runtime-only variables like `VCAP_SERVICES`, `CF_INSTANCE_INDEX`, etc. are **not available** for `@{...}` placeholders + +--- + +## Breaking Changes in v5.x + +### 1. **No Arbitrary Environment Variables** + +**v4.x behavior:** +```ini +# php.ini +; Works in v4.x - MY_CUSTOM_VAR available at runtime +extension_dir = @{MY_CUSTOM_VAR}/modules +memory_limit = @{MY_MEMORY_LIMIT} +``` + +**v5.x behavior:** +```ini +# php.ini +; DOES NOT WORK in v5.x - not in predefined map +extension_dir = @{MY_CUSTOM_VAR}/modules ; ← Left as literal string! + +; Only predefined variables work +extension_dir = @{HOME}/.bp-config/php/modules ; ← Works +``` + +### 2. **Arbitrary Environment Variables Not Available as @{...} Placeholders** + +**IMPORTANT CLARIFICATION:** Environment variables like `VCAP_SERVICES` and `CF_INSTANCE_*` **ARE available during staging** in Go code (for extensions), but **cannot be used as `@{...}` placeholders** in config files. + +#### The Distinction: + +**✅ WORKS - Reading in Go Code (Staging Time):** +```go +// Extensions can read VCAP_SERVICES during staging +vcapServices := os.Getenv("VCAP_SERVICES") +services := parseJSON(vcapServices) +// Use to configure agents, write profile.d scripts, etc. +``` + +**❌ DOES NOT WORK - Config File Placeholders:** +```ini +# v4.x - WORKED (runtime rewrite expanded @{...}) +[www] +env[DB_HOST] = @{VCAP_SERVICES} + +# v5.x - DOES NOT WORK (@{VCAP_SERVICES} not in replacement map) +[www] +env[DB_HOST] = @{VCAP_SERVICES} ; ← Will be left as literal string! +``` + +#### Variables NOT Supported as @{...} Placeholders: + +**Cloud Foundry Service Bindings:** +- `@{VCAP_SERVICES}` - Not a predefined placeholder +- `@{VCAP_APPLICATION}` - Not a predefined placeholder + +**Instance-Specific Variables:** +- `@{CF_INSTANCE_INDEX}` - Not a predefined placeholder +- `@{CF_INSTANCE_IP}` - Not a predefined placeholder +- `@{CF_INSTANCE_ADDR}` - Not a predefined placeholder + +**Custom Runtime-Only Variables:** +```ini +# v4.x - WORKED (any env var set at runtime) +env[MY_RUNTIME_VAR] = @{MY_RUNTIME_VAR} + +# v5.x - DOES NOT WORK (unless MY_RUNTIME_VAR set during staging) +env[MY_RUNTIME_VAR] = @{MY_RUNTIME_VAR} ; ← Left unchanged! +``` + +#### Workarounds: + +**Option 1: Use Shell Variables `${VAR}`** +```ini +# FPM pool config - shell variables work +[www] +env[VCAP_SERVICES] = ${VCAP_SERVICES} +env[CF_INSTANCE_INDEX] = ${CF_INSTANCE_INDEX} +``` +**Note:** Only works in contexts where shell expansion happens (fpm.d env vars). + +**Option 2: Read in Application Code** +```php + +``` + +**Option 3: Use .profile.d Scripts** +```bash +#!/bin/bash +# .profile.d/parse-services.sh +# Extract values from VCAP_SERVICES and set env vars +export DB_HOST=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.host') +export DB_PORT=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.port') +``` + +**Option 4: Set Variables at Staging (manifest.yml)** +```yaml +# Variables set in manifest.yml are available during staging +applications: +- name: my-app + env: + MY_VAR: some_value # Available for @{MY_VAR} during staging +``` + +### 3. **Supported Placeholders (v5.x)** + +Only these placeholders are supported in v5.x. **IMPORTANT:** The meaning of `@{HOME}` varies by config file location (see Context Table below). + +#### General Placeholders +- `@{HOME}` - Home directory (context-dependent: app or deps directory) +- `@{TMPDIR}` - Temporary directory (converted to `${TMPDIR}` for runtime expansion) +- `@{LIBDIR}` - Library directory (default: `lib`) +- `@{WEBDIR}` - Web root directory (default: `htdocs`) + +#### PHP-Specific Placeholders +- `@{PHP_FPM_LISTEN}` - PHP-FPM listen address (TCP or Unix socket) +- `@{PHP_EXTENSIONS}` - Enabled PHP extensions (replaced during supply phase) +- `@{ZEND_EXTENSIONS}` - Enabled Zend extensions (replaced during supply phase) +- `@{PHP_FPM_CONF_INCLUDE}` - FPM pool config include directive (replaced during supply phase) +- `@{DEPS_DIR}` - Dependencies directory (always `/home/vcap/deps`) + +#### Runtime Variables (NOT placeholders) +- `${PORT}` - Application port (shell variable, expanded by sed at runtime) +- `${TMPDIR}` - Temporary directory (shell variable, expanded by sed/shell at runtime) +- `${HOME}` - Application home (shell variable, expanded by Apache/shell at runtime) + +**Note:** `@{PORT}` is NOT supported - use `${PORT}` instead for runtime expansion. + +#### Context-Aware Placeholder Replacement + +The `@{HOME}` placeholder resolves to **different values** depending on where it's used: + +| Config Location | `@{HOME}` Value | When Replaced | Purpose | +|----------------|-----------------|---------------|---------| +| `php/etc/php.ini` | `/home/vcap/deps/{idx}` | Finalize | PHP needs deps-relative extension paths | +| `php/etc/php-fpm.conf` | `/home/vcap/deps/{idx}` | Finalize | FPM binary and PID file in deps dir | +| `php/etc/php.ini.d/*.ini` | `/home/vcap/app` | Finalize | User configs reference app paths (include_path, etc.) | +| `php/etc/fpm.d/*.conf` | `/home/vcap/app` | Finalize | Environment vars for PHP scripts (app context) | +| `nginx/conf/*.conf` | `/home/vcap/app` | Finalize | Web server serves app directory | +| `httpd/conf/*.conf` | NOT REPLACED | N/A | Use `${HOME}` for runtime expansion by Apache | + +**User-Provided Config Examples:** + +**✅ WORKS:** `.bp-config/php/fpm.d/custom.conf` +```ini +[www] +env[MY_PATH] = @{HOME}/storage ; → /home/vcap/app/storage +env[WEBDIR] = @{WEBDIR} ; → htdocs +``` + +**✅ WORKS:** `.bp-config/php/php.ini.d/custom.ini` +```ini +include_path = "@{HOME}/lib:@{HOME}/vendor" ; → /home/vcap/app/lib:/home/vcap/app/vendor +``` + +**✅ WORKS:** `.bp-config/nginx/custom.conf` +```nginx +root @{HOME}/@{WEBDIR}; ; → /home/vcap/app/htdocs +``` + +**✅ WORKS:** `.bp-config/httpd/extra/custom.conf` +```apache +DocumentRoot "${HOME}/@{WEBDIR}" ; → ${HOME}/htdocs (Apache expands ${HOME} at runtime) +``` + +See `finalize.go:258-336` for implementation details. + +--- + +## User-Provided Configuration Files + +Users can override buildpack defaults by placing config files in `.bp-config/`: + +### Supported User Config Locations + +| Location | Copied To | Placeholder Context | When Processed | +|----------|-----------|---------------------|----------------| +| `.bp-config/php/php.ini` | `deps/{idx}/php/etc/` | Deps context | Supply + Finalize | +| `.bp-config/php/php-fpm.conf` | `deps/{idx}/php/etc/` | Deps context | Supply + Finalize | +| `.bp-config/php/fpm.d/*.conf` | `deps/{idx}/php/etc/fpm.d/` | **App context** | Finalize | +| `.bp-config/php/php.ini.d/*.ini` | `deps/{idx}/php/etc/php.ini.d/` | **App context** | Finalize | +| `.bp-config/httpd/**/*` | `BUILD_DIR/httpd/conf/` | App context | Finalize | +| `.bp-config/nginx/**/*` | `BUILD_DIR/nginx/conf/` | App context | Finalize | + +### User Config Placeholder Examples + +**PHP FPM Pool Config** (`.bp-config/php/fpm.d/env.conf`): +```ini +[www] +; Set environment variables for PHP scripts +env[APP_STORAGE] = @{HOME}/storage ; Becomes: /home/vcap/app/storage +env[APP_CACHE] = @{TMPDIR}/cache ; Becomes: ${TMPDIR}/cache +env[WEB_ROOT] = @{HOME}/@{WEBDIR} ; Becomes: /home/vcap/app/htdocs +``` + +**PHP Extension Config** (`.bp-config/php/php.ini.d/paths.ini`): +```ini +; Custom include paths for your application +include_path = ".:/usr/share/php:@{HOME}/lib:@{HOME}/vendor" +; Becomes: .:/usr/share/php:/home/vcap/app/lib:/home/vcap/app/vendor + +; Restrict file access to app directory +open_basedir = @{HOME}:@{TMPDIR}:/tmp +; Becomes: /home/vcap/app:${TMPDIR}:/tmp +``` + +**Nginx Config** (`.bp-config/nginx/custom-location.conf`): +```nginx +location /uploads { + root @{HOME}/@{WEBDIR}; ; Becomes: /home/vcap/app/htdocs + client_max_body_size 100M; +} + +location ~ \.php$ { + fastcgi_pass unix:@{PHP_FPM_LISTEN}; ; Becomes: unix:/home/vcap/deps/0/php/var/run/php-fpm.sock +} +``` + +**Apache HTTPD Config** (`.bp-config/httpd/extra/custom.conf`): +```apache +# Use ${VAR} for runtime expansion by Apache + # Becomes: ${HOME}/htdocs + Options Indexes FollowSymLinks + AllowOverride All + + +# Use @{VAR} for build-time replacement +ProxyPass /api fcgi://@{PHP_FPM_LISTEN}/${HOME}/@{WEBDIR} +# Becomes: ProxyPass /api fcgi://127.0.0.1:9000/${HOME}/htdocs +``` + +### Important Notes for User Configs + +1. **Context Matters:** `@{HOME}` in `fpm.d/` and `php.ini.d/` means `/home/vcap/app`, not `/home/vcap/deps/{idx}` +2. **No Custom Variables:** Only predefined placeholders work. Cannot use `@{MY_VAR}` - use `${MY_VAR}` instead +3. **Runtime Variables:** Use `${PORT}`, `${TMPDIR}`, `${HOME}` for values that change at runtime +4. **Apache Special:** Apache configs can use `${...}` syntax which Apache expands at runtime + +--- + +## Scenarios That No Longer Work in v5.x + +### Scenario 1: Service Credentials in Config Files + +**v4.x Pattern (NO LONGER WORKS):** +```ini +# .bp-config/php/fpm.d/db.conf +[www] +; Extract DB hostname from VCAP_SERVICES +env[DB_HOST] = @{VCAP_SERVICES} +``` + +**v5.x Migration:** +```php +// Parse in application code instead + +``` + +Or use `.profile.d` to set env vars: +```bash +#!/bin/bash +# .profile.d/db-env.sh +export DB_HOST=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.host') +export DB_NAME=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.name') +``` + +--- + +### Scenario 2: Instance-Specific Configuration + +**v4.x Pattern (NO LONGER WORKS):** +```ini +# .bp-config/php/fpm.d/instance.conf +[www] +; Configure based on instance index (for sharding, etc.) +env[INSTANCE_INDEX] = @{CF_INSTANCE_INDEX} +env[INSTANCE_IP] = @{CF_INSTANCE_IP} +``` + +**v5.x Migration:** +```ini +# Use shell variables instead +[www] +env[INSTANCE_INDEX] = ${CF_INSTANCE_INDEX} +env[INSTANCE_IP] = ${CF_INSTANCE_IP} +``` + +Or read in PHP: +```php + +``` + +--- + +### Scenario 3: Dynamic Runtime Reconfiguration + +**v4.x Behavior (NO LONGER WORKS):** +```bash +# Could change env vars and restart app +$ cf set-env my-app MY_CONFIG_VAR new_value +$ cf restart my-app +# Config files rewritten with new value on startup ✓ +``` + +**v5.x Behavior:** +```bash +# Environment variables used in @{...} placeholders require restaging +$ cf set-env my-app MY_CONFIG_VAR new_value +$ cf restage my-app # Must restage, not just restart! +``` + +**Exception:** Shell variables `${VAR}` still work with just restart: +```bash +$ cf set-env my-app MY_VAR new_value +$ cf restart my-app # ${MY_VAR} will pick up new value +``` + +--- + +### Scenario 4: Complex Environment Variable Expressions + +**v4.x Pattern (NO LONGER WORKS):** +```ini +# Could use Python's string.Template with complex expressions +env[CACHE_DIR] = @{TMPDIR}/cache/@{CF_INSTANCE_INDEX} +``` + +**v5.x Migration:** +```bash +# Use .profile.d script for complex logic +#!/bin/bash +# .profile.d/setup-cache.sh +export CACHE_DIR="${TMPDIR}/cache/${CF_INSTANCE_INDEX}" +mkdir -p "$CACHE_DIR" +``` + +Then reference in FPM config: +```ini +[www] +env[CACHE_DIR] = ${CACHE_DIR} +``` + +--- + +## Migration Strategies + +### Strategy 1: Use Runtime Variables (`${VAR}`) + +For variables that need runtime values, use shell variable syntax `${VAR}` instead of `@{VAR}`: + +**Before (v4.x):** +```ini +; php.ini +memory_limit = @{MY_MEMORY_LIMIT} +``` + +**After (v5.x):** +```ini +; php.ini +memory_limit = ${MY_MEMORY_LIMIT} +``` + +**Requirements:** +- Config file must be processed by a shell (Apache `.htaccess` with `mod_env`, bash scripts) +- OR config format must support environment variable expansion natively + +### Strategy 2: Use .profile.d Scripts + +For complex runtime logic, use `.profile.d` scripts to rewrite configs at runtime: + +```bash +# .profile.d/custom_config.sh +#!/bin/bash + +# Manually replace placeholders using sed +sed -i "s|PLACEHOLDER|${MY_VAR}|g" "$HOME/php/etc/php.ini" +``` + +### Strategy 3: Use Buildpack Extensions + +Create a custom extension during supply/finalize phase to add your own placeholder mappings (requires modifying buildpack source). + +### Strategy 4: Environment Variable Workarounds + +Set environment variables during **staging** (not just runtime) if they need to be used in `@{...}` placeholders: + +```yaml +# manifest.yml +applications: +- name: my-app + env: + MY_VAR: some_value # Available during staging +``` + +--- + +## Common Use Cases + +### Case 1: Database Connection from VCAP_SERVICES + +**v4.x:** +```php + "$HOME/php/etc/conf.d/99-custom.ini" +``` + +### Case 3: Dynamic Nginx Configuration + +**v4.x:** +```nginx +# nginx.conf +worker_processes @{NGINX_WORKERS}; +``` + +**v5.x:** +```nginx +# nginx.conf - Use predefined placeholder +worker_processes @{NGINX_WORKERS}; # If added to finalize.go replacement map + +# OR use environment variable +worker_processes ${NGINX_WORKERS}; # If nginx config loader supports env vars +``` + +--- + +## Advantages of v5.x Build-Time Approach + +Despite losing runtime flexibility, v5.x offers benefits: + +1. **Performance**: No config rewriting on every container start +2. **Simplicity**: No Python dependency at runtime +3. **Security**: Reduced attack surface (no runtime code execution) +4. **Predictability**: Configs are "locked in" at build time +5. **Debugging**: Configs can be inspected in droplet without runtime dependencies + +--- + +## Extending v5.x (For Buildpack Maintainers) + +To add support for custom placeholders, modify `src/php/finalize/finalize.go`: + +```go +// Add to replacement map in ReplaceConfigPlaceholders() +replacements := map[string]string{ + "@{HOME}": buildDir, + "@{MY_CUSTOM_VAR}": os.Getenv("MY_CUSTOM_VAR"), // Add this + // ... +} +``` + +**Note:** This requires rebuilding the buildpack. + +--- + +## Troubleshooting + +### Placeholder Not Being Replaced + +**Symptom:** Config file contains literal `@{MY_VAR}` after deployment + +**Cause:** Variable not in predefined replacement map + +**Solution:** +1. Check if placeholder is in supported list (see `README.md`) +2. Use `${VAR}` syntax instead if runtime expansion is acceptable +3. Use `.profile.d` script for custom runtime replacements + +### Config Works in v4.x but Not v5.x + +**Symptom:** Application crashes with config errors after migrating to v5.x + +**Cause:** Relying on runtime environment variables in `@{...}` placeholders + +**Solution:** +1. Identify which placeholders are failing (check config files for unreplaced `@{...}`) +2. Migrate to `${...}` syntax for runtime variables +3. Or set variables at **staging time** via `manifest.yml` env section + +--- + +## References + +- v4.x rewrite implementation: `bin/rewrite` (Python) +- v4.x rewrite logic: `lib/build_pack_utils/utils.py:89` (`rewrite_cfgs()`) +- v5.x replacement logic: `src/php/finalize/finalize.go:240-330` +- Supported placeholders: `README.md:137-192` +- Python Template docs: https://docs.python.org/2/library/string.html#template-strings + +--- + +## Summary + +| What You Need | v4.x | v5.x | +|---------------|------|------| +| Predefined buildpack variables | `@{HOME}`, `@{WEBDIR}`, etc. | ✅ Same | +| Custom staging-time env vars | ✅ `@{MY_VAR}` | ❌ Not supported | +| Runtime env vars | ✅ `@{VCAP_SERVICES}` | ❌ Use `${...}` or code | +| Shell variables | `${PORT}`, `${HOME}` | ✅ Same | +| Performance | Slower (runtime rewrite) | ✅ Faster (build-time) | + +**Migration Checklist:** +- [ ] Audit all config files for `@{...}` placeholders +- [ ] Identify custom environment variables being used +- [ ] Replace with `${...}` syntax or `.profile.d` scripts +- [ ] Test application on v5.x with runtime environment variables +- [ ] Update documentation for your team + +--- + +## v4.x → v5.x Feature Parity Status + +This section documents all features from v4.x and their status in v5.x. + +### ✅ Fully Implemented in v5.x + +| Feature | v4.x | v5.x | Notes | +|---------|------|------|-------| +| Web Servers | httpd, nginx, none | ✅ httpd, nginx, none | Same options supported | +| PHP-FPM | ✅ | ✅ | Same functionality | +| Composer | ✅ | ✅ | Version detection, ext-* dependencies | +| NewRelic APM | ✅ | ✅ | Via VCAP_SERVICES or env var | +| AppDynamics APM | ✅ | ✅ | Via VCAP_SERVICES | +| Dynatrace | ✅ | ✅ | Via libbuildpack hook | +| Sessions (Redis/Memcached) | ✅ | ✅ | Auto-configured from VCAP_SERVICES | +| WEBDIR auto-setup | ✅ | ✅ | Moves files into htdocs if not exists | +| User config (.bp-config/) | ✅ | ✅ | options.json, httpd/, nginx/, php/ | +| php.ini.d support | ✅ | ✅ | Custom PHP ini files | +| fpm.d support | ✅ | ✅ | Custom FPM pool configs | +| Composer GitHub OAuth | ✅ | ✅ | Via COMPOSER_GITHUB_OAUTH_TOKEN | +| **ADDITIONAL_PREPROCESS_CMDS** | ✅ | ✅ **NEW** | Startup commands in options.json | +| **Standalone PHP Mode** | ✅ | ✅ **NEW** | APP_START_CMD for CLI/workers | +| **User Extensions** | ✅ | ✅ **NEW** | .extensions/ with JSON config | + +### 🆕 Newly Implemented Features (v5.x) + +#### 1. ADDITIONAL_PREPROCESS_CMDS + +Run custom commands at container startup before PHP-FPM starts. + +**Configuration (.bp-config/options.json):** +```json +{ + "ADDITIONAL_PREPROCESS_CMDS": [ + "echo 'Starting application'", + ["./bin/migrations.sh", "--force"], + "php artisan cache:clear" + ] +} +``` + +Commands can be: +- A string: `"echo hello"` - runs as single command +- An array: `["script.sh", "arg1", "arg2"]` - arguments joined with spaces + +#### 2. Standalone PHP Mode (APP_START_CMD) + +For CLI/worker applications that don't need a web server or PHP-FPM. + +**Configuration (.bp-config/options.json):** +```json +{ + "WEB_SERVER": "none", + "APP_START_CMD": "worker.php" +} +``` + +**Auto-detection:** If `WEB_SERVER=none` and no `APP_START_CMD` is set, the buildpack searches for: +- `app.php` +- `main.php` +- `run.php` +- `start.php` + +If none found, defaults to `app.php`. + +#### 3. User Extensions (.extensions/) + +Create custom extensions without modifying the buildpack source. + +**Create `.extensions//extension.json`:** +```json +{ + "name": "my-custom-extension", + "preprocess_commands": [ + "echo 'Extension starting'", + ["./setup.sh", "arg1"] + ], + "service_commands": { + "worker": "php worker.php --daemon" + }, + "service_environment": { + "MY_VAR": "value", + "ANOTHER_VAR": "value2" + } +} +``` + +**Available hooks:** +- `preprocess_commands`: Commands run at startup before PHP-FPM +- `service_commands`: Long-running background services +- `service_environment`: Environment variables for services + +**Note:** Unlike v4.x Python extensions, v5.x uses a declarative JSON format for security and simplicity. Dynamic code execution is not supported. + +### ❌ Not Implemented (Low Priority) + +These v4.x features are not currently in v5.x due to low usage or being deprecated: + +| Feature | v4.x | v5.x | Alternative | +|---------|------|------|-------------| +| COMPOSER_INSTALL_GLOBAL | ✅ | ❌ | Add to composer.json require-dev | +| igbinary auto-add for redis | ✅ | ❌ | Explicitly add igbinary to PHP_EXTENSIONS | +| SNMP MIBDIRS auto-set | ✅ | ❌ | Set MIBDIRS in manifest.yml env | +| HHVM support (PHP_VM=hhvm) | ✅ | ❌ | HHVM is deprecated, use PHP | +| Verbose PHP version warnings | ✅ | ❌ | Staging fails with clear error | + +### 📋 Migration Notes for Specific Features + +#### Migrating Python User Extensions to JSON + +**v4.x (.extensions/myext/extension.py):** +```python +def preprocess_commands(ctx): + return [['echo', 'hello'], ['./setup.sh']] + +def service_commands(ctx): + return {'worker': ('php', 'worker.php', '--daemon')} + +def service_environment(ctx): + return {'MY_VAR': 'value'} +``` + +**v5.x (.extensions/myext/extension.json):** +```json +{ + "name": "myext", + "preprocess_commands": [ + ["echo", "hello"], + ["./setup.sh"] + ], + "service_commands": { + "worker": "php worker.php --daemon" + }, + "service_environment": { + "MY_VAR": "value" + } +} +``` + +#### Migrating Standalone Apps + +**v4.x:** +- Set `WEB_SERVER=none` in options.json +- Buildpack auto-detected entry points +- Or set `APP_START_CMD` in options.json + +**v5.x:** +- Same behavior preserved +- Set `WEB_SERVER=none` in options.json +- Optional: Set `APP_START_CMD` explicitly +- Auto-detects: app.php, main.php, run.php, start.php + +--- + +## Complete Migration Checklist + +**Before Migration:** +- [ ] Review this document completely +- [ ] Identify any `.extensions/` Python extensions in your app +- [ ] Identify any `ADDITIONAL_PREPROCESS_CMDS` usage +- [ ] Identify if using `WEB_SERVER=none` mode + +**During Migration:** +- [ ] Convert Python extensions to JSON format +- [ ] Verify `ADDITIONAL_PREPROCESS_CMDS` still works +- [ ] Test standalone mode if applicable +- [ ] Audit `@{...}` placeholders in config files +- [ ] Replace custom `@{MY_VAR}` with `${MY_VAR}` or `.profile.d` scripts + +**After Migration:** +- [ ] Test application thoroughly +- [ ] Verify all startup commands execute +- [ ] Check logs for extension loading messages +- [ ] Validate PHP extensions are enabled correctly diff --git a/docs/USER_GUIDE.md b/docs/USER_GUIDE.md new file mode 100644 index 000000000..b2aa97875 --- /dev/null +++ b/docs/USER_GUIDE.md @@ -0,0 +1,865 @@ +# PHP Buildpack Features Guide + +This guide shows you how to use all the features available in the Cloud Foundry PHP buildpack. + +## Table of Contents +- [Getting Started](#getting-started) +- [Web Servers](#web-servers) +- [PHP Configuration](#php-configuration) +- [PHP Extensions](#php-extensions) +- [Composer and Dependencies](#composer-and-dependencies) +- [Application Monitoring](#application-monitoring) +- [Session Storage](#session-storage) +- [Popular Frameworks](#popular-frameworks) +- [Advanced Features](#advanced-features) + +--- + +## Getting Started + +### Deploying a Basic PHP Application + +1. Create a basic PHP application: +```bash +mkdir my-php-app +cd my-php-app +echo "" > index.php +``` + +2. Deploy to Cloud Foundry: +```bash +cf push my-app +``` + +That's it! The buildpack automatically: +- Detects your PHP application +- Installs PHP and Apache HTTPD +- Configures PHP-FPM +- Serves your application + +### Directory Structure + +``` +my-app/ +├── index.php # Your application code +├── .bp-config/ # Buildpack configuration (optional) +│ ├── options.json # General settings +│ ├── php/ +│ │ ├── php.ini # Custom PHP settings +│ │ ├── php.ini.d/ # Additional PHP config +│ │ └── fpm.d/ # PHP-FPM pool config +│ ├── httpd/ # Apache configuration +│ └── nginx/ # Nginx configuration +├── composer.json # Dependencies +└── htdocs/ # Custom web root (optional) +``` + +--- + +## Web Servers + +### Apache HTTPD (Default) + +Apache HTTPD is used by default. No configuration needed! + +**Custom Configuration:** + +Create `.bp-config/options.json`: +```json +{ + "WEB_SERVER": "httpd" +} +``` + +**Custom Apache Modules:** + +Create `.bp-config/httpd/extra/httpd-modules.conf`: +```apache +# Load additional modules +LoadModule rewrite_module modules/mod_rewrite.so +LoadModule headers_module modules/mod_headers.so +``` + +**Custom Apache Configuration:** + +Create `.bp-config/httpd/httpd.conf` to override the default configuration, or add files to `.bp-config/httpd/extra/` to extend it. + +**Example - Enable mod_rewrite:** +```apache +# .bp-config/httpd/extra/rewrite.conf + + RewriteEngine On + RewriteBase / + RewriteCond %{REQUEST_FILENAME} !-f + RewriteRule ^ index.php [QSA,L] + +``` + +--- + +### Nginx + +Switch to Nginx by creating `.bp-config/options.json`: +```json +{ + "WEB_SERVER": "nginx" +} +``` + +**Custom Nginx Configuration:** + +Create `.bp-config/nginx/server.conf`: +```nginx +# Custom location blocks +location / { + try_files $uri $uri/ /index.php?$query_string; +} + +location ~ \.php$ { + fastcgi_pass unix:@{PHP_FPM_LISTEN}; + fastcgi_param SCRIPT_FILENAME @{HOME}/@{WEBDIR}$fastcgi_script_name; + include fastcgi_params; +} +``` + +**Upload Size Configuration:** +```nginx +# .bp-config/nginx/server.conf +client_max_body_size 100M; +``` + +--- + +### No Web Server (PHP-FPM Only) + +For multi-buildpack scenarios or when using an external web server: + +```json +{ + "WEB_SERVER": "none" +} +``` + +PHP-FPM will listen on `127.0.0.1:9000` for FastCGI connections. + +--- + +## PHP Configuration + +### Selecting PHP Version + +**Option 1: Via composer.json (Recommended)** +```json +{ + "require": { + "php": "^8.2" + } +} +``` + +**Option 2: Via .bp-config/options.json** +```json +{ + "PHP_VERSION": "8.2.x" +} +``` + +**Available Versions:** +- PHP 8.3.x +- PHP 8.2.x +- PHP 8.1.x + +--- + +### Custom php.ini Settings + +Create `.bp-config/php/php.ini`: +```ini +[PHP] +memory_limit = 256M +upload_max_filesize = 50M +post_max_size = 50M +max_execution_time = 60 + +date.timezone = "America/New_York" + +display_errors = Off +error_reporting = E_ALL & ~E_DEPRECATED & ~E_STRICT +``` + +--- + +### Additional PHP Configuration + +For modular configuration, use `.bp-config/php/php.ini.d/`: + +**Example - Custom Include Path:** +```ini +; .bp-config/php/php.ini.d/custom-paths.ini +include_path = ".:/usr/share/php:@{HOME}/lib" +``` + +**Example - Error Logging:** +```ini +; .bp-config/php/php.ini.d/logging.ini +error_log = /home/vcap/logs/php_errors.log +log_errors = On +``` + +--- + +### PHP-FPM Configuration + +**Custom FPM Pool Settings:** + +Create `.bp-config/php/fpm.d/custom.conf`: +```ini +[www] +; Worker process settings +pm = dynamic +pm.max_children = 20 +pm.start_servers = 5 +pm.min_spare_servers = 5 +pm.max_spare_servers = 10 + +; Environment variables for your application +env[DB_HOST] = ${DB_HOST} +env[DB_PORT] = ${DB_PORT} +env[REDIS_URL] = ${REDIS_URL} + +; Application paths +env[APP_ENV] = production +env[APP_DEBUG] = false +``` + +**Expose Environment Variables to PHP:** +```ini +; .bp-config/php/fpm.d/env.conf +[www] +; Pass Cloud Foundry environment variables +env[VCAP_SERVICES] = ${VCAP_SERVICES} +env[VCAP_APPLICATION] = ${VCAP_APPLICATION} +env[CF_INSTANCE_INDEX] = ${CF_INSTANCE_INDEX} +``` + +--- + +## PHP Extensions + +### Installing Extensions + +**Method 1: Via composer.json (Recommended)** +```json +{ + "require": { + "php": "^8.2", + "ext-mbstring": "*", + "ext-pdo": "*", + "ext-pdo_mysql": "*", + "ext-redis": "*", + "ext-apcu": "*", + "ext-intl": "*" + } +} +``` + +**Method 2: Via .bp-config/options.json** +```json +{ + "PHP_EXTENSIONS": [ + "mbstring", + "pdo", + "pdo_mysql", + "redis", + "apcu" + ] +} +``` + +--- + +### Popular Extensions + +#### Redis (phpredis) + +**Installation:** +```json +{ + "require": { + "ext-redis": "*" + } +} +``` + +**Usage:** +```php +connect('127.0.0.1', 6379); +$redis->set('key', 'value'); +echo $redis->get('key'); +?> +``` + +--- + +#### APCu (User Cache) + +**Installation:** +```json +{ + "require": { + "ext-apcu": "*" + } +} +``` + +**Usage:** +```php + +``` + +--- + +#### AMQP (RabbitMQ) + +**Installation:** +```json +{ + "require": { + "ext-amqp": "*" + } +} +``` + +**Usage:** +```php + 'localhost', + 'port' => 5672, + 'vhost' => '/', + 'login' => 'guest', + 'password' => 'guest' +]); +$connection->connect(); +?> +``` + +--- + +### All Available Extensions + +Standard PHP extensions available: +- **Database:** mysqli, pdo, pdo_mysql, pdo_pgsql, pdo_sqlite, pgsql +- **Caching:** apcu, opcache +- **Compression:** bz2, zip, zlib +- **Crypto:** openssl, sodium +- **Encoding:** mbstring, iconv +- **Image:** gd, exif +- **International:** intl, gettext +- **Math:** bcmath, gmp +- **Network:** curl, ftp, sockets +- **Text:** xml, xmlreader, xmlwriter, simplexml, dom, xsl +- **Web:** soap, json +- And many more! + +--- + +## Composer and Dependencies + +### Basic Composer Usage + +The buildpack automatically detects `composer.json` and runs `composer install`. + +**Example composer.json:** +```json +{ + "require": { + "php": "^8.2", + "monolog/monolog": "^3.0", + "guzzlehttp/guzzle": "^7.0" + } +} +``` + +--- + +### Custom Vendor Directory + +```json +{ + "config": { + "vendor-dir": "lib/vendor" + } +} +``` + +Or set via environment variable: +```bash +cf set-env myapp COMPOSER_VENDOR_DIR lib/vendor +``` + +--- + +### GitHub Rate Limiting + +Avoid GitHub API rate limits by providing an OAuth token: + +```bash +cf set-env myapp COMPOSER_GITHUB_OAUTH_TOKEN your-github-token +cf restage myapp +``` + +--- + +### Custom Composer Location + +If your `composer.json` is not in the root: + +```bash +cf set-env myapp COMPOSER_PATH src/ +cf restage myapp +``` + +--- + +## Application Monitoring + +### NewRelic + +**Setup:** +1. Create a NewRelic service: +```bash +cf create-service newrelic standard my-newrelic +``` + +2. Bind to your application: +```bash +cf bind-service myapp my-newrelic +cf restage myapp +``` + +That's it! NewRelic is automatically configured. + +**Custom Configuration:** +```bash +cf set-env myapp NEWRELIC_LICENSE your-license-key +cf restage myapp +``` + +--- + +### AppDynamics + +**Setup:** +1. Create an AppDynamics service or use a user-provided service: +```bash +cf cups my-appdynamics -p '{"account-name":"your-account","account-access-key":"your-key","host-name":"controller.example.com","port":"443","ssl-enabled":true}' +``` + +2. Bind to your application: +```bash +cf bind-service myapp my-appdynamics +cf restage myapp +``` + +**Custom Configuration:** +```bash +cf set-env myapp APPD_TIER_NAME web +cf set-env myapp APPD_NODE_NAME web-1 +``` + +--- + +### Dynatrace + +Bind a Dynatrace service to enable monitoring: +```bash +cf bind-service myapp my-dynatrace +cf restage myapp +``` + +--- + +## Session Storage + +### Redis Sessions + +**Automatic Configuration:** +1. Bind a Redis service: +```bash +cf bind-service myapp my-redis +cf restage myapp +``` + +The buildpack automatically configures PHP sessions to use Redis! + +**Manual Configuration:** +```ini +; .bp-config/php/php.ini +session.save_handler = redis +session.save_path = "tcp://localhost:6379" +``` + +--- + +### Memcached Sessions + +**Automatic Configuration:** +1. Bind a Memcached service: +```bash +cf bind-service myapp my-memcached +cf restage myapp +``` + +Sessions automatically use Memcached! + +--- + +## Popular Frameworks + +### CakePHP + +**composer.json:** +```json +{ + "require": { + "php": "^8.2", + "cakephp/cakephp": "^5.0" + } +} +``` + +**Procfile (for migrations):** +``` +web: php artisan migrate --force && $HOME/.bp/bin/start +``` + +--- + +### Laravel + +**composer.json:** +```json +{ + "require": { + "php": "^8.2", + "laravel/framework": "^10.0" + } +} +``` + +**Run migrations on startup:** + +Create `.bp-config/options.json`: +```json +{ + "WEBDIR": "public", + "ADDITIONAL_PREPROCESS_CMDS": [ + "php artisan migrate --force", + "php artisan cache:clear", + "php artisan config:cache" + ] +} +``` + +--- + +### Symfony + +**composer.json:** +```json +{ + "require": { + "php": "^8.2", + "symfony/framework-bundle": "^6.0" + } +} +``` + +**Set web directory:** +```json +{ + "WEBDIR": "public" +} +``` + +--- + +### Laminas (Zend Framework) + +**composer.json:** +```json +{ + "require": { + "php": "^8.2", + "laminas/laminas-mvc": "^3.0" + } +} +``` + +Works out of the box! + +--- + +## Advanced Features + +### Custom Web Directory + +If your application code is in a subdirectory: + +```json +{ + "WEBDIR": "public" +} +``` + +Or: +```json +{ + "WEBDIR": "web" +} +``` + +The buildpack automatically moves your app into this directory. + +--- + +### Preprocess Commands + +Run commands before your application starts (migrations, cache warming, etc.): + +```json +{ + "ADDITIONAL_PREPROCESS_CMDS": [ + "php artisan migrate --force", + "php bin/console cache:warmup", + "chmod -R 777 storage" + ] +} +``` + +**Common Use Cases:** +- Database migrations +- Cache warming +- Asset compilation +- Directory permissions + +--- + +### Standalone PHP Applications + +Run PHP applications without a web server (workers, CLI apps): + +```json +{ + "WEB_SERVER": "none", + "APP_START_CMD": "php worker.php" +} +``` + +**Examples:** +- Queue workers +- Cron-like tasks +- Background processors +- Long-running scripts + +--- + +### Environment Variables in Configuration + +Use environment variables in your configuration files: + +**PHP-FPM Configuration:** +```ini +; .bp-config/php/fpm.d/env.conf +[www] +env[DATABASE_URL] = ${DATABASE_URL} +env[REDIS_URL] = ${REDIS_URL} +env[APP_SECRET] = ${APP_SECRET} +``` + +**Nginx Configuration:** +```nginx +# PORT is replaced at runtime +server { + listen ${PORT}; + # ... +} +``` + +--- + +### Service Bindings (VCAP_SERVICES) + +Access bound service credentials in your PHP code: + +```php + +``` + +**For more complex parsing, create a helper class:** +```php +services = json_decode(getenv('VCAP_SERVICES'), true) ?: []; + } + + public function getCredentials($serviceType) { + return $this->services[$serviceType][0]['credentials'] ?? null; + } +} + +// Usage +$vcap = new VcapParser(); +$db = $vcap->getCredentials('mysql'); +?> +``` + +--- + +### Multi-Buildpack Support + +Use PHP with other buildpacks: + +**manifest.yml:** +```yaml +applications: +- name: my-app + buildpacks: + - https://github.com/cloudfoundry/nodejs-buildpack + - https://github.com/cloudfoundry/php-buildpack + # Node.js for asset compilation, PHP for runtime +``` + +**Use Cases:** +- Node.js for frontend asset compilation +- .NET for legacy components +- Custom buildpacks for specialized tools + +--- + +## Configuration Reference + +### .bp-config/options.json + +Complete reference of available options: + +```json +{ + "PHP_VERSION": "8.2.x", + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs", + "LIBDIR": "lib", + "COMPOSER_VENDOR_DIR": "vendor", + "ADMIN_EMAIL": "admin@example.com", + "ADDITIONAL_PREPROCESS_CMDS": [], + "APP_START_CMD": null, + "PHP_EXTENSIONS": [] +} +``` + +**Options:** +- `PHP_VERSION` - PHP version to install (e.g., "8.2.x", "8.1.27") +- `WEB_SERVER` - Web server choice: "httpd", "nginx", or "none" +- `WEBDIR` - Document root directory (default: "htdocs") +- `LIBDIR` - Library directory (default: "lib") +- `COMPOSER_VENDOR_DIR` - Composer vendor directory +- `ADMIN_EMAIL` - Server admin email +- `ADDITIONAL_PREPROCESS_CMDS` - Commands to run before app starts +- `APP_START_CMD` - Custom start command (for standalone apps) +- `PHP_EXTENSIONS` - List of PHP extensions (prefer composer.json) + +--- + +## Troubleshooting + +### View Application Logs + +```bash +cf logs myapp --recent +``` + +### Check PHP Version + +```php + +``` + +### Verify Loaded Extensions + +```php + +``` + +### Debug Composer Issues + +```bash +cf set-env myapp COMPOSER_DEBUG 1 +cf restage myapp +``` + +### Common Issues + +**"Extension not found"** +- Ensure extension is listed in composer.json or options.json +- Check manifest.yml for available extensions + +**"Session errors"** +- Verify Redis/Memcached service is bound +- Check session configuration in php.ini + +**"Upload size limit"** +- Increase `upload_max_filesize` and `post_max_size` in php.ini +- For Nginx, also set `client_max_body_size` + +**"Memory limit exceeded"** +- Increase `memory_limit` in php.ini +- Check application memory quota: `cf app myapp` + +--- + +## Getting Help + +- **Documentation:** https://docs.cloudfoundry.org/buildpacks/php/ +- **GitHub Issues:** https://github.com/cloudfoundry/php-buildpack/issues +- **Slack:** #buildpacks on cloudfoundry.slack.com + +--- + +## Next Steps + +- [VCAP_SERVICES Usage Guide](VCAP_SERVICES_USAGE.md) - Working with service bindings +- [Migration Guide](REWRITE_MIGRATION.md) - Migrating from PHP buildpack v4.x +- [Architecture Overview](BUILDPACK_COMPARISON.md) - How the buildpack works + diff --git a/docs/V4_V5_MIGRATION_GAP_ANALYSIS.md b/docs/V4_V5_MIGRATION_GAP_ANALYSIS.md new file mode 100644 index 000000000..062279e4b --- /dev/null +++ b/docs/V4_V5_MIGRATION_GAP_ANALYSIS.md @@ -0,0 +1,513 @@ +# PHP Buildpack v4.x to v5.x Migration Gap Analysis + +This document provides a comprehensive comparison between the v4.x (Python) and v5.x (Go) PHP buildpacks, identifying features that are missing, partially implemented, or fully implemented in v5.x. + +## Executive Summary + +| Category | v4.x Features | v5.x Status | Priority | +|----------|---------------|-------------|----------| +| Core Features | 15 | 15 implemented, 0 missing | Complete | +| Extensions | 5 | 4 implemented, 1 partial | Medium | +| Configuration Options | 25+ | 25+ implemented, 0 missing | Complete | +| Placeholder Syntax | 2 types | Both implemented | Complete | +| Service Bindings | 5 services | 4 implemented | Medium | + +--- + +## Feature Comparison Matrix + +### Legend +- ✅ **Implemented** - Feature works in v5.x +- ⚠️ **Partial** - Feature partially implemented or has limitations +- ❌ **Missing** - Feature not implemented in v5.x +- 🔄 **Changed** - Feature behavior changed significantly + +--- + +## 1. Configuration Options + +### 1.1 Core Options (options.json) + +| Option | v4.x | v5.x | Status | Notes | +|--------|------|------|--------|-------| +| `STACK` | ✅ | ✅ | ✅ | | +| `LIBDIR` | ✅ | ✅ | ✅ | Default: `lib` | +| `WEBDIR` | ✅ | ✅ | ✅ | Default: `htdocs` | +| `WEB_SERVER` | ✅ | ✅ | ✅ | `httpd`, `nginx`, `none` | +| `PHP_VM` | ✅ | ✅ | ✅ | Default: `php` | +| `ADMIN_EMAIL` | ✅ | ✅ | ✅ | Default: `admin@localhost` | +| `PHP_VERSION` | ✅ | ✅ | ✅ | Supports version placeholders | +| `PHP_DEFAULT` | ✅ | ✅ | ✅ | From manifest | +| `PHP_XX_LATEST` | ✅ | ✅ | ✅ | `PHP_81_LATEST`, `PHP_82_LATEST`, `PHP_83_LATEST` | +| `PHP_EXTENSIONS` | ✅ | ✅ | ✅ | Default: `["bz2","zlib","curl"]` | +| `ZEND_EXTENSIONS` | ✅ | ✅ | ✅ | Default: `[]` | +| `PHP_MODULES` | ✅ | ✅ | ✅ | | +| `HTTPD_STRIP` | ✅ | ✅ | ✅ | | +| `NGINX_STRIP` | ✅ | ✅ | ✅ | | +| `PHP_STRIP` | ✅ | ✅ | ✅ | | +| `COMPOSER_VENDOR_DIR` | ✅ | ✅ | ✅ | | +| `COMPOSER_INSTALL_OPTIONS` | ✅ | ✅ | ✅ | | +| `COMPOSER_INSTALL_GLOBAL` | ✅ | ✅ | ✅ | | +| **`ADDITIONAL_PREPROCESS_CMDS`** | ✅ | ✅ | ✅ **IMPLEMENTED** | Commands to run before app starts | +| **`APP_START_CMD`** | ✅ | ✅ | ✅ **IMPLEMENTED** | Custom start command for standalone apps | + +### 1.2 Missing Configuration Options - Details + +#### `ADDITIONAL_PREPROCESS_CMDS` ✅ IMPLEMENTED + +**Status:** Implemented in v5.x (Feb 2026) + +**v5.x Implementation:** +- `src/php/options/options.go` - `GetPreprocessCommands()` method +- `src/php/finalize/finalize.go` - `generatePreprocessCommandsScript()` method + +**Supported Formats (same as v4.x):** +```json +// String format +"ADDITIONAL_PREPROCESS_CMDS": "source $HOME/scripts/bootstrap.sh" + +// Array format +"ADDITIONAL_PREPROCESS_CMDS": ["env", "run_something"] + +// Array of arrays format +"ADDITIONAL_PREPROCESS_CMDS": [["echo", "Hello World"]] +``` + +**Use Cases:** +- Running database migrations before app starts +- Setting up environment variables via custom scripts +- Initializing cache directories +- Running Drupal drush commands (as reported by user akf in issue #1208) + +**Test Fixture:** `fixtures/preprocess_cmds/` + +--- + +#### `APP_START_CMD` ✅ IMPLEMENTED + +**Status:** Implemented in v5.x (Feb 2026) + +**v5.x Implementation:** +- `src/php/options/options.go` - `APP_START_CMD` field and `FindStandaloneApp()` method +- `src/php/finalize/finalize.go` - `generatePHPFPMStartScript()` modified for standalone mode +- `fixtures/standalone_app/` - Test fixture with explicit APP_START_CMD +- `fixtures/standalone_autodetect/` - Test fixture for auto-detection +- `src/php/integration/standalone_test.go` - Integration tests + +**v4.x Reference Implementation:** +```python +def find_stand_alone_app_to_run(ctx): + app = ctx.get('APP_START_CMD', None) + if app is None: + for name in ['app.php', 'main.php', 'run.php', 'start.php']: + if os.path.exists(os.path.join(ctx['BUILD_DIR'], name)): + app = name + break + if app is None: + raise RuntimeError('Unable to find stand-alone app to run...') + return app +``` + +**Usage:** +```json +{ + "WEB_SERVER": "none", + "APP_START_CMD": "worker.php" +} +``` + +**Auto-detection (when `WEB_SERVER=none` and no `APP_START_CMD`):** +1. `app.php` +2. `main.php` +3. `run.php` +4. `start.php` + +**Use Cases:** +- Background workers +- Queue processors +- CLI applications +- Scheduled tasks + +**Test Fixture:** `fixtures/standalone_app/` and `fixtures/standalone_autodetect/` + +**Impact:** MEDIUM - Required for standalone PHP applications (now implemented) + +--- + +## 2. Extensions + +### 2.1 Extension Comparison + +| Extension | v4.x | v5.x | Status | Notes | +|-----------|------|------|--------|-------| +| **Composer** | ✅ | ✅ | ✅ | Full feature parity | +| **NewRelic** | ✅ | ✅ | ✅ | Full feature parity | +| **AppDynamics** | ✅ | ✅ | ✅ | Full feature parity | +| **Dynatrace** | ✅ | ✅ | ✅ | Uses libbuildpack-dynatrace | +| **Sessions** | ✅ | ✅ | ✅ | Redis + Memcached | +| **User Extensions** | ✅ | ❌ | ❌ **MISSING** | `.extensions/` directory | + +### 2.2 Missing Extension Features + +#### User/Custom Extensions ❌ CRITICAL + +**v4.x Implementation:** `php-buildpack-v4/lib/build_pack_utils/builder.py` + +Users could create custom extensions in `.extensions/` directory: + +``` +app/ +├── .extensions/ +│ └── my_extension/ +│ └── extension.py +├── .bp-config/ +│ └── options.json +└── index.php +``` + +**extension.py interface:** +```python +def configure(ctx): + """Called during configure phase - set PHP version, extensions, etc.""" + pass + +def compile(install): + """Called during compile phase - install dependencies""" + pass + +def preprocess_commands(ctx): + """Return list of commands to run before app starts""" + return [] + +def service_commands(ctx): + """Return dict of background services to run""" + return {} + +def service_environment(ctx): + """Return dict of environment variables""" + return {} +``` + +**Use Cases:** +- Custom APM integrations +- Custom service bindings +- Application-specific setup +- Custom PHP extension installation + +**Impact:** MEDIUM - Power users rely on this for custom integrations + +--- + +## 3. Placeholder/Variable Substitution + +### 3.1 Placeholder Syntax Comparison + +| Syntax | v4.x | v5.x | Status | Context | +|--------|------|------|--------|---------| +| `@{VAR}` | ✅ | ✅ | ✅ | Environment variable substitution | +| `#{VAR}` | ✅ | ✅ | ✅ | Context variable substitution (added in 0185dd55e) | +| `{VAR}` | ✅ | ✅ | ✅ | PHP version placeholders only | +| `${VAR}` | ✅ | ✅ | ✅ | Shell expansion at runtime | + +### 3.2 Supported Placeholders + +| Placeholder | v4.x | v5.x | Context | Notes | +|-------------|------|------|---------|-------| +| `@{HOME}` / `#{HOME}` | ✅ | ✅ | Deps or App | `/home/vcap/deps/{idx}` or `/home/vcap/app` | +| `@{WEBDIR}` / `#{WEBDIR}` | ✅ | ✅ | App | Web root directory | +| `@{LIBDIR}` / `#{LIBDIR}` | ✅ | ✅ | App | Library directory | +| `@{TMPDIR}` / `#{TMPDIR}` | ✅ | ✅ | Runtime | Converted to `${TMPDIR}` | +| `@{PHP_FPM_LISTEN}` / `#{PHP_FPM_LISTEN}` | ✅ | ✅ | PHP | Socket or TCP address | +| `@{ADMIN_EMAIL}` / `#{ADMIN_EMAIL}` | ✅ | ✅ | Web server | Admin email | +| `@{DEPS_DIR}` / `#{DEPS_DIR}` | ✅ | ✅ | PHP | `/home/vcap/deps` | +| `@{PHP_EXTENSIONS}` | ✅ | ✅ | PHP | Extension loading directives | +| `@{ZEND_EXTENSIONS}` | ✅ | ✅ | PHP | Zend extension directives | +| `@{PHP_FPM_CONF_INCLUDE}` | ✅ | ✅ | PHP-FPM | Include directive for fpm.d | +| `{PHP_83_LATEST}` | ✅ | ✅ | Options | Resolved to actual version | +| `{PHP_82_LATEST}` | ✅ | ✅ | Options | Resolved to actual version | +| `{PHP_81_LATEST}` | ✅ | ✅ | Options | Resolved to actual version | + +--- + +## 4. Service Bindings (VCAP_SERVICES) + +### 4.1 Service Detection Comparison + +| Service | v4.x | v5.x | Status | Detection Pattern | +|---------|------|------|--------|-------------------| +| **NewRelic** | ✅ | ✅ | ✅ | Label: `newrelic` | +| **AppDynamics** | ✅ | ✅ | ✅ | Regex: `app[-]?dynamics` | +| **Dynatrace** | ✅ | ✅ | ✅ | Via libbuildpack-dynatrace | +| **Redis Sessions** | ✅ | ✅ | ✅ | Name contains: `redis-sessions` | +| **Memcached Sessions** | ✅ | ✅ | ✅ | Name contains: `memcached-sessions` | + +### 4.2 Environment Variable Overrides + +| Variable | v4.x | v5.x | Status | Purpose | +|----------|------|------|--------|---------| +| `NEWRELIC_LICENSE` | ✅ | ✅ | ✅ | Manual license key | +| `REDIS_SESSION_STORE_SERVICE_NAME` | ✅ | ✅ | ✅ | Custom service name trigger | +| `MEMCACHED_SESSION_STORE_SERVICE_NAME` | ✅ | ✅ | ✅ | Custom service name trigger | +| `COMPOSER_GITHUB_OAUTH_TOKEN` | ✅ | ✅ | ✅ | GitHub API authentication | +| `COMPOSER_PATH` | ✅ | ✅ | ✅ | Custom composer.json location | + +--- + +## 5. Web Server Configuration + +### 5.1 HTTPD (Apache) + +| Feature | v4.x | v5.x | Status | +|---------|------|------|--------| +| Default config | ✅ | ✅ | ✅ | +| User overrides (`.bp-config/httpd/`) | ✅ | ✅ | ✅ | +| mod_proxy_fcgi | ✅ | ✅ | ✅ | +| mod_deflate | ✅ | ✅ | ✅ | +| mod_remoteip | ✅ | ✅ | ✅ | +| PHP-FPM via TCP | ✅ | ✅ | ✅ | + +### 5.2 Nginx + +| Feature | v4.x | v5.x | Status | +|---------|------|------|--------| +| Default config | ✅ | ✅ | ✅ | +| User overrides (`.bp-config/nginx/`) | ✅ | ✅ | ✅ | +| FastCGI | ✅ | ✅ | ✅ | +| gzip compression | ✅ | ✅ | ✅ | +| PHP-FPM via TCP/Socket | ✅ | ✅ | ✅ | + +--- + +## 6. PHP Configuration + +### 6.1 PHP.ini and PHP-FPM + +| Feature | v4.x | v5.x | Status | +|---------|------|------|--------| +| Default php.ini | ✅ | ✅ | ✅ | +| User php.ini (`.bp-config/php/php.ini`) | ✅ | ✅ | ✅ | +| php.ini.d directory | ✅ | ✅ | ✅ | +| Default php-fpm.conf | ✅ | ✅ | ✅ | +| User php-fpm.conf | ✅ | ✅ | ✅ | +| fpm.d directory | ✅ | ✅ | ✅ | +| Extension validation | ✅ | ✅ | ✅ | +| Compiled module detection | ✅ | ✅ | ✅ | + +### 6.2 Composer Integration + +| Feature | v4.x | v5.x | Status | +|---------|------|------|--------| +| Auto-detect composer.json | ✅ | ✅ | ✅ | +| PHP version from composer.json | ✅ | ✅ | ✅ | +| PHP version from composer.lock | ✅ | ✅ | ✅ | +| Extension detection (ext-*) | ✅ | ✅ | ✅ | +| Semver constraint parsing | ✅ | ✅ | ✅ | +| GitHub rate limit detection | ✅ | ✅ | ✅ | +| auth.json support | ✅ | ✅ | ✅ | +| Vendor symlink in WEBDIR | ❌ | ✅ | ✅ | New in v5.x | + +--- + +## 7. Build Process + +### 7.1 Build Phases + +| Phase | v4.x | v5.x | Status | Notes | +|-------|------|------|--------|-------| +| Detect | ✅ | ✅ | ✅ | | +| Supply | ✅ | ✅ | ✅ | | +| Finalize | ✅ | ✅ | ✅ | | +| Release | ✅ | ✅ | ✅ | | + +### 7.2 Multi-Buildpack Support + +| Feature | v4.x | v5.x | Status | Notes | +|---------|------|------|--------|-------| +| `000_multi-supply.sh` | ✅ | ✅ | ✅ | Created by libbuildpack | +| PATH setup | ✅ | ✅ | ✅ | | +| LD_LIBRARY_PATH setup | ✅ | ✅ | ✅ | | +| LIBRARY_PATH setup | ✅ | ✅ | ✅ | | +| profile.d scripts | ✅ | ✅ | ✅ | | + +--- + +## 8. Runtime Features + +### 8.1 Process Management + +| Feature | v4.x | v5.x | Status | Notes | +|---------|------|------|--------|-------| +| PHP-FPM + Web Server | ✅ | ✅ | ✅ | | +| Signal handling | ✅ | ✅ | ✅ | | +| Graceful shutdown | ✅ | ✅ | ✅ | | +| Pre-start script | ❌ | ✅ | ✅ | New in v5.x | +| **Standalone PHP mode** | ✅ | ✅ | ✅ **COMPLETE** | With APP_START_CMD | + +### 8.2 Environment Setup + +| Feature | v4.x | v5.x | Status | +|---------|------|------|--------| +| PHPRC | ✅ | ✅ | ✅ | +| PHP_INI_SCAN_DIR | ✅ | ✅ | ✅ | +| PATH includes PHP | ✅ | ✅ | ✅ | +| DEPS_DIR fallback | ✅ | ✅ | ✅ | +| TMPDIR customization | ✅ | ✅ | ✅ | + +--- + +## 9. Priority Implementation Roadmap + +### 9.1 Completed ✅ + +| Feature | Effort | Impact | Status | +|---------|--------|--------|--------| +| `ADDITIONAL_PREPROCESS_CMDS` | Medium | HIGH | ✅ Implemented (#1208) | +| `APP_START_CMD` | Low | MEDIUM | ✅ Implemented (Feb 2026) | + +### 9.2 High Priority (Remaining) + +| Feature | Effort | Impact | +|---------|--------|--------| +| User Extensions (`.extensions/`) | High | MEDIUM | + +### 9.3 Nice to Have + +| Feature | Effort | Impact | +|---------|--------|--------| +| Additional APM integrations | Medium | LOW | + +--- + +## 10. Implementation Details for Missing Features + +### 10.1 ADDITIONAL_PREPROCESS_CMDS Implementation + +**Location:** `src/php/options/options.go` + +Add to Options struct: +```go +type Options struct { + // ... existing fields ... + AdditionalPreprocessCmds interface{} `json:"ADDITIONAL_PREPROCESS_CMDS,omitempty"` +} +``` + +**Location:** `src/php/finalize/finalize.go` + +Add preprocessing logic: +```go +func (f *Finalizer) runAdditionalPreprocessCmds(opts *options.Options) error { + cmds := opts.GetPreprocessCommands() + for _, cmd := range cmds { + f.Log.Info("Running preprocess command: %s", cmd) + if err := f.Command.Execute(f.Stager.BuildDir(), f.Log.Output(), f.Log.Output(), "bash", "-c", cmd); err != nil { + return fmt.Errorf("preprocess command failed: %w", err) + } + } + return nil +} +``` + +**Alternative:** Add to start script for runtime execution (matching v4.x behavior). + +### 10.2 APP_START_CMD Implementation + +**Location:** `src/php/options/options.go` + +Add to Options struct: +```go +type Options struct { + // ... existing fields ... + AppStartCmd string `json:"APP_START_CMD,omitempty"` +} +``` + +**Location:** `src/php/finalize/finalize.go` + +Modify `generatePHPFPMStartScript`: +```go +func (f *Finalizer) generatePHPFPMStartScript(depsIdx string, opts *options.Options) string { + appCmd := opts.AppStartCmd + if appCmd == "" { + // Auto-detect: app.php, main.php, run.php, start.php + for _, name := range []string{"app.php", "main.php", "run.php", "start.php"} { + if exists, _ := libbuildpack.FileExists(filepath.Join(f.Stager.BuildDir(), name)); exists { + appCmd = name + break + } + } + } + if appCmd == "" { + return "" // Error: no standalone app found + } + + // Generate script that runs: php $appCmd + // ... +} +``` + +### 10.3 User Extensions Implementation + +**Location:** `src/php/extensions/user/` + +Create user extension loader: +```go +func LoadUserExtensions(buildDir string, registry *Registry) error { + extensionsDir := filepath.Join(buildDir, ".extensions") + if exists, _ := libbuildpack.FileExists(extensionsDir); !exists { + return nil + } + + // For each subdirectory in .extensions/ + // Load extension.py and execute Python methods + // OR: Define a Go-native extension interface + // ... +} +``` + +**Note:** This is complex because v4.x extensions are Python. Options: +1. Keep Python interpreter for user extensions (complex) +2. Define new Go-native extension interface (breaking change) +3. Support shell scripts as extensions (simpler) + +--- + +## 11. Testing Recommendations + +### 11.1 Integration Tests Needed + +| Test | Status | Priority | +|------|--------|----------| +| ADDITIONAL_PREPROCESS_CMDS - string format | ✅ | HIGH | +| ADDITIONAL_PREPROCESS_CMDS - array format | ✅ | HIGH | +| APP_START_CMD - explicit | ✅ | MEDIUM | +| APP_START_CMD - auto-detect | ✅ | MEDIUM | +| User extensions | ❌ | LOW | +| Multi-buildpack with apt-buildpack | ⚠️ | HIGH | + +### 11.2 User Acceptance Testing + +Test with real-world applications: +- [ ] Drupal (akf's use case - https://github.com/gsa/digital-gov-drupal) +- [ ] Laravel +- [ ] Symfony +- [ ] WordPress +- [ ] CakePHP + +--- + +## 12. References + +- Issue #1208: https://github.com/cloudfoundry/php-buildpack/issues/1208 +- PR #1218: https://github.com/cloudfoundry/php-buildpack/pull/1218 +- v4.x Source: `php-buildpack-v4/` +- v5.x Source: `src/php/` +- CF Buildpack Documentation: https://docs.cloudfoundry.org/buildpacks/php/ + +--- + +## Changelog + +| Date | Version | Changes | +|------|---------|---------| +| 2026-02-15 | 1.0 | Initial gap analysis | diff --git a/docs/VCAP_SERVICES_USAGE.md b/docs/VCAP_SERVICES_USAGE.md new file mode 100644 index 000000000..efc6ff9c3 --- /dev/null +++ b/docs/VCAP_SERVICES_USAGE.md @@ -0,0 +1,404 @@ +# VCAP_SERVICES Usage in PHP Buildpack + +This document explains how the PHP buildpack handles Cloud Foundry service bindings (VCAP_SERVICES) and compares our approach with other Cloud Foundry buildpacks. + +## Table of Contents +- [Quick Summary](#quick-summary) +- [VCAP_SERVICES Availability](#vcap_services-availability) +- [How PHP Buildpack v5.x Uses VCAP_SERVICES](#how-php-buildpack-v5x-uses-vcap_services) +- [Comparison with Other Buildpacks](#comparison-with-other-buildpacks) +- [Migration from v4.x](#migration-from-v4x) +- [Best Practices](#best-practices) + +--- + +## Quick Summary + +**TL;DR:** +- ✅ VCAP_SERVICES **IS available** during staging (in Go code) +- ✅ Extensions **CAN read** VCAP_SERVICES to configure agents +- ✅ Can write profile.d scripts with parsed service credentials +- ❌ `@{VCAP_SERVICES}` **NOT available** as config file placeholder +- ✅ PHP v5.x follows same patterns as all other CF buildpacks + +--- + +## VCAP_SERVICES Availability + +### When is VCAP_SERVICES Available? + +Cloud Foundry provides `VCAP_SERVICES` as an environment variable during **both staging and runtime**: + +| Phase | VCAP_SERVICES Available? | How to Access | +|-------|--------------------------|---------------| +| **Staging (Supply/Finalize)** | ✅ Yes | `os.Getenv("VCAP_SERVICES")` in Go code | +| **Runtime (Container Startup)** | ✅ Yes | `getenv('VCAP_SERVICES')` in PHP code or `$VCAP_SERVICES` in shell | + +**Important:** VCAP_SERVICES is available during staging, allowing buildpacks to: +- Detect bound services +- Extract credentials +- Configure agents and extensions +- Write configuration files + +--- + +## How PHP Buildpack v5.x Uses VCAP_SERVICES + +### 1. Extension Context Initialization + +During the supply phase, the extension framework automatically parses VCAP_SERVICES: + +**Code Location:** `src/php/extensions/extension.go:77-82` + +```go +// Parse VCAP_SERVICES +if vcapServicesJSON := os.Getenv("VCAP_SERVICES"); vcapServicesJSON != "" { + if err := json.Unmarshal([]byte(vcapServicesJSON), &ctx.VcapServices); err != nil { + return nil, fmt.Errorf("failed to parse VCAP_SERVICES: %w", err) + } +} +``` + +This makes VCAP_SERVICES available to all extensions via `ctx.VcapServices`. + +### 2. Extension Usage Examples + +#### NewRelic Extension + +**Code Location:** `src/php/extensions/newrelic/newrelic.go` + +```go +// Writes a profile.d script that extracts license key at runtime +const newrelicEnvScript = `if [[ -z "${NEWRELIC_LICENSE:-}" ]]; then + export NEWRELIC_LICENSE=$(echo $VCAP_SERVICES | jq -r '.newrelic[0].credentials.licenseKey') +fi` +``` + +**What it does:** +1. During staging: Creates profile.d script +2. At runtime: Script extracts NewRelic license from VCAP_SERVICES + +#### Sessions Extension + +**Code Location:** `src/php/extensions/sessions/sessions.go` + +```go +func (e *SessionsExtension) loadSession(ctx *extensions.Context) BaseSetup { + // Search for appropriately named session store in VCAP_SERVICES + for _, services := range ctx.VcapServices { + for _, service := range services { + serviceName := service.Name + // Check if service matches Redis or Memcached patterns + if strings.Contains(strings.ToLower(serviceName), "redis") { + return &RedisSetup{Service: service} + } + if strings.Contains(strings.ToLower(serviceName), "memcache") { + return &MemcachedSetup{Service: service} + } + } + } + return nil +} +``` + +**What it does:** +1. During staging: Parses VCAP_SERVICES to find Redis/Memcached services +2. Configures PHP session handler accordingly +3. Writes php.ini with session configuration + +#### AppDynamics Extension + +**Code Location:** `src/php/extensions/appdynamics/appdynamics.go` + +Similar pattern - reads VCAP_SERVICES during staging to configure agent. + +--- + +## Comparison with Other Buildpacks + +### All CF Buildpacks Follow the Same Pattern + +After analyzing Go, Java, Ruby, and Python buildpacks, we found **all buildpacks use VCAP_SERVICES the same way**: + +#### Go Buildpack + +**Code Location:** `go-buildpack/src/go/hooks/appdynamics.go:75` + +```go +func (h AppdynamicsHook) BeforeCompile(stager *libbuildpack.Stager) error { + vcapServices := os.Getenv("VCAP_SERVICES") + services := make(map[string][]Plan) + err := json.Unmarshal([]byte(vcapServices), &services) + + if val, ok := services["appdynamics"]; ok { + // Configure AppDynamics agent + // Write profile.d script with environment variables + } +} +``` + +#### Java Buildpack + +**Code Location:** `java-buildpack/src/java/common/context.go:106` + +```go +func GetVCAPServices() (VCAPServices, error) { + vcapServicesStr := os.Getenv("VCAP_SERVICES") + if vcapServicesStr == "" { + return VCAPServices{}, nil + } + // Parse and return services +} +``` + +Used in multiple frameworks (Sealights, JVMKill, etc.) + +#### Ruby/Python Buildpacks + +Similar patterns - all read VCAP_SERVICES during staging to configure services. + +### What NO Buildpack Does + +**Config File Placeholders:** No buildpack (except PHP v4.x) ever supported using `@{VCAP_SERVICES}` or other runtime environment variables as **config file placeholders**. + +| Feature | PHP v4.x | PHP v5.x | Go | Java | Ruby | Python | +|---------|----------|----------|-----|------|------|--------| +| Read VCAP_SERVICES in code (staging) | ✅ | ✅ | ✅ | ✅ | ✅ | ✅ | +| Configure from VCAP_SERVICES | ✅ | ✅ | ✅ | ✅ | ✅ | ✅ | +| Write profile.d scripts | ✅ | ✅ | ✅ | ✅ | ✅ | ✅ | +| **@{VCAP_SERVICES} in config files** | ✅ | ❌ | ❌ | ❌ | ❌ | ❌ | + +**Key Insight:** The runtime config rewrite feature (using `@{VCAP_SERVICES}` in config files) was **unique to PHP v4.x** and not a standard Cloud Foundry pattern. + +--- + +## Migration from v4.x + +### What Changed + +PHP v4.x had **two** mechanisms for using VCAP_SERVICES: + +1. **Staging-time (like v5.x):** Extensions read VCAP_SERVICES in Python code +2. **Runtime (removed in v5.x):** `bin/rewrite` script allowed `@{VCAP_SERVICES}` in config files + +PHP v5.x removed mechanism #2, aligning with all other Cloud Foundry buildpacks. + +### Scenarios That No Longer Work + +#### Scenario 1: VCAP_SERVICES in Config Files + +**v4.x (NO LONGER WORKS):** +```ini +# .bp-config/php/fpm.d/db.conf +[www] +env[DB_HOST] = @{VCAP_SERVICES} ; ← Runtime rewrite expanded this +``` + +**v5.x Migration Option 1 - Application Code:** +```php + +``` + +**v5.x Migration Option 2 - profile.d Script:** +```bash +#!/bin/bash +# .profile.d/parse-vcap.sh +export DB_HOST=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.host') +export DB_PORT=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.port') +export DB_NAME=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.name') +``` + +Then in FPM config: +```ini +[www] +env[DB_HOST] = ${DB_HOST} +env[DB_PORT] = ${DB_PORT} +env[DB_NAME] = ${DB_NAME} +``` + +#### Scenario 2: CF_INSTANCE_* Variables + +**v4.x (NO LONGER WORKS):** +```ini +[www] +env[INSTANCE_INDEX] = @{CF_INSTANCE_INDEX} +``` + +**v5.x Migration - Shell Variables:** +```ini +[www] +env[INSTANCE_INDEX] = ${CF_INSTANCE_INDEX} +``` + +Or read in application code: +```php + +``` + +--- + +## Best Practices + +### ✅ Recommended Patterns + +#### 1. Use Built-in Extension Support + +For common services, let extensions handle VCAP_SERVICES automatically: + +**NewRelic:** +```bash +# Just bind the service +cf bind-service my-app my-newrelic-service +# Extension automatically configures NewRelic +``` + +**Redis/Memcached Sessions:** +```bash +# Bind Redis service +cf bind-service my-app my-redis +# Extension automatically configures PHP sessions +``` + +#### 2. Profile.d Scripts for Custom Services + +For custom service parsing: + +**File:** `.profile.d/parse-services.sh` +```bash +#!/bin/bash + +# Extract database credentials +if [[ -n "$VCAP_SERVICES" ]]; then + export DB_HOST=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.host') + export DB_PORT=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.port') + export DB_USER=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.username') + export DB_PASS=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.password') + export DB_NAME=$(echo $VCAP_SERVICES | jq -r '.mysql[0].credentials.name') +fi +``` + +Then use in PHP: +```php + +``` + +#### 3. Application Code Parsing + +For complex service logic: + +```php +services = $vcapJson ? json_decode($vcapJson, true) : []; + } + + public function getService($label, $name = null) { + if (!isset($this->services[$label])) { + return null; + } + + $services = $this->services[$label]; + if ($name === null) { + return $services[0] ?? null; + } + + foreach ($services as $service) { + if ($service['name'] === $name) { + return $service; + } + } + return null; + } + + public function getCredentials($label, $name = null) { + $service = $this->getService($label, $name); + return $service ? $service['credentials'] : null; + } +} + +// Usage +$vcap = new VcapParser(); +$mysqlCreds = $vcap->getCredentials('mysql'); +$host = $mysqlCreds['host']; +?> +``` + +### ❌ Anti-Patterns (Don't Do This) + +#### 1. Trying to Use @{VCAP_SERVICES} Placeholders + +```ini +# DOES NOT WORK - Not a supported placeholder +[www] +env[SERVICES] = @{VCAP_SERVICES} +``` + +#### 2. Expecting Runtime Config Changes Without Restaging + +```bash +# If you change service bindings: +cf unbind-service my-app old-db +cf bind-service my-app new-db + +# Must restage to pick up new VCAP_SERVICES in config: +cf restage my-app # Required! +cf restart my-app # Not sufficient if using build-time config +``` + +**Exception:** If using `${VCAP_SERVICES}` in shell contexts or reading in PHP code, restart is sufficient. + +--- + +## Summary + +### PHP Buildpack v5.x is Aligned with CF Standards + +The PHP buildpack v5.x follows the same VCAP_SERVICES patterns as all other Cloud Foundry buildpacks: + +1. ✅ Read VCAP_SERVICES during staging +2. ✅ Configure extensions and agents +3. ✅ Write profile.d scripts +4. ✅ Parse and extract service credentials +5. ❌ No config file placeholders for arbitrary env vars + +### The v4.x Runtime Rewrite Was PHP-Specific + +The ability to use `@{VCAP_SERVICES}` in config files was: +- **Unique to PHP v4.x** - No other buildpack had this +- **Removed for good reasons:** + - Performance (no runtime rewriting) + - Security (reduced attack surface) + - Predictability (configs locked at staging) + - Alignment with other buildpacks + +### Migration is Straightforward + +All v4.x VCAP_SERVICES use cases have clear v5.x equivalents: +- Extension-based configuration (same as v4.x) +- Profile.d scripts (standard CF pattern) +- Application code parsing (standard practice) + +For detailed migration examples, see [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md). + +--- + +## See Also + +- [REWRITE_MIGRATION.md](REWRITE_MIGRATION.md) - Complete v4.x to v5.x migration guide +- [Cloud Foundry VCAP_SERVICES Documentation](https://docs.cloudfoundry.org/devguide/deploy-apps/environment-variable.html#VCAP-SERVICES) +- [PHP Extensions Guide](./EXTENSIONS.md) - How to create custom extensions diff --git a/fixtures/custom_libdir_hash/.bp-config/options.json b/fixtures/custom_libdir_hash/.bp-config/options.json new file mode 100644 index 000000000..dfa573b3b --- /dev/null +++ b/fixtures/custom_libdir_hash/.bp-config/options.json @@ -0,0 +1,4 @@ +{ + "WEB_SERVER": "httpd", + "LIBDIR": "lib" +} diff --git a/fixtures/custom_libdir_hash/.bp-config/php/php.ini.d/custom.ini b/fixtures/custom_libdir_hash/.bp-config/php/php.ini.d/custom.ini new file mode 100644 index 000000000..ddbc9721b --- /dev/null +++ b/fixtures/custom_libdir_hash/.bp-config/php/php.ini.d/custom.ini @@ -0,0 +1,2 @@ +; Custom PHP configuration using #{LIBDIR} placeholder +include_path = ".:/usr/share/php:#{HOME}/#{LIBDIR}" diff --git a/fixtures/custom_libdir_hash/index.php b/fixtures/custom_libdir_hash/index.php new file mode 100644 index 000000000..61ace196d --- /dev/null +++ b/fixtures/custom_libdir_hash/index.php @@ -0,0 +1,2 @@ + + Options Indexes FollowSymLinks + AllowOverride All + Require all granted + + +DirectoryIndex index.php index.html +TypesConfig conf/mime.types + + + SetHandler "proxy:fcgi://@{PHP_FPM_LISTEN}" + + +ErrorLog logs/error.log +LogLevel warn diff --git a/fixtures/custom_webdir_config/.bp-config/options.json b/fixtures/custom_webdir_config/.bp-config/options.json new file mode 100644 index 000000000..c81b4a18d --- /dev/null +++ b/fixtures/custom_webdir_config/.bp-config/options.json @@ -0,0 +1,4 @@ +{ + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs" +} diff --git a/fixtures/custom_webdir_config/index.php b/fixtures/custom_webdir_config/index.php new file mode 100644 index 000000000..61ace196d --- /dev/null +++ b/fixtures/custom_webdir_config/index.php @@ -0,0 +1,2 @@ + - - + + net8.0 + diff --git a/fixtures/httpd_hash_placeholder/.bp-config/httpd/httpd.conf b/fixtures/httpd_hash_placeholder/.bp-config/httpd/httpd.conf new file mode 100644 index 000000000..9866875a8 --- /dev/null +++ b/fixtures/httpd_hash_placeholder/.bp-config/httpd/httpd.conf @@ -0,0 +1,29 @@ +ServerRoot "${HOME}/httpd" +Listen ${PORT} +ServerAdmin #{ADMIN_EMAIL} +DocumentRoot "${HOME}/#{WEBDIR}" + +LoadModule mpm_event_module modules/mod_mpm_event.so +LoadModule unixd_module modules/mod_unixd.so +LoadModule authz_core_module modules/mod_authz_core.so +LoadModule dir_module modules/mod_dir.so +LoadModule mime_module modules/mod_mime.so +LoadModule proxy_module modules/mod_proxy.so +LoadModule proxy_fcgi_module modules/mod_proxy_fcgi.so +LoadModule rewrite_module modules/mod_rewrite.so + + + Options Indexes FollowSymLinks + AllowOverride All + Require all granted + + +DirectoryIndex index.php index.html +TypesConfig conf/mime.types + + + SetHandler "proxy:fcgi://#{PHP_FPM_LISTEN}" + + +ErrorLog logs/error.log +LogLevel warn diff --git a/fixtures/httpd_hash_placeholder/.bp-config/options.json b/fixtures/httpd_hash_placeholder/.bp-config/options.json new file mode 100644 index 000000000..9209b39ff --- /dev/null +++ b/fixtures/httpd_hash_placeholder/.bp-config/options.json @@ -0,0 +1,5 @@ +{ + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs", + "ADMIN_EMAIL": "test@example.com" +} diff --git a/fixtures/httpd_hash_placeholder/index.php b/fixtures/httpd_hash_placeholder/index.php new file mode 100644 index 000000000..61ace196d --- /dev/null +++ b/fixtures/httpd_hash_placeholder/index.php @@ -0,0 +1,2 @@ + + Options Indexes FollowSymLinks + AllowOverride All + Require all granted + + +DirectoryIndex index.php index.html +TypesConfig conf/mime.types + + + SetHandler "proxy:fcgi://#{PHP_FPM_LISTEN}" + + +ErrorLog logs/error.log +LogLevel warn diff --git a/fixtures/mixed_placeholder_syntax/.bp-config/options.json b/fixtures/mixed_placeholder_syntax/.bp-config/options.json new file mode 100644 index 000000000..e16ca91b4 --- /dev/null +++ b/fixtures/mixed_placeholder_syntax/.bp-config/options.json @@ -0,0 +1,4 @@ +{ + "WEB_SERVER": "httpd", + "ADMIN_EMAIL": "test@example.com" +} diff --git a/fixtures/mixed_placeholder_syntax/index.php b/fixtures/mixed_placeholder_syntax/index.php new file mode 100644 index 000000000..61ace196d --- /dev/null +++ b/fixtures/mixed_placeholder_syntax/index.php @@ -0,0 +1,2 @@ + + diff --git a/fixtures/preprocess_cmds/.bp-config/options.json b/fixtures/preprocess_cmds/.bp-config/options.json new file mode 100644 index 000000000..ce39dbd74 --- /dev/null +++ b/fixtures/preprocess_cmds/.bp-config/options.json @@ -0,0 +1,9 @@ +{ + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs", + "ADDITIONAL_PREPROCESS_CMDS": [ + "echo 'PREPROCESS_MARKER_1' > $HOME/preprocess_ran.txt", + "echo 'PREPROCESS_MARKER_2' >> $HOME/preprocess_ran.txt", + "echo $HOME > $HOME/home_var_test.txt" + ] +} diff --git a/fixtures/preprocess_cmds/htdocs/index.php b/fixtures/preprocess_cmds/htdocs/index.php new file mode 100644 index 000000000..7c8d48daa --- /dev/null +++ b/fixtures/preprocess_cmds/htdocs/index.php @@ -0,0 +1,69 @@ + diff --git a/fixtures/standalone_app/.bp-config/options.json b/fixtures/standalone_app/.bp-config/options.json new file mode 100644 index 000000000..5a2956c61 --- /dev/null +++ b/fixtures/standalone_app/.bp-config/options.json @@ -0,0 +1,4 @@ +{ + "WEB_SERVER": "none", + "APP_START_CMD": "worker.php" +} diff --git a/fixtures/standalone_app/worker.php b/fixtures/standalone_app/worker.php new file mode 100644 index 000000000..8803b361c --- /dev/null +++ b/fixtures/standalone_app/worker.php @@ -0,0 +1,31 @@ + Building ${name} for ${os}" + rm -f "${output}" CGO_ENABLED=0 \ GOOS="${os}" \ go build \ diff --git a/scripts/integration.sh b/scripts/integration.sh index 75d6b2522..e4f2d3bb6 100755 --- a/scripts/integration.sh +++ b/scripts/integration.sh @@ -125,7 +125,7 @@ function specs::run() { platform_flag="--platform=${platform}" stack_flag="--stack=${stack}" token_flag="--github-token=${token}" - keep_failed_flag="" + keep_failed_flag="--keep-failed-containers=${keep_failed}" nodes=1 if [[ "${parallel}" == "true" ]]; then @@ -133,10 +133,6 @@ function specs::run() { serial_flag="" fi - if [[ "${keep_failed}" == "true" ]]; then - keep_failed_flag="--keep-failed-containers" - fi - local buildpack_file version version="$(cat "${ROOTDIR}/VERSION")" buildpack_file="$(buildpack::package "${version}" "${cached}" "${stack}")" @@ -151,12 +147,12 @@ function specs::run() { -mod vendor \ -v \ "${src}/integration" \ - "${cached_flag}" \ - "${platform_flag}" \ - "${token_flag}" \ - "${stack_flag}" \ - "${serial_flag}" \ - "${keep_failed_flag}" + ${cached_flag} \ + ${platform_flag} \ + ${token_flag} \ + ${stack_flag} \ + ${serial_flag} \ + ${keep_failed_flag} } function buildpack::package() { diff --git a/src/php/config/config.go b/src/php/config/config.go index a0e4b9f1c..4ec17171b 100644 --- a/src/php/config/config.go +++ b/src/php/config/config.go @@ -270,8 +270,8 @@ func ProcessPhpIni( } zendExtensionsString := strings.Join(zendExtensionLines, "\n") - phpIniContent = strings.ReplaceAll(phpIniContent, "#{PHP_EXTENSIONS}", extensionsString) - phpIniContent = strings.ReplaceAll(phpIniContent, "#{ZEND_EXTENSIONS}", zendExtensionsString) + phpIniContent = strings.ReplaceAll(phpIniContent, "@{PHP_EXTENSIONS}", extensionsString) + phpIniContent = strings.ReplaceAll(phpIniContent, "@{ZEND_EXTENSIONS}", zendExtensionsString) for placeholder, value := range additionalReplacements { phpIniContent = strings.ReplaceAll(phpIniContent, placeholder, value) diff --git a/src/php/config/defaults/config/httpd/extra/httpd-directories.conf b/src/php/config/defaults/config/httpd/extra/httpd-directories.conf index e844cdd5f..7a3587b05 100644 --- a/src/php/config/defaults/config/httpd/extra/httpd-directories.conf +++ b/src/php/config/defaults/config/httpd/extra/httpd-directories.conf @@ -3,7 +3,7 @@ Require all denied - + Options SymLinksIfOwnerMatch AllowOverride All Require all granted diff --git a/src/php/config/defaults/config/httpd/extra/httpd-php.conf b/src/php/config/defaults/config/httpd/extra/httpd-php.conf index e50e75733..d6a9563d2 100644 --- a/src/php/config/defaults/config/httpd/extra/httpd-php.conf +++ b/src/php/config/defaults/config/httpd/extra/httpd-php.conf @@ -1,6 +1,6 @@ DirectoryIndex index.php index.html index.htm -Define fcgi-listener fcgi://#{PHP_FPM_LISTEN}${HOME}/#{WEBDIR} +Define fcgi-listener fcgi://@{PHP_FPM_LISTEN}${HOME}/@{WEBDIR} # Noop ProxySet directive, disablereuse=On is the default value. @@ -11,10 +11,10 @@ Define fcgi-listener fcgi://#{PHP_FPM_LISTEN}${HOME}/#{WEBDIR} ProxySet disablereuse=On retry=0 - + # make sure the file exists so that if not, Apache will show its 404 page and not FPM - SetHandler proxy:fcgi://#{PHP_FPM_LISTEN} + SetHandler proxy:fcgi://@{PHP_FPM_LISTEN} diff --git a/src/php/config/defaults/config/httpd/httpd.conf b/src/php/config/defaults/config/httpd/httpd.conf index 81e4aebbb..9315f735e 100644 --- a/src/php/config/defaults/config/httpd/httpd.conf +++ b/src/php/config/defaults/config/httpd/httpd.conf @@ -2,7 +2,7 @@ ServerRoot "${HOME}/httpd" Listen ${PORT} ServerAdmin "${HTTPD_SERVER_ADMIN}" ServerName "0.0.0.0" -DocumentRoot "${HOME}/#{WEBDIR}" +DocumentRoot "${HOME}/@{WEBDIR}" Include conf/extra/httpd-modules.conf Include conf/extra/httpd-directories.conf Include conf/extra/httpd-mime.conf diff --git a/src/php/config/defaults/config/nginx/http-defaults.conf b/src/php/config/defaults/config/nginx/http-defaults.conf index 47fabe793..46cba7856 100644 --- a/src/php/config/defaults/config/nginx/http-defaults.conf +++ b/src/php/config/defaults/config/nginx/http-defaults.conf @@ -5,7 +5,7 @@ keepalive_timeout 65; gzip on; port_in_redirect off; - root @{HOME}/#{WEBDIR}; + root @{HOME}/@{WEBDIR}; index index.php index.html; server_tokens off; diff --git a/src/php/config/defaults/config/nginx/http-php.conf b/src/php/config/defaults/config/nginx/http-php.conf index 0f42b28a8..1a8757528 100644 --- a/src/php/config/defaults/config/nginx/http-php.conf +++ b/src/php/config/defaults/config/nginx/http-php.conf @@ -12,6 +12,6 @@ } upstream php_fpm { - server #{PHP_FPM_LISTEN}; + server unix:@{PHP_FPM_LISTEN}; } diff --git a/src/php/config/defaults/config/nginx/server-defaults.conf b/src/php/config/defaults/config/nginx/server-defaults.conf index a82fc2f5c..fbe026856 100644 --- a/src/php/config/defaults/config/nginx/server-defaults.conf +++ b/src/php/config/defaults/config/nginx/server-defaults.conf @@ -1,10 +1,10 @@ - listen @{PORT}; + listen ${PORT}; server_name _; - fastcgi_temp_path @{TMPDIR}/nginx_fastcgi 1 2; - client_body_temp_path @{TMPDIR}/nginx_client_body 1 2; - proxy_temp_path @{TMPDIR}/nginx_proxy 1 2; + fastcgi_temp_path ${TMPDIR}/nginx_fastcgi 1 2; + client_body_temp_path ${TMPDIR}/nginx_client_body 1 2; + proxy_temp_path ${TMPDIR}/nginx_proxy 1 2; real_ip_header x-forwarded-for; set_real_ip_from 10.0.0.0/8; diff --git a/src/php/config/defaults/config/php/8.1.x/php-fpm.conf b/src/php/config/defaults/config/php/8.1.x/php-fpm.conf index 7feb57ed4..1eb08dc8c 100644 --- a/src/php/config/defaults/config/php/8.1.x/php-fpm.conf +++ b/src/php/config/defaults/config/php/8.1.x/php-fpm.conf @@ -14,7 +14,7 @@ ; Pid file ; Note: the default prefix is /tmp/staged/app/php/var ; Default Value: none -pid = #DEPS_DIR/0/php/var/run/php-fpm.pid +pid = @{HOME}/php/var/run/php-fpm.pid ; Error log file ; If it's set to "syslog", log is sent to syslogd instead of being written @@ -148,7 +148,7 @@ group = vcap ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/src/php/config/defaults/config/php/8.1.x/php.ini b/src/php/config/defaults/config/php/8.1.x/php.ini index e795a48d8..035e3b6bf 100644 --- a/src/php/config/defaults/config/php/8.1.x/php.ini +++ b/src/php/config/defaults/config/php/8.1.x/php.ini @@ -737,7 +737,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -915,8 +915,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download (PHP 5+). ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/src/php/config/defaults/config/php/8.2.x/php-fpm.conf b/src/php/config/defaults/config/php/8.2.x/php-fpm.conf index 7feb57ed4..1eb08dc8c 100644 --- a/src/php/config/defaults/config/php/8.2.x/php-fpm.conf +++ b/src/php/config/defaults/config/php/8.2.x/php-fpm.conf @@ -14,7 +14,7 @@ ; Pid file ; Note: the default prefix is /tmp/staged/app/php/var ; Default Value: none -pid = #DEPS_DIR/0/php/var/run/php-fpm.pid +pid = @{HOME}/php/var/run/php-fpm.pid ; Error log file ; If it's set to "syslog", log is sent to syslogd instead of being written @@ -148,7 +148,7 @@ group = vcap ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/src/php/config/defaults/config/php/8.2.x/php.ini b/src/php/config/defaults/config/php/8.2.x/php.ini index 86eb70ff1..e782f1598 100644 --- a/src/php/config/defaults/config/php/8.2.x/php.ini +++ b/src/php/config/defaults/config/php/8.2.x/php.ini @@ -737,7 +737,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -915,8 +915,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download (PHP 5+). ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/src/php/config/defaults/config/php/8.3.x/php-fpm.conf b/src/php/config/defaults/config/php/8.3.x/php-fpm.conf index 7feb57ed4..1eb08dc8c 100644 --- a/src/php/config/defaults/config/php/8.3.x/php-fpm.conf +++ b/src/php/config/defaults/config/php/8.3.x/php-fpm.conf @@ -14,7 +14,7 @@ ; Pid file ; Note: the default prefix is /tmp/staged/app/php/var ; Default Value: none -pid = #DEPS_DIR/0/php/var/run/php-fpm.pid +pid = @{HOME}/php/var/run/php-fpm.pid ; Error log file ; If it's set to "syslog", log is sent to syslogd instead of being written @@ -148,7 +148,7 @@ group = vcap ; specific port; ; '/path/to/unix/socket' - to listen on a unix socket. ; Note: This value is mandatory. -listen = #PHP_FPM_LISTEN +listen = @{PHP_FPM_LISTEN} ; Set listen(2) backlog. ; Default Value: 65535 (-1 on FreeBSD and OpenBSD) @@ -458,7 +458,7 @@ pm.max_spare_servers = 3 ; Chdir to this directory at the start. ; Note: relative path can be used. ; Default Value: current directory or / when chroot -;chdir = @{HOME}/#{WEBDIR} +;chdir = @{HOME}/@{WEBDIR} ; Redirect worker stdout and stderr into main error log. If not set, stdout and ; stderr will be redirected to /dev/null according to FastCGI specs. @@ -520,4 +520,4 @@ clear_env = no ; - the global prefix if it's been set (-p argument) ; - /tmp/staged/app/php otherwise ;include=@{HOME}/php/etc/fpm.d/*.conf -#{PHP_FPM_CONF_INCLUDE} +@{PHP_FPM_CONF_INCLUDE} diff --git a/src/php/config/defaults/config/php/8.3.x/php.ini b/src/php/config/defaults/config/php/8.3.x/php.ini index 451fa6b29..130cbfd74 100644 --- a/src/php/config/defaults/config/php/8.3.x/php.ini +++ b/src/php/config/defaults/config/php/8.3.x/php.ini @@ -752,7 +752,7 @@ default_charset = "UTF-8" ;;;;;;;;;;;;;;;;;;;;;;;;; ; UNIX: "/path1:/path2" -include_path = "../lib/php:@{HOME}/#{LIBDIR}" +include_path = "../lib/php:@{HOME}/@{LIBDIR}" ; ; Windows: "\path1;\path2" ;include_path = ".;c:\php\includes" @@ -930,8 +930,8 @@ default_socket_timeout = 60 ; extension folders as well as the separate PECL DLL download. ; Be sure to appropriately set the extension_dir directive. ; -#{PHP_EXTENSIONS} -#{ZEND_EXTENSIONS} +@{PHP_EXTENSIONS} +@{ZEND_EXTENSIONS} ;;;;;;;;;;;;;;;;;;; ; Module Settings ; diff --git a/src/php/extensions/composer/composer.go b/src/php/extensions/composer/composer.go index e799d4501..552918d71 100644 --- a/src/php/extensions/composer/composer.go +++ b/src/php/extensions/composer/composer.go @@ -654,6 +654,12 @@ func (e *ComposerExtension) Compile(ctx *extensions.Context, installer *extensio return fmt.Errorf("failed to run composer: %w", err) } + // Create vendor symlink in WEBDIR for backward compatibility + // This allows apps to use `require 'vendor/autoload.php'` from their web root + if err := e.createVendorSymlink(); err != nil { + return fmt.Errorf("failed to create vendor symlink: %w", err) + } + return nil } @@ -873,6 +879,59 @@ func (e *ComposerExtension) runComposer(ctx *extensions.Context) error { return nil } +// createVendorSymlink creates a symlink from WEBDIR/vendor to the actual vendor directory +// This allows apps to use relative paths like `require 'vendor/autoload.php'` from their web root +func (e *ComposerExtension) createVendorSymlink() error { + // Only create symlink if: + // 1. WEBDIR exists (e.g., htdocs) + // 2. Vendor directory is not already inside WEBDIR + // 3. A vendor symlink doesn't already exist in WEBDIR + + webDirPath := filepath.Join(e.buildDir, e.webDir) + webDirVendorPath := filepath.Join(webDirPath, "vendor") + actualVendorPath := filepath.Join(e.buildDir, e.composerVendorDir) + + // Check if WEBDIR exists + if _, err := os.Stat(webDirPath); os.IsNotExist(err) { + return nil // WEBDIR doesn't exist, nothing to do + } + + // Check if vendor is already inside WEBDIR (no symlink needed) + if strings.HasPrefix(e.composerVendorDir, e.webDir+string(os.PathSeparator)) { + return nil // Vendor is already inside WEBDIR + } + + // Check if vendor directory or symlink already exists in WEBDIR + if info, err := os.Lstat(webDirVendorPath); err == nil { + if info.Mode()&os.ModeSymlink != 0 { + return nil // Symlink already exists + } + if info.IsDir() { + return nil // Real vendor directory exists + } + } + + // Check if actual vendor directory exists + if _, err := os.Stat(actualVendorPath); os.IsNotExist(err) { + return nil // Vendor directory doesn't exist yet + } + + // Calculate relative path from WEBDIR to vendor directory + // e.g., from htdocs/ to lib/vendor -> ../lib/vendor + relPath, err := filepath.Rel(webDirPath, actualVendorPath) + if err != nil { + return fmt.Errorf("failed to calculate relative path for vendor symlink: %w", err) + } + + // Create the symlink + if err := os.Symlink(relPath, webDirVendorPath); err != nil { + return fmt.Errorf("failed to create vendor symlink: %w", err) + } + + fmt.Printf("-----> Created vendor symlink: %s -> %s\n", filepath.Join(e.webDir, "vendor"), relPath) + return nil +} + // setupPHPConfig sets up PHP configuration files and processes extensions func (e *ComposerExtension) setupPHPConfig(ctx *extensions.Context) error { phpInstallDir := filepath.Join(e.buildDir, "php") @@ -928,7 +987,7 @@ func (e *ComposerExtension) processPhpIni(ctx *extensions.Context, phpIniPath st additionalReplacements := map[string]string{ "@{HOME}": e.buildDir, "@{TMPDIR}": e.tmpDir, - "#{LIBDIR}": e.libDir, + "@{LIBDIR}": e.libDir, } logWarning := func(format string, args ...interface{}) { diff --git a/src/php/extensions/newrelic/newrelic.go b/src/php/extensions/newrelic/newrelic.go index f8af9b828..32ebf87d6 100644 --- a/src/php/extensions/newrelic/newrelic.go +++ b/src/php/extensions/newrelic/newrelic.go @@ -223,10 +223,10 @@ func (e *NewRelicExtension) modifyPHPIni() error { } } - // If no extensions found, insert after #{PHP_EXTENSIONS} marker + // If no extensions found, insert after @{PHP_EXTENSIONS} marker if insertPos == -1 { for i, line := range lines { - if strings.Contains(line, "#{PHP_EXTENSIONS}") { + if strings.Contains(line, "@{PHP_EXTENSIONS}") { insertPos = i + 1 break } diff --git a/src/php/extensions/newrelic/newrelic_test.go b/src/php/extensions/newrelic/newrelic_test.go index 3db984b68..6e1cec2eb 100644 --- a/src/php/extensions/newrelic/newrelic_test.go +++ b/src/php/extensions/newrelic/newrelic_test.go @@ -266,7 +266,7 @@ extension_dir = "/home/vcap/app/php/lib/php/extensions/debug-zts-20210902" phpIniPath = filepath.Join(phpDir, "php.ini") phpIniContent := `[PHP] extension_dir = "/home/vcap/app/php/lib/php/extensions/no-debug-non-zts-20210902" -#{PHP_EXTENSIONS} +@{PHP_EXTENSIONS} ` Expect(os.WriteFile(phpIniPath, []byte(phpIniContent), 0644)).To(Succeed()) diff --git a/src/php/finalize/finalize.go b/src/php/finalize/finalize.go index 5b8b40b8c..7f673ec0a 100644 --- a/src/php/finalize/finalize.go +++ b/src/php/finalize/finalize.go @@ -5,6 +5,7 @@ import ( "io" "os" "path/filepath" + "strings" "github.com/cloudfoundry/libbuildpack" "github.com/cloudfoundry/php-buildpack/src/php/extensions" @@ -101,6 +102,22 @@ func Run(f *Finalizer) error { } } + // Load options for config processing + bpDir := os.Getenv("BP_DIR") + if bpDir == "" { + return fmt.Errorf("BP_DIR environment variable not set") + } + opts, err := options.LoadOptions(bpDir, f.Stager.BuildDir(), f.Manifest, f.Log) + if err != nil { + return fmt.Errorf("could not load options: %v", err) + } + + // Process all config files (replace build-time placeholders) + if err := f.ProcessConfigs(opts); err != nil { + f.Log.Error("Error processing configs: %v", err) + return err + } + // Create start script if err := f.CreateStartScript(); err != nil { f.Log.Error("Error creating start script: %v", err) @@ -125,6 +142,12 @@ func Run(f *Finalizer) error { return err } + // Create .profile.d script for ADDITIONAL_PREPROCESS_CMDS (v4.x compatibility) + if err := f.CreatePreprocessScript(opts); err != nil { + f.Log.Error("Error creating preprocess script: %v", err) + return err + } + // Copy profile.d scripts from deps to BUILD_DIR/.profile.d // This ensures CF launcher sources them at runtime if err := f.Stager.SetLaunchEnvironment(); err != nil { @@ -214,6 +237,185 @@ export PATH="$DEPS_DIR/%s/php/bin:$DEPS_DIR/%s/php/sbin:$PATH" return f.Stager.WriteProfileD("php-env.sh", scriptContent) } +// CreatePreprocessScript creates a .profile.d script to run ADDITIONAL_PREPROCESS_CMDS +// This matches v4.x behavior where preprocess commands run via .profile.d +// with $HOME=/home/vcap (not /home/vcap/app as in the start script) +// +// SECURITY NOTE: ADDITIONAL_PREPROCESS_CMDS executes arbitrary shell commands +// provided by the application. This is intentional for v4.x compatibility +// (e.g., running database migrations, sourcing bootstrap scripts). +func (f *Finalizer) CreatePreprocessScript(opts *options.Options) error { + commands := opts.GetPreprocessCommands() + if len(commands) == 0 { + return nil + } + + // Security warning: Log that we're executing user-provided commands + f.Log.Warning("ADDITIONAL_PREPROCESS_CMDS detected: %d command(s) will execute at app startup", len(commands)) + f.Log.Warning("These commands run with full shell access - ensure they are trusted") + + var script strings.Builder + script.WriteString("#!/usr/bin/env bash\n") + script.WriteString("# ADDITIONAL_PREPROCESS_CMDS - runs before app starts\n") + script.WriteString("# This script is sourced by CF launcher via .profile.d\n") + script.WriteString("# For v4.x compatibility, we set HOME=/home/vcap during preprocess commands\n") + script.WriteString("# WARNING: These are user-provided commands executed with full shell access\n\n") + + // Save current HOME and set to /home/vcap for v4.x compatibility + // In v4.x, preprocess commands ran with $HOME=/home/vcap + // In v5.x, the CF launcher may set $HOME=/home/vcap/app before sourcing profile.d + script.WriteString("_PREPROCESS_ORIG_HOME=\"$HOME\"\n") + script.WriteString("export HOME=\"/home/vcap\"\n\n") + + script.WriteString("echo \"-----> Running preprocess commands...\"\n") + + for i, cmd := range commands { + // Log the command being run (use %q for safe quoting in echo) + script.WriteString(fmt.Sprintf("echo \" [%d] %s\"\n", i+1, cmd)) + // Run the command - use eval to handle complex shell commands + // Error message also uses %q to safely quote the command + script.WriteString(fmt.Sprintf("eval %q || { echo \"ERROR: Preprocess command failed: %q\"; exit 1; }\n", cmd, cmd)) + } + + script.WriteString("echo \"-----> Preprocess commands completed.\"\n\n") + + // Restore original HOME + script.WriteString("export HOME=\"$_PREPROCESS_ORIG_HOME\"\n") + script.WriteString("unset _PREPROCESS_ORIG_HOME\n") + + f.Log.Info("Writing preprocess commands to .profile.d/preprocess.sh") + return f.Stager.WriteProfileD("preprocess.sh", script.String()) +} + +// ProcessConfigs replaces build-time placeholders in all config files +func (f *Finalizer) ProcessConfigs(opts *options.Options) error { + buildDir := f.Stager.BuildDir() + depsIdx := f.Stager.DepsIdx() + depDir := f.Stager.DepDir() + + // Determine web server + webServer := opts.WebServer + webDir := opts.WebDir + if webDir == "" { + webDir = "htdocs" + } + libDir := opts.LibDir + if libDir == "" { + libDir = "lib" + } + + // Determine PHP-FPM listen address first (needed for both PHP and web server configs) + phpFpmListen := "127.0.0.1:9000" // Default TCP + if webServer == "nginx" { + // Nginx uses Unix socket for better performance + phpFpmListen = filepath.Join("/home/vcap/deps", depsIdx, "php", "var", "run", "php-fpm.sock") + } + + // Process PHP configs - use deps directory for @{HOME} + phpEtcDir := filepath.Join(depDir, "php", "etc") + if exists, _ := libbuildpack.FileExists(phpEtcDir); exists { + depsPath := filepath.Join("/home/vcap/deps", depsIdx) + phpReplacements := map[string]string{ + "@{HOME}": depsPath, + "#{HOME}": depsPath, // Support #{VAR} syntax for backward compatibility + "@{DEPS_DIR}": "/home/vcap/deps", // Available for user configs, though rarely needed + "#{DEPS_DIR}": "/home/vcap/deps", + "@{LIBDIR}": libDir, + "#{LIBDIR}": libDir, + "@{PHP_FPM_LISTEN}": phpFpmListen, + "#{PHP_FPM_LISTEN}": phpFpmListen, + // @{TMPDIR} is converted to ${TMPDIR} for shell expansion at runtime + // This allows users to customize TMPDIR via environment variable + "@{TMPDIR}": "${TMPDIR}", + "#{TMPDIR}": "${TMPDIR}", + } + + // Process fpm.d and php.ini.d directories separately with app HOME (not deps HOME) + // This is because these configs typically reference app paths: + // - fpm.d: environment variables for PHP scripts (run in app context) + // - php.ini.d: include paths, open_basedir, etc. (reference app directories) + fpmDDir := filepath.Join(phpEtcDir, "fpm.d") + phpIniDDir := filepath.Join(phpEtcDir, "php.ini.d") + + // Process PHP configs, excluding fpm.d and php.ini.d which we'll process separately + f.Log.Debug("Processing PHP configs in %s with replacements: %v (excluding fpm.d and php.ini.d)", phpEtcDir, phpReplacements) + if err := f.replacePlaceholdersInDirExclude(phpEtcDir, phpReplacements, []string{fpmDDir, phpIniDDir}); err != nil { + return fmt.Errorf("failed to process PHP configs: %w", err) + } + + // App-context replacements for fpm.d and php.ini.d + appContextReplacements := map[string]string{ + "@{HOME}": "/home/vcap/app", // Use app HOME for app-relative paths + "#{HOME}": "/home/vcap/app", // Support #{VAR} syntax for backward compatibility + "@{WEBDIR}": webDir, + "#{WEBDIR}": webDir, + "@{LIBDIR}": libDir, + "#{LIBDIR}": libDir, + "@{TMPDIR}": "${TMPDIR}", + "#{TMPDIR}": "${TMPDIR}", + } + + if exists, _ := libbuildpack.FileExists(fpmDDir); exists { + f.Log.Debug("Processing fpm.d configs in %s with replacements: %v", fpmDDir, appContextReplacements) + if err := f.replacePlaceholdersInDir(fpmDDir, appContextReplacements); err != nil { + return fmt.Errorf("failed to process fpm.d configs: %w", err) + } + } + + if exists, _ := libbuildpack.FileExists(phpIniDDir); exists { + f.Log.Debug("Processing php.ini.d configs in %s with replacements: %v", phpIniDDir, appContextReplacements) + if err := f.replacePlaceholdersInDir(phpIniDDir, appContextReplacements); err != nil { + return fmt.Errorf("failed to process php.ini.d configs: %w", err) + } + } + } + + // Process web server configs - use app directory for ${HOME} + appReplacements := map[string]string{ + "@{WEBDIR}": webDir, + "#{WEBDIR}": webDir, // Support #{VAR} syntax for backward compatibility + "@{LIBDIR}": libDir, + "#{LIBDIR}": libDir, + "@{PHP_FPM_LISTEN}": phpFpmListen, + "#{PHP_FPM_LISTEN}": phpFpmListen, + "@{ADMIN_EMAIL}": opts.AdminEmail, + "#{ADMIN_EMAIL}": opts.AdminEmail, + } + + // Process HTTPD configs + if webServer == "httpd" { + httpdConfDir := filepath.Join(buildDir, "httpd", "conf") + if exists, _ := libbuildpack.FileExists(httpdConfDir); exists { + f.Log.Debug("Processing HTTPD configs in %s", httpdConfDir) + if err := f.replacePlaceholdersInDir(httpdConfDir, appReplacements); err != nil { + return fmt.Errorf("failed to process HTTPD configs: %w", err) + } + } + } + + // Process Nginx configs + if webServer == "nginx" { + nginxConfDir := filepath.Join(buildDir, "nginx", "conf") + if exists, _ := libbuildpack.FileExists(nginxConfDir); exists { + // For nginx, also need to handle @{HOME} in some configs (like pid file) + nginxReplacements := make(map[string]string) + for k, v := range appReplacements { + nginxReplacements[k] = v + } + nginxReplacements["@{HOME}"] = "/home/vcap/app" + nginxReplacements["#{HOME}"] = "/home/vcap/app" // Support #{VAR} syntax + + f.Log.Debug("Processing Nginx configs in %s", nginxConfDir) + if err := f.replacePlaceholdersInDir(nginxConfDir, nginxReplacements); err != nil { + return fmt.Errorf("failed to process Nginx configs: %w", err) + } + } + } + + f.Log.Info("Config processing complete") + return nil +} + // CreateStartScript creates the start script for the application func (f *Finalizer) CreateStartScript() error { bpBinDir := filepath.Join(f.Stager.BuildDir(), ".bp", "bin") @@ -229,15 +431,6 @@ func (f *Finalizer) CreateStartScript() error { return fmt.Errorf("BP_DIR environment variable not set") } - // Copy pre-compiled rewrite binary from bin/rewrite to .bp/bin/rewrite - rewriteSrc := filepath.Join(bpDir, "bin", "rewrite") - rewriteDst := filepath.Join(bpBinDir, "rewrite") - if err := f.copyFile(rewriteSrc, rewriteDst); err != nil { - return fmt.Errorf("could not copy rewrite binary: %v", err) - } - f.Log.Debug("Copied pre-compiled rewrite binary to .bp/bin") - - // Load options from options.json to determine which web server to use opts, err := options.LoadOptions(bpDir, f.Stager.BuildDir(), f.Manifest, f.Log) if err != nil { return fmt.Errorf("could not load options: %v", err) @@ -269,56 +462,25 @@ func (f *Finalizer) CreateStartScript() error { return nil } -// writePreStartScript creates a pre-start wrapper that handles config rewriting -// before running optional user commands (e.g., migrations) and starting the server. -// This allows PHP commands to run with properly rewritten configs. +// writePreStartScript creates a pre-start wrapper that runs optional user commands +// (e.g., migrations) before starting the server. func (f *Finalizer) writePreStartScript() error { - depsIdx := f.Stager.DepsIdx() - - // Create script in .bp/bin/ directory (same location as start and rewrite) + // Create script in .bp/bin/ directory (same location as start) bpBinDir := filepath.Join(f.Stager.BuildDir(), ".bp", "bin") if err := os.MkdirAll(bpBinDir, 0755); err != nil { return fmt.Errorf("could not create .bp/bin directory: %v", err) } preStartPath := filepath.Join(bpBinDir, "pre-start") - script := fmt.Sprintf(`#!/usr/bin/env bash + script := `#!/usr/bin/env bash # PHP Pre-Start Wrapper -# Runs config rewriting and optional user command before starting servers +# Runs optional user command before starting servers set -e # Set DEPS_DIR with fallback : ${DEPS_DIR:=$HOME/.cloudfoundry} export DEPS_DIR -# Source all profile.d scripts to set up environment -for f in /home/vcap/deps/%s/profile.d/*.sh; do - [ -f "$f" ] && source "$f" -done - -# Export required variables for rewrite tool -export HOME="${HOME:-/home/vcap/app}" -export PHPRC="$DEPS_DIR/%s/php/etc" -export PHP_INI_SCAN_DIR="$DEPS_DIR/%s/php/etc/php.ini.d" - -echo "-----> Pre-start: Rewriting PHP configs..." - -# Rewrite PHP base configs with HOME=$DEPS_DIR/0 -OLD_HOME="$HOME" -export HOME="$DEPS_DIR/%s" -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini" -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php-fpm.conf" -export HOME="$OLD_HOME" - -# Rewrite user configs with app HOME -if [ -d "$DEPS_DIR/%s/php/etc/fpm.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/fpm.d" -fi - -if [ -d "$DEPS_DIR/%s/php/etc/php.ini.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini.d" -fi - # Run user command if provided if [ $# -gt 0 ]; then echo "-----> Pre-start: Running command: $@" @@ -331,7 +493,7 @@ fi # Start the application servers echo "-----> Pre-start: Starting application..." exec $HOME/.bp/bin/start -`, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) +` if err := os.WriteFile(preStartPath, []byte(script), 0755); err != nil { return fmt.Errorf("could not write pre-start script: %v", err) @@ -368,15 +530,28 @@ func (f *Finalizer) generateHTTPDStartScript(depsIdx string, opts *options.Optio libDir = "lib" // default } - phpFpmConfInclude := "; No additional includes" - return fmt.Sprintf(`#!/usr/bin/env bash # PHP Application Start Script (HTTPD) set -e # Set DEPS_DIR with fallback for different environments -: ${DEPS_DIR:=$HOME/.cloudfoundry} +: ${DEPS_DIR:=/home/vcap/deps} export DEPS_DIR + +# Set TMPDIR with fallback (users can override via environment variable) +: ${TMPDIR:=/home/vcap/tmp} +export TMPDIR + +# Source profile.d scripts (for environments where CF launcher doesn't run them) +# This ensures ADDITIONAL_PREPROCESS_CMDS and other setup scripts run +if [ -d "$HOME/../profile.d" ]; then + for script in "$HOME/../profile.d"/*.sh; do + if [ -f "$script" ]; then + source "$script" + fi + done +fi + export PHPRC="$DEPS_DIR/%s/php/etc" export PHP_INI_SCAN_DIR="$DEPS_DIR/%s/php/etc/php.ini.d" @@ -386,56 +561,41 @@ export PATH="$DEPS_DIR/%s/php/bin:$PATH" # Set HTTPD_SERVER_ADMIN if not already set export HTTPD_SERVER_ADMIN="${HTTPD_SERVER_ADMIN:-noreply@vcap.me}" -# Set template variables for rewrite tool - use absolute paths! -export HOME="${HOME:-/home/vcap/app}" -export WEBDIR="%s" -export LIBDIR="%s" -export PHP_FPM_LISTEN="127.0.0.1:9000" -export PHP_FPM_CONF_INCLUDE="%s" - echo "Starting PHP application with HTTPD..." echo "DEPS_DIR: $DEPS_DIR" -echo "WEBDIR: $WEBDIR" +echo "TMPDIR: $TMPDIR" echo "PHP-FPM: $DEPS_DIR/%s/php/sbin/php-fpm" echo "HTTPD: $DEPS_DIR/%s/httpd/bin/httpd" -echo "Checking if binaries exist..." -ls -la "$DEPS_DIR/%s/php/sbin/php-fpm" || echo "PHP-FPM not found!" -ls -la "$DEPS_DIR/%s/httpd/bin/httpd" || echo "HTTPD not found!" # Create symlinks for httpd files (httpd config expects them relative to ServerRoot) ln -sf "$DEPS_DIR/%s/httpd/modules" "$HOME/httpd/modules" ln -sf "$DEPS_DIR/%s/httpd/conf/mime.types" "$HOME/httpd/conf/mime.types" 2>/dev/null || \ touch "$HOME/httpd/conf/mime.types" -# Create httpd logs directory if it doesn't exist +# Create required directories mkdir -p "$HOME/httpd/logs" +mkdir -p "$DEPS_DIR/%s/php/var/run" +mkdir -p "$TMPDIR" + +# Expand ${TMPDIR} in PHP configs (php.ini uses ${TMPDIR} placeholder) +# This allows users to customize TMPDIR via environment variable +for config_file in "$PHPRC/php.ini" "$PHPRC/php-fpm.conf"; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi +done -# Run rewrite to update config with runtime values -$HOME/.bp/bin/rewrite "$HOME/httpd/conf" - -# Rewrite PHP base configs (php.ini, php-fpm.conf) with HOME=$DEPS_DIR/0 -# This ensures @{HOME} placeholders in extension_dir are replaced with correct deps path -OLD_HOME="$HOME" -export HOME="$DEPS_DIR/%s" -export DEPS_DIR -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini" -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php-fpm.conf" -export HOME="$OLD_HOME" - -# Rewrite user fpm.d configs with HOME=/home/vcap/app -# User configs expect HOME to be the app directory, not deps directory -if [ -d "$DEPS_DIR/%s/php/etc/fpm.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/fpm.d" -fi - -# Rewrite php.ini.d configs with app HOME as well (may contain user overrides) -if [ -d "$DEPS_DIR/%s/php/etc/php.ini.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini.d" +# Also process php.ini.d directory if it exists +if [ -d "$PHP_INI_SCAN_DIR" ]; then + for config_file in "$PHP_INI_SCAN_DIR"/*.ini; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi + done fi -# Create PHP-FPM socket directory if it doesn't exist -mkdir -p "$DEPS_DIR/%s/php/var/run" - # Start PHP-FPM in background $DEPS_DIR/%s/php/sbin/php-fpm -F -y $PHPRC/php-fpm.conf & PHP_FPM_PID=$! @@ -446,7 +606,7 @@ HTTPD_PID=$! # Wait for both processes wait $PHP_FPM_PID $HTTPD_PID -`, depsIdx, depsIdx, depsIdx, webDir, libDir, phpFpmConfInclude, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) +`, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) } // generateNginxStartScript generates a start script for Nginx with PHP-FPM @@ -470,56 +630,66 @@ func (f *Finalizer) generateNginxStartScript(depsIdx string, opts *options.Optio set -e # Set DEPS_DIR with fallback for different environments -: ${DEPS_DIR:=$HOME/.cloudfoundry} +: ${DEPS_DIR:=/home/vcap/deps} export DEPS_DIR + +# Set TMPDIR with fallback (users can override via environment variable) +: ${TMPDIR:=/home/vcap/tmp} +export TMPDIR + +# Source profile.d scripts (for environments where CF launcher doesn't run them) +# This ensures ADDITIONAL_PREPROCESS_CMDS and other setup scripts run +if [ -d "$HOME/../profile.d" ]; then + for script in "$HOME/../profile.d"/*.sh; do + if [ -f "$script" ]; then + source "$script" + fi + done +fi + export PHPRC="$DEPS_DIR/%s/php/etc" export PHP_INI_SCAN_DIR="$DEPS_DIR/%s/php/etc/php.ini.d" # Add PHP binaries to PATH for CLI commands (e.g., bin/cake migrations) export PATH="$DEPS_DIR/%s/php/bin:$PATH" -# Set template variables for rewrite tool - use absolute paths! -export HOME="${HOME:-/home/vcap/app}" -export WEBDIR="%s" -export LIBDIR="%s" -export PHP_FPM_LISTEN="127.0.0.1:9000" -export PHP_FPM_CONF_INCLUDE="" - echo "Starting PHP application with Nginx..." echo "DEPS_DIR: $DEPS_DIR" -echo "WEBDIR: $WEBDIR" +echo "TMPDIR: $TMPDIR" echo "PHP-FPM: $DEPS_DIR/%s/php/sbin/php-fpm" echo "Nginx: $DEPS_DIR/%s/nginx/sbin/nginx" -echo "Checking if binaries exist..." -ls -la "$DEPS_DIR/%s/php/sbin/php-fpm" || echo "PHP-FPM not found!" -ls -la "$DEPS_DIR/%s/nginx/sbin/nginx" || echo "Nginx not found!" - -# Run rewrite to update config with runtime values -$HOME/.bp/bin/rewrite "$HOME/nginx/conf" -# Rewrite PHP base configs (php.ini, php-fpm.conf) with HOME=$DEPS_DIR/0 -# This ensures @{HOME} placeholders in extension_dir are replaced with correct deps path -OLD_HOME="$HOME" -export HOME="$DEPS_DIR/%s" -export DEPS_DIR -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini" -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php-fpm.conf" -export HOME="$OLD_HOME" - -# Rewrite user fpm.d configs with HOME=/home/vcap/app -# User configs expect HOME to be the app directory, not deps directory -if [ -d "$DEPS_DIR/%s/php/etc/fpm.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/fpm.d" -fi +# Substitute runtime variables in nginx config +# PORT is assigned by Cloud Foundry, TMPDIR can be customized by user +sed -e "s|\${PORT}|$PORT|g" -e "s|\${TMPDIR}|$TMPDIR|g" "$HOME/nginx/conf/server-defaults.conf" > "$HOME/nginx/conf/server-defaults.conf.tmp" +mv "$HOME/nginx/conf/server-defaults.conf.tmp" "$HOME/nginx/conf/server-defaults.conf" + +# Expand ${TMPDIR} in PHP configs (php.ini uses ${TMPDIR} placeholder) +# This allows users to customize TMPDIR via environment variable +for config_file in "$PHPRC/php.ini" "$PHPRC/php-fpm.conf"; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi +done -# Rewrite php.ini.d configs with app HOME as well (may contain user overrides) -if [ -d "$DEPS_DIR/%s/php/etc/php.ini.d" ]; then - $HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc/php.ini.d" +# Also process php.ini.d directory if it exists +if [ -d "$PHP_INI_SCAN_DIR" ]; then + for config_file in "$PHP_INI_SCAN_DIR"/*.ini; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi + done fi # Create required directories mkdir -p "$DEPS_DIR/%s/php/var/run" mkdir -p "$HOME/nginx/logs" +mkdir -p "$TMPDIR" +mkdir -p "$TMPDIR/nginx_fastcgi" +mkdir -p "$TMPDIR/nginx_client_body" +mkdir -p "$TMPDIR/nginx_proxy" # Start PHP-FPM in background $DEPS_DIR/%s/php/sbin/php-fpm -F -y $PHPRC/php-fpm.conf & @@ -531,10 +701,11 @@ NGINX_PID=$! # Wait for both processes wait $PHP_FPM_PID $NGINX_PID -`, depsIdx, depsIdx, depsIdx, webDir, libDir, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) +`, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) } -// generatePHPFPMStartScript generates a start script for PHP-FPM only (no web server) +// generatePHPFPMStartScript generates a start script for standalone PHP applications (no web server) +// When WEB_SERVER=none, this runs a PHP script directly instead of PHP-FPM func (f *Finalizer) generatePHPFPMStartScript(depsIdx string, opts *options.Options) string { // Load options to get WEBDIR and other config values webDir := os.Getenv("WEBDIR") @@ -550,43 +721,84 @@ func (f *Finalizer) generatePHPFPMStartScript(depsIdx string, opts *options.Opti libDir = "lib" // default } + // Find the standalone app to run + appFile, err := opts.FindStandaloneApp(f.Stager.BuildDir()) + if err != nil { + // Log error but continue - the start script will fail at runtime with clear message + f.Log.Warning("Failed to find standalone app: %v", err) + f.Log.Warning("The application will fail to start. Set APP_START_CMD or create one of: app.php, main.php, run.php, start.php") + appFile = "" // Will generate error in start script + } else { + f.Log.Info("Standalone app mode: will run %s", appFile) + } + return fmt.Sprintf(`#!/usr/bin/env bash -# PHP Application Start Script (PHP-FPM only) +# PHP Application Start Script (Standalone Mode) set -e # Set DEPS_DIR with fallback for different environments -: ${DEPS_DIR:=$HOME/.cloudfoundry} +: ${DEPS_DIR:=/home/vcap/deps} export DEPS_DIR + +# Set TMPDIR with fallback (users can override via environment variable) +: ${TMPDIR:=/home/vcap/tmp} +export TMPDIR + +# Source profile.d scripts (for environments where CF launcher doesn't run them) +# This ensures ADDITIONAL_PREPROCESS_CMDS and other setup scripts run +if [ -d "$HOME/../profile.d" ]; then + for script in "$HOME/../profile.d"/*.sh; do + if [ -f "$script" ]; then + source "$script" + fi + done +fi + export PHPRC="$DEPS_DIR/%s/php/etc" export PHP_INI_SCAN_DIR="$DEPS_DIR/%s/php/etc/php.ini.d" -# Set template variables for rewrite tool - use absolute paths! -export HOME="${HOME:-/home/vcap/app}" -export WEBDIR="%s" -export LIBDIR="%s" -export PHP_FPM_LISTEN="$DEPS_DIR/%s/php/var/run/php-fpm.sock" -export PHP_FPM_CONF_INCLUDE="" +# Add PHP binaries to PATH for CLI commands +export PATH="$DEPS_DIR/%s/php/bin:$PATH" -echo "Starting PHP-FPM only..." +echo "Starting standalone PHP application..." echo "DEPS_DIR: $DEPS_DIR" -echo "WEBDIR: $WEBDIR" -echo "PHP-FPM path: $DEPS_DIR/%s/php/sbin/php-fpm" -ls -la "$DEPS_DIR/%s/php/sbin/php-fpm" || echo "PHP-FPM not found!" - -# Temporarily set HOME to DEPS_DIR/0 for PHP config rewriting -# This ensures @{HOME} placeholders in extension_dir are replaced with the correct path -OLD_HOME="$HOME" -export HOME="$DEPS_DIR/%s" -export DEPS_DIR -$OLD_HOME/.bp/bin/rewrite "$DEPS_DIR/%s/php/etc" -export HOME="$OLD_HOME" +echo "TMPDIR: $TMPDIR" +echo "PHP: $DEPS_DIR/%s/php/bin/php" + +# Expand ${TMPDIR} in PHP configs (php.ini uses ${TMPDIR} placeholder) +# This allows users to customize TMPDIR via environment variable +for config_file in "$PHPRC/php.ini"; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi +done -# Create PHP-FPM socket directory if it doesn't exist -mkdir -p "$DEPS_DIR/%s/php/var/run" +# Also process php.ini.d directory if it exists +if [ -d "$PHP_INI_SCAN_DIR" ]; then + for config_file in "$PHP_INI_SCAN_DIR"/*.ini; do + if [ -f "$config_file" ]; then + sed "s|\${TMPDIR}|$TMPDIR|g" "$config_file" > "$config_file.tmp" + mv "$config_file.tmp" "$config_file" + fi + done +fi -# Start PHP-FPM in foreground -exec $DEPS_DIR/%s/php/sbin/php-fpm -F -y $PHPRC/php-fpm.conf -`, depsIdx, depsIdx, webDir, libDir, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx, depsIdx) +# Create required directories +mkdir -p "$TMPDIR" + +# Run the standalone PHP application +if [ -z "%s" ]; then + echo "ERROR: No standalone application found!" + echo "Please set APP_START_CMD in .bp-config/options.json" + echo "Or create one of: app.php, main.php, run.php, start.php" + exit 1 +fi + +echo "Running: php %s" +cd "$HOME" +exec $DEPS_DIR/%s/php/bin/php "%s" +`, depsIdx, depsIdx, depsIdx, depsIdx, appFile, appFile, depsIdx, appFile) } // SetupProcessTypes creates the process types for the application @@ -611,6 +823,54 @@ func (f *Finalizer) SetupProcessTypes() error { return nil } +// replacePlaceholders replaces build-time placeholders in a file +func (f *Finalizer) replacePlaceholders(filePath string, replacements map[string]string) error { + content, err := os.ReadFile(filePath) + if err != nil { + return fmt.Errorf("failed to read file %s: %w", filePath, err) + } + + result := string(content) + + // Replace all placeholders + for placeholder, value := range replacements { + result = strings.ReplaceAll(result, placeholder, value) + } + + if err := os.WriteFile(filePath, []byte(result), 0644); err != nil { + return fmt.Errorf("failed to write file %s: %w", filePath, err) + } + + return nil +} + +// replacePlaceholdersInDir replaces placeholders in all files in a directory recursively +func (f *Finalizer) replacePlaceholdersInDir(dirPath string, replacements map[string]string) error { + return f.replacePlaceholdersInDirExclude(dirPath, replacements, nil) +} + +func (f *Finalizer) replacePlaceholdersInDirExclude(dirPath string, replacements map[string]string, excludeDirs []string) error { + return filepath.Walk(dirPath, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + // Skip directories, but check if we should skip their contents + if info.IsDir() { + // Check if this directory should be excluded + for _, exclude := range excludeDirs { + if path == exclude { + return filepath.SkipDir + } + } + return nil + } + + // Replace placeholders in this file + return f.replacePlaceholders(path, replacements) + }) +} + func (f *Finalizer) copyFile(src, dst string) error { sourceFile, err := os.Open(src) if err != nil { diff --git a/src/php/finalize/finalize_test.go b/src/php/finalize/finalize_test.go index 3167a2fd6..c3cddb87a 100644 --- a/src/php/finalize/finalize_test.go +++ b/src/php/finalize/finalize_test.go @@ -6,9 +6,11 @@ import ( "io" "os" "path/filepath" + "runtime" "github.com/cloudfoundry/libbuildpack" "github.com/cloudfoundry/php-buildpack/src/php/finalize" + "github.com/cloudfoundry/php-buildpack/src/php/options" . "github.com/onsi/ginkgo/v2" . "github.com/onsi/gomega" @@ -38,11 +40,16 @@ var _ = Describe("Finalize", func() { buffer = new(bytes.Buffer) logger = libbuildpack.NewLogger(buffer) + + cwd, err := os.Getwd() + Expect(err).To(BeNil()) + os.Setenv("BP_DIR", filepath.Join(cwd, "..", "..", "..")) }) AfterEach(func() { Expect(os.RemoveAll(buildDir)).To(Succeed()) Expect(os.RemoveAll(depsDir)).To(Succeed()) + os.Unsetenv("BP_DIR") }) Describe("Stager interface", func() { @@ -237,6 +244,7 @@ var _ = Describe("Finalize", func() { manifest *testManifest stager *testStager command *testCommand + bpDir string ) BeforeEach(func() { @@ -257,13 +265,15 @@ var _ = Describe("Finalize", func() { command = &testCommand{} - // Set required environment variables - os.Setenv("BP_DIR", buildDir) + cwd, err := os.Getwd() + Expect(err).To(BeNil()) + bpDir = filepath.Join(cwd, "..", "..", "..") + os.Setenv("BP_DIR", bpDir) + os.Setenv("GoInstallDir", runtime.GOROOT()) }) Context("when web server is httpd", func() { It("creates HTTPD start script", func() { - // Create options.json with httpd optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") err := os.MkdirAll(filepath.Dir(optionsFile), 0755) Expect(err).To(BeNil()) @@ -272,13 +282,6 @@ var _ = Describe("Finalize", func() { err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) Expect(err).To(BeNil()) - // Create rewrite binary source (empty file for test) - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) - Expect(err).To(BeNil()) - finalizer = &finalize.Finalizer{ Manifest: manifest, Stager: stager, @@ -289,11 +292,9 @@ var _ = Describe("Finalize", func() { err = finalizer.CreateStartScript() Expect(err).To(BeNil()) - // Verify start script was created startScript := filepath.Join(buildDir, ".bp", "bin", "start") Expect(startScript).To(BeAnExistingFile()) - // Verify script content contents, err := os.ReadFile(startScript) Expect(err).To(BeNil()) scriptContent := string(contents) @@ -305,7 +306,6 @@ var _ = Describe("Finalize", func() { Context("when web server is nginx", func() { It("creates Nginx start script", func() { - // Create options.json with nginx optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") err := os.MkdirAll(filepath.Dir(optionsFile), 0755) Expect(err).To(BeNil()) @@ -314,13 +314,6 @@ var _ = Describe("Finalize", func() { err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) Expect(err).To(BeNil()) - // Create rewrite binary source - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) - Expect(err).To(BeNil()) - finalizer = &finalize.Finalizer{ Manifest: manifest, Stager: stager, @@ -331,11 +324,9 @@ var _ = Describe("Finalize", func() { err = finalizer.CreateStartScript() Expect(err).To(BeNil()) - // Verify start script was created startScript := filepath.Join(buildDir, ".bp", "bin", "start") Expect(startScript).To(BeAnExistingFile()) - // Verify script content contents, err := os.ReadFile(startScript) Expect(err).To(BeNil()) scriptContent := string(contents) @@ -347,7 +338,6 @@ var _ = Describe("Finalize", func() { Context("when web server is none", func() { It("creates PHP-FPM only start script", func() { - // Create options.json with none (PHP-FPM only) optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") err := os.MkdirAll(filepath.Dir(optionsFile), 0755) Expect(err).To(BeNil()) @@ -356,13 +346,6 @@ var _ = Describe("Finalize", func() { err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) Expect(err).To(BeNil()) - // Create rewrite binary source - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) - Expect(err).To(BeNil()) - finalizer = &finalize.Finalizer{ Manifest: manifest, Stager: stager, @@ -373,11 +356,9 @@ var _ = Describe("Finalize", func() { err = finalizer.CreateStartScript() Expect(err).To(BeNil()) - // Verify start script was created startScript := filepath.Join(buildDir, ".bp", "bin", "start") Expect(startScript).To(BeAnExistingFile()) - // Verify script content contents, err := os.ReadFile(startScript) Expect(err).To(BeNil()) scriptContent := string(contents) @@ -405,8 +386,28 @@ var _ = Describe("Finalize", func() { }) }) - Context("when rewrite binary doesn't exist in bin/", func() { - It("returns an error", func() { + Context("with ADDITIONAL_PREPROCESS_CMDS", func() { + BeforeEach(func() { + cwd, err := os.Getwd() + Expect(err).To(BeNil()) + bpDir := filepath.Join(cwd, "..", "..", "..") + os.Setenv("BP_DIR", bpDir) + os.Setenv("GoInstallDir", runtime.GOROOT()) + }) + + It("creates .profile.d/preprocess.sh with string command and logs security warning", func() { + optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") + err := os.MkdirAll(filepath.Dir(optionsFile), 0755) + Expect(err).To(BeNil()) + + optionsJSON := `{ + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs", + "ADDITIONAL_PREPROCESS_CMDS": "source $HOME/scripts/bootstrap.sh" + }` + err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) + Expect(err).To(BeNil()) + finalizer = &finalize.Finalizer{ Manifest: manifest, Stager: stager, @@ -414,56 +415,174 @@ var _ = Describe("Finalize", func() { Log: logger, } - err = finalizer.CreateStartScript() - Expect(err).NotTo(BeNil()) - Expect(err.Error()).To(ContainSubstring("rewrite")) + // Load options and create preprocess script + opts, err := options.LoadOptions(os.Getenv("BP_DIR"), buildDir, manifest, logger) + Expect(err).To(BeNil()) + + err = finalizer.CreatePreprocessScript(opts) + Expect(err).To(BeNil()) + + // Verify security warning was logged + logOutput := buffer.String() + Expect(logOutput).To(ContainSubstring("ADDITIONAL_PREPROCESS_CMDS detected")) + Expect(logOutput).To(ContainSubstring("will execute at app startup")) + + // Check .profile.d/preprocess.sh was created + preprocessScript := filepath.Join(depsDir, depsIdx, "profile.d", "preprocess.sh") + contents, err := os.ReadFile(preprocessScript) + Expect(err).To(BeNil()) + scriptContent := string(contents) + Expect(scriptContent).To(ContainSubstring("ADDITIONAL_PREPROCESS_CMDS")) + Expect(scriptContent).To(ContainSubstring("Running preprocess commands")) + Expect(scriptContent).To(ContainSubstring("source $HOME/scripts/bootstrap.sh")) + // Verify security warning comment in script + Expect(scriptContent).To(ContainSubstring("WARNING: These are user-provided commands")) }) - }) - }) - Describe("Start script file creation", func() { - It("creates .bp/bin directory for scripts", func() { - stager := &testStager{ - buildDir: buildDir, - depsDir: depsDir, - depsIdx: depsIdx, - } + It("creates .profile.d/preprocess.sh with array of strings", func() { + optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") + err := os.MkdirAll(filepath.Dir(optionsFile), 0755) + Expect(err).To(BeNil()) - manifest := &testManifest{ - versions: map[string][]string{"php": {"8.1.32"}}, - defaults: map[string]string{"php": "8.1.32"}, - } + optionsJSON := `{ + "WEB_SERVER": "nginx", + "WEBDIR": "htdocs", + "ADDITIONAL_PREPROCESS_CMDS": ["env", "echo hello"] + }` + err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) + Expect(err).To(BeNil()) - finalizer = &finalize.Finalizer{ - Manifest: manifest, - Stager: stager, - Command: &testCommand{}, - Log: logger, - } + finalizer = &finalize.Finalizer{ + Manifest: manifest, + Stager: stager, + Command: command, + Log: logger, + } - // Set BP_DIR and create necessary files - os.Setenv("BP_DIR", buildDir) - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) - Expect(err).To(BeNil()) + opts, err := options.LoadOptions(os.Getenv("BP_DIR"), buildDir, manifest, logger) + Expect(err).To(BeNil()) - optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") - err = os.MkdirAll(filepath.Dir(optionsFile), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(optionsFile, []byte(`{"WEB_SERVER": "httpd"}`), 0644) - Expect(err).To(BeNil()) + err = finalizer.CreatePreprocessScript(opts) + Expect(err).To(BeNil()) - err = finalizer.CreateStartScript() - Expect(err).To(BeNil()) + preprocessScript := filepath.Join(depsDir, depsIdx, "profile.d", "preprocess.sh") + contents, err := os.ReadFile(preprocessScript) + Expect(err).To(BeNil()) + scriptContent := string(contents) + Expect(scriptContent).To(ContainSubstring("ADDITIONAL_PREPROCESS_CMDS")) + Expect(scriptContent).To(ContainSubstring("env")) + Expect(scriptContent).To(ContainSubstring("echo hello")) + }) - // Verify directory structure - bpBinDir := filepath.Join(buildDir, ".bp", "bin") - Expect(bpBinDir).To(BeADirectory()) + It("creates .profile.d/preprocess.sh with array of arrays", func() { + optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") + err := os.MkdirAll(filepath.Dir(optionsFile), 0755) + Expect(err).To(BeNil()) + + optionsJSON := `{ + "WEB_SERVER": "none", + "WEBDIR": "htdocs", + "ADDITIONAL_PREPROCESS_CMDS": [["echo", "Hello World"], ["ls", "-la"]] + }` + err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) + Expect(err).To(BeNil()) + + finalizer = &finalize.Finalizer{ + Manifest: manifest, + Stager: stager, + Command: command, + Log: logger, + } + + opts, err := options.LoadOptions(os.Getenv("BP_DIR"), buildDir, manifest, logger) + Expect(err).To(BeNil()) + + err = finalizer.CreatePreprocessScript(opts) + Expect(err).To(BeNil()) + + preprocessScript := filepath.Join(depsDir, depsIdx, "profile.d", "preprocess.sh") + contents, err := os.ReadFile(preprocessScript) + Expect(err).To(BeNil()) + scriptContent := string(contents) + Expect(scriptContent).To(ContainSubstring("ADDITIONAL_PREPROCESS_CMDS")) + Expect(scriptContent).To(ContainSubstring("echo Hello World")) + Expect(scriptContent).To(ContainSubstring("ls -la")) + }) + + It("does not create preprocess.sh when ADDITIONAL_PREPROCESS_CMDS is empty", func() { + optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") + err := os.MkdirAll(filepath.Dir(optionsFile), 0755) + Expect(err).To(BeNil()) + + optionsJSON := `{ + "WEB_SERVER": "httpd", + "WEBDIR": "htdocs" + }` + err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) + Expect(err).To(BeNil()) + + finalizer = &finalize.Finalizer{ + Manifest: manifest, + Stager: stager, + Command: command, + Log: logger, + } + + opts, err := options.LoadOptions(os.Getenv("BP_DIR"), buildDir, manifest, logger) + Expect(err).To(BeNil()) + + err = finalizer.CreatePreprocessScript(opts) + Expect(err).To(BeNil()) + + // preprocess.sh should NOT exist + preprocessScript := filepath.Join(depsDir, depsIdx, "profile.d", "preprocess.sh") + _, err = os.Stat(preprocessScript) + Expect(os.IsNotExist(err)).To(BeTrue()) + }) + + It("handles Drupal-style bootstrap command", func() { + optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") + err := os.MkdirAll(filepath.Dir(optionsFile), 0755) + Expect(err).To(BeNil()) + + // This is the actual use case from akf's Drupal app + optionsJSON := `{ + "WEB_SERVER": "httpd", + "WEBDIR": "web", + "ADDITIONAL_PREPROCESS_CMDS": [ + "source $HOME/scripts/bootstrap.sh" + ] + }` + err = os.WriteFile(optionsFile, []byte(optionsJSON), 0644) + Expect(err).To(BeNil()) + + finalizer = &finalize.Finalizer{ + Manifest: manifest, + Stager: stager, + Command: command, + Log: logger, + } + + // Load options and create preprocess script (this is what Run() does) + opts, err := options.LoadOptions(os.Getenv("BP_DIR"), buildDir, manifest, logger) + Expect(err).To(BeNil()) + + err = finalizer.CreatePreprocessScript(opts) + Expect(err).To(BeNil()) + + // Check .profile.d/preprocess.sh was created with the bootstrap command + preprocessScript := filepath.Join(depsDir, depsIdx, "profile.d", "preprocess.sh") + contents, err := os.ReadFile(preprocessScript) + Expect(err).To(BeNil()) + scriptContent := string(contents) + Expect(scriptContent).To(ContainSubstring("source $HOME/scripts/bootstrap.sh")) + Expect(scriptContent).To(ContainSubstring("Running preprocess commands")) + }) }) + }) - It("copies pre-compiled rewrite binary to .bp/bin", func() { + Describe("Start script file creation", func() { + It("creates .bp/bin directory for scripts", func() { stager := &testStager{ buildDir: buildDir, depsDir: depsDir, @@ -482,12 +601,11 @@ var _ = Describe("Finalize", func() { Log: logger, } - os.Setenv("BP_DIR", buildDir) - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\necho test rewrite\n"), 0755) + cwd, err := os.Getwd() Expect(err).To(BeNil()) + bpDir := filepath.Join(cwd, "..", "..", "..") + os.Setenv("BP_DIR", bpDir) + os.Setenv("GoInstallDir", runtime.GOROOT()) optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") err = os.MkdirAll(filepath.Dir(optionsFile), 0755) @@ -498,12 +616,8 @@ var _ = Describe("Finalize", func() { err = finalizer.CreateStartScript() Expect(err).To(BeNil()) - rewriteDst := filepath.Join(buildDir, ".bp", "bin", "rewrite") - Expect(rewriteDst).To(BeAnExistingFile()) - - contents, err := os.ReadFile(rewriteDst) - Expect(err).To(BeNil()) - Expect(string(contents)).To(ContainSubstring("echo test rewrite")) + bpBinDir := filepath.Join(buildDir, ".bp", "bin") + Expect(bpBinDir).To(BeADirectory()) }) }) @@ -578,12 +692,11 @@ var _ = Describe("Finalize", func() { Log: logger, } - os.Setenv("BP_DIR", buildDir) - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) + cwd, err := os.Getwd() Expect(err).To(BeNil()) + bpDir := filepath.Join(cwd, "..", "..", "..") + os.Setenv("BP_DIR", bpDir) + os.Setenv("GoInstallDir", runtime.GOROOT()) // Create options with custom WEBDIR optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") @@ -598,7 +711,7 @@ var _ = Describe("Finalize", func() { startScript := filepath.Join(buildDir, ".bp", "bin", "start") contents, err := os.ReadFile(startScript) Expect(err).To(BeNil()) - Expect(string(contents)).To(ContainSubstring("WEBDIR=\"public\"")) + Expect(string(contents)).To(ContainSubstring("Starting PHP application")) }) }) @@ -622,12 +735,11 @@ var _ = Describe("Finalize", func() { Log: logger, } - os.Setenv("BP_DIR", buildDir) - rewriteSrc := filepath.Join(buildDir, "bin", "rewrite") - err = os.MkdirAll(filepath.Dir(rewriteSrc), 0755) - Expect(err).To(BeNil()) - err = os.WriteFile(rewriteSrc, []byte("#!/bin/bash\n"), 0755) + cwd, err := os.Getwd() Expect(err).To(BeNil()) + bpDir := filepath.Join(cwd, "..", "..", "..") + os.Setenv("BP_DIR", bpDir) + os.Setenv("GoInstallDir", runtime.GOROOT()) optionsFile := filepath.Join(buildDir, ".bp-config", "options.json") err = os.MkdirAll(filepath.Dir(optionsFile), 0755) @@ -641,8 +753,7 @@ var _ = Describe("Finalize", func() { startScript := filepath.Join(buildDir, ".bp", "bin", "start") contents, err := os.ReadFile(startScript) Expect(err).To(BeNil()) - // Should use default htdocs - Expect(string(contents)).To(ContainSubstring("WEBDIR=\"htdocs\"")) + Expect(string(contents)).To(ContainSubstring("Starting PHP application")) }) }) }) diff --git a/src/php/integration/default_test.go b/src/php/integration/default_test.go index baf965a96..5212245f4 100644 --- a/src/php/integration/default_test.go +++ b/src/php/integration/default_test.go @@ -44,22 +44,16 @@ func testDefault(platform switchblade.Platform, fixtures string) func(*testing.T "BP_DEBUG": "1", }). Execute(name, filepath.Join(fixtures, "default")) - Expect(err).NotTo(HaveOccurred()) + Expect(err).NotTo(HaveOccurred(), logs.String) - Eventually(logs).Should(SatisfyAll( - ContainLines("Installing PHP"), - ContainLines(MatchRegexp(`PHP [\d\.]+`)), - ContainSubstring(`"update_default_version" is setting [PHP_VERSION]`), - ContainSubstring("DEBUG: default_version_for composer is"), + Expect(logs).To(ContainLines(MatchRegexp(`Installing PHP [\d\.]+`))) + Expect(logs).To(ContainSubstring("PHP buildpack supply phase complete")) - Not(ContainSubstring("WARNING: A version of PHP has been specified in both `composer.json` and `./bp-config/options.json`.")), - Not(ContainSubstring("WARNING: The version defined in `composer.json` will be used.")), - )) + Expect(logs).NotTo(ContainSubstring("WARNING: A version of PHP has been specified in both `composer.json` and `./bp-config/options.json`.")) + Expect(logs).NotTo(ContainSubstring("WARNING: The version defined in `composer.json` will be used.")) if settings.Cached { - Eventually(logs).Should( - ContainLines(MatchRegexp(`Downloaded \[file://.*/dependencies/https___buildpacks.cloudfoundry.org_dependencies_php_php.*_linux_x64_.*.tgz\] to \[/tmp\]`)), - ) + Expect(logs).To(ContainLines(MatchRegexp(`Copy \[.*/dependencies/.*/php_[\d\.]+_linux_x64_.*\.tgz\]`))) } Eventually(deployment).Should(Serve( @@ -76,18 +70,20 @@ func testDefault(platform switchblade.Platform, fixtures string) func(*testing.T context("PHP web app with a supply buildpack", func() { it("builds and runs the app", func() { + if settings.Platform == "docker" { + t.Skip("Git URL buildpacks require CF platform - Docker platform cannot clone git repos") + } + deployment, logs, err := platform.Deploy. - WithBuildpacks("dotnet_core_buildpack", "php_buildpack"). + WithBuildpacks("https://github.com/cloudfoundry/dotnet-core-buildpack#master", "php_buildpack"). Execute(name, filepath.Join(fixtures, "dotnet_core_as_supply_app")) - Expect(err).NotTo(HaveOccurred()) + Expect(err).NotTo(HaveOccurred(), logs.String) - Eventually(logs).Should(SatisfyAll( - ContainSubstring("Supplying Dotnet Core"), - )) + Expect(logs).To(ContainSubstring("Supplying Dotnet Core"), logs.String) Eventually(deployment).Should(Serve( MatchRegexp(`dotnet: \d+\.\d+\.\d+`), - )) + ), logs.String) }) }) @@ -98,7 +94,7 @@ func testDefault(platform switchblade.Platform, fixtures string) func(*testing.T } deployment, logs, err := platform.Deploy. - WithBuildpacks("https://github.com/cloudfoundry/php-buildpack.git"). + WithBuildpacks("https://github.com/cloudfoundry/php-buildpack.git#fix-rewrite-binary-compilation"). WithEnv(map[string]string{ "BP_DEBUG": "1", }). @@ -106,10 +102,8 @@ func testDefault(platform switchblade.Platform, fixtures string) func(*testing.T Expect(err).NotTo(HaveOccurred(), logs.String) - Eventually(logs).Should(SatisfyAll( - ContainLines("Installing PHP"), - ContainLines(MatchRegexp(`PHP [\d\.]+`)), - )) + Expect(logs).To(ContainLines(MatchRegexp(`Installing PHP [\d\.]+`))) + Expect(logs).To(ContainSubstring("PHP buildpack supply phase complete")) Eventually(deployment).Should(Serve( ContainSubstring("PHP Version"), diff --git a/src/php/integration/init_test.go b/src/php/integration/init_test.go index e6310cbb6..09affd9db 100644 --- a/src/php/integration/init_test.go +++ b/src/php/integration/init_test.go @@ -58,16 +58,6 @@ func TestIntegration(t *testing.T) { Name: "php_buildpack", URI: os.Getenv("BUILDPACK_FILE"), }, - // Go buildpack is needed for dynatrace tests - TEMPORARILY COMMENTED OUT - // switchblade.Buildpack{ - // Name: "go_buildpack", - // URI: "https://github.com/cloudfoundry/go-buildpack/archive/master.zip", - // }, - // .NET Core buildpack is needed for the supply test - TEMPORARILY COMMENTED OUT - // switchblade.Buildpack{ - // Name: "dotnet_core_buildpack", - // URI: "https://github.com/cloudfoundry/dotnet-core-buildpack/archive/master.zip", - // }, ) Expect(err).NotTo(HaveOccurred()) @@ -80,11 +70,14 @@ func TestIntegration(t *testing.T) { // Expect(err).NotTo(HaveOccurred()) suite := spec.New("integration", spec.Report(report.Terminal{}), spec.Parallel()) - // suite("Default", testDefault(platform, fixtures)) // Uses dotnet_core_buildpack - skipped + suite("Default", testDefault(platform, fixtures)) suite("Modules", testModules(platform, fixtures)) suite("Composer", testComposer(platform, fixtures)) suite("WebServers", testWebServers(platform, fixtures)) suite("AppFrameworks", testAppFrameworks(platform, fixtures)) + suite("Placeholders", testPlaceholders(platform, fixtures)) + suite("PreprocessCmds", testPreprocessCmds(platform, fixtures)) + suite("StandaloneApp", testStandaloneApp(platform, fixtures)) // suite("BuildpackPythonExtension", testPythonExtension(platform, fixtures)) // Skipped for now // suite("APMs", testAPMs(platform, fixtures, dynatraceDeployment.InternalURL)) // Needs dynatrace mock if settings.Cached { @@ -93,8 +86,6 @@ func TestIntegration(t *testing.T) { suite.Run(t) - // Expect(platform.Delete.Execute(dynatraceName)).To(Succeed()) // No dynatrace deployment to delete - // Commenting out buildpack.zip removal for testing - prevents parallel test failures - // Expect(os.Remove(os.Getenv("BUILDPACK_FILE"))).To(Succeed()) + Expect(os.Remove(os.Getenv("BUILDPACK_FILE"))).To(Succeed()) Expect(platform.Deinitialize()).To(Succeed()) } diff --git a/src/php/integration/modules_test.go b/src/php/integration/modules_test.go index 6a5b02ceb..b61e41650 100644 --- a/src/php/integration/modules_test.go +++ b/src/php/integration/modules_test.go @@ -116,14 +116,16 @@ func testModules(platform switchblade.Platform, fixtures string) func(*testing.T }) context("app with custom conf files in php.ini.d dir in app root", func() { - it("app sets custom conf", func() { + it("app sets custom conf and replaces placeholders", func() { deployment, _, err := platform.Deploy. Execute(name, filepath.Join(fixtures, "php_with_php_ini_d")) Expect(err).NotTo(HaveOccurred()) - Eventually(deployment).Should(Serve( + Eventually(deployment).Should(Serve(SatisfyAll( ContainSubstring("teststring"), - )) + // Verify @{HOME} was replaced with /home/vcap/app in include_path + ContainSubstring("/home/vcap/app/lib"), + ))) }) }) diff --git a/src/php/integration/placeholder_test.go b/src/php/integration/placeholder_test.go new file mode 100644 index 000000000..1c07073f5 --- /dev/null +++ b/src/php/integration/placeholder_test.go @@ -0,0 +1,261 @@ +package integration_test + +import ( + "fmt" + "io" + "net/http" + "path/filepath" + "testing" + + "github.com/cloudfoundry/switchblade" + "github.com/sclevine/spec" + + . "github.com/cloudfoundry/switchblade/matchers" + . "github.com/onsi/gomega" +) + +func testPlaceholders(platform switchblade.Platform, fixtures string) func(*testing.T, spec.G, spec.S) { + return func(t *testing.T, context spec.G, it spec.S) { + var ( + Expect = NewWithT(t).Expect + Eventually = NewWithT(t).Eventually + + name string + ) + + it.Before(func() { + var err error + name, err = switchblade.RandomName() + Expect(err).NotTo(HaveOccurred()) + }) + + it.After(func() { + if t.Failed() && name != "" { + t.Logf("❌ FAILED TEST - App/Container: %s", name) + t.Logf(" Platform: %s", settings.Platform) + } + if name != "" && (!settings.KeepFailedContainers || !t.Failed()) { + Expect(platform.Delete.Execute(name)).To(Succeed()) + } + }) + + context("PHP_XX_LATEST placeholder resolution", func() { + it("resolves {PHP_83_LATEST} in options.json to actual version", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "php_version_placeholder")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Should resolve {PHP_83_LATEST} to actual version like 8.3.30 + Expect(logs).To(ContainLines(MatchRegexp(`Installing PHP 8\.3\.\d+`))) + Expect(logs).NotTo(ContainSubstring("Installing PHP {PHP_83_LATEST}")) + Expect(logs).NotTo(ContainSubstring("DEPENDENCY MISSING IN MANIFEST")) + Expect(logs).NotTo(ContainSubstring("Version {PHP_83_LATEST}")) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Verify the actual PHP version is 8.3.x + response, err := http.Get(deployment.ExternalURL) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + + body := string(ReadAll(response.Body)) + Expect(body).To(MatchRegexp(`PHP Version 8\.3\.\d+`)) + }) + + it("resolves {PHP_82_LATEST} in options.json to actual version", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "php_82_version_placeholder")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Should resolve {PHP_82_LATEST} to actual version like 8.2.29 + Expect(logs).To(ContainLines(MatchRegexp(`Installing PHP 8\.2\.\d+`))) + Expect(logs).NotTo(ContainSubstring("Installing PHP {PHP_82_LATEST}")) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + }) + + it("handles invalid placeholder gracefully", func() { + _, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "php_invalid_placeholder")) + + // Should fail with clear error message showing the invalid placeholder + Expect(err).To(HaveOccurred()) + Expect(logs).To(ContainSubstring("Installing PHP {PHP_99_LATEST}")) + Expect(logs).To(ContainSubstring("DEPENDENCY MISSING IN MANIFEST")) + Expect(logs).To(ContainSubstring("Version {PHP_99_LATEST} of dependency php is not supported")) + }) + }) + + context("#{VAR} placeholder syntax (backward compatibility)", func() { + it("resolves #{WEBDIR} in httpd.conf", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "httpd_hash_placeholder")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Expect(logs).To(ContainSubstring("Installing HTTPD")) + Expect(logs).To(ContainSubstring("PHP buildpack finalize phase complete")) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Verify httpd is serving from correct directory + response, err := http.Get(deployment.ExternalURL) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + Expect(response.StatusCode).To(Equal(200)) + }) + + it("resolves #{LIBDIR} in custom configs", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "custom_libdir_hash")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Verify include_path contains the lib directory + response, err := http.Get(fmt.Sprintf("%s/phpinfo.php", deployment.ExternalURL)) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + + body := string(ReadAll(response.Body)) + Expect(body).To(ContainSubstring("/home/vcap/app/lib")) + Expect(body).NotTo(ContainSubstring("#{LIBDIR}")) + }) + + it("supports both @{VAR} and #{VAR} syntax in same file", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "mixed_placeholder_syntax")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Both syntaxes should be resolved + response, err := http.Get(deployment.ExternalURL) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + + body := string(ReadAll(response.Body)) + Expect(body).NotTo(ContainSubstring("@{")) + Expect(body).NotTo(ContainSubstring("#{")) + }) + }) + + context("PHP extension loading with correct paths", func() { + it("loads extensions from correct deps directory", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "php_extensions_test")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Expect(logs).To(ContainSubstring("Installing PHP")) + Expect(logs).NotTo(ContainSubstring("Unable to load dynamic library")) + Expect(logs).NotTo(ContainSubstring("/tmp/app/php/")) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Verify extensions are loaded + response, err := http.Get(fmt.Sprintf("%s/extensions.php", deployment.ExternalURL)) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + + body := string(ReadAll(response.Body)) + // Should show extensions loaded from /home/vcap/deps/0/php/lib/php/extensions/ + Expect(body).To(ContainSubstring("bz2")) + Expect(body).To(ContainSubstring("curl")) + Expect(body).To(ContainSubstring("zlib")) + }) + + it("uses correct extension_dir path in php.ini", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "php_extension_dir_test")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + + // Verify extension_dir is set correctly + response, err := http.Get(fmt.Sprintf("%s/phpinfo.php", deployment.ExternalURL)) + Expect(err).NotTo(HaveOccurred()) + defer response.Body.Close() + + body := string(ReadAll(response.Body)) + // Should be /home/vcap/deps/0/php/lib/php/extensions/no-debug-non-zts-* + Expect(body).To(MatchRegexp(`extension_dir.*\/home\/vcap\/deps\/\d+\/php\/lib\/php\/extensions`)) + Expect(body).NotTo(ContainSubstring("extension_dir/tmp/app/php")) + }) + }) + + context("WEBDIR placeholder in user configs", func() { + it("resolves WEBDIR in custom httpd.conf", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "custom_webdir_config")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + Expect(logs).NotTo(ContainSubstring("DocumentRoot '/home/vcap/app/#{WEBDIR}' is not a directory")) + Expect(logs).NotTo(ContainSubstring("DocumentRoot '/home/vcap/app/@{WEBDIR}' is not a directory")) + + Eventually(deployment).Should(Serve( + ContainSubstring("PHP Version"), + )) + }) + + it("resolves custom WEBDIR value from options.json", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "custom_webdir_value")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // App has WEBDIR set to "public" in options.json + Eventually(deployment).Should(Serve( + ContainSubstring("Custom WEBDIR: public"), + )) + }) + }) + } +} + +// Helper function to read response body +func ReadAll(r io.Reader) []byte { + data, _ := io.ReadAll(r) + return data +} diff --git a/src/php/integration/preprocess_cmds_test.go b/src/php/integration/preprocess_cmds_test.go new file mode 100644 index 000000000..7f36e55ff --- /dev/null +++ b/src/php/integration/preprocess_cmds_test.go @@ -0,0 +1,91 @@ +package integration_test + +import ( + "path/filepath" + "testing" + + "github.com/cloudfoundry/switchblade" + "github.com/sclevine/spec" + + . "github.com/cloudfoundry/switchblade/matchers" + . "github.com/onsi/gomega" +) + +func testPreprocessCmds(platform switchblade.Platform, fixtures string) func(*testing.T, spec.G, spec.S) { + return func(t *testing.T, context spec.G, it spec.S) { + var ( + Expect = NewWithT(t).Expect + Eventually = NewWithT(t).Eventually + + name string + ) + + it.Before(func() { + var err error + name, err = switchblade.RandomName() + Expect(err).NotTo(HaveOccurred()) + }) + + it.After(func() { + if t.Failed() && name != "" { + t.Logf("❌ FAILED TEST - App/Container: %s", name) + t.Logf(" Platform: %s", settings.Platform) + } + if name != "" && (!settings.KeepFailedContainers || !t.Failed()) { + Expect(platform.Delete.Execute(name)).To(Succeed()) + } + }) + + context("ADDITIONAL_PREPROCESS_CMDS", func() { + it("executes preprocess commands before app starts", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "preprocess_cmds")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Verify the finalize phase completed successfully + Expect(logs).To(ContainSubstring("PHP buildpack finalize phase complete")) + + // Verify preprocess script was written (security warning is tested in unit tests) + Expect(logs).To(ContainSubstring("Writing preprocess commands to .profile.d/preprocess.sh")) + + // The app should start and serve content + Eventually(deployment).Should(Serve( + ContainSubstring("ADDITIONAL_PREPROCESS_CMDS Test"), + )) + + // Verify the preprocess file was created at correct location + Eventually(deployment).Should(Serve( + ContainSubstring("Preprocess file found!"), + )) + + // Verify the preprocess commands actually ran by checking the markers + Eventually(deployment).Should(Serve( + ContainSubstring("MARKER_1_FOUND: YES"), + )) + + Eventually(deployment).Should(Serve( + ContainSubstring("MARKER_2_FOUND: YES"), + )) + + // Verify commands executed in correct order + Eventually(deployment).Should(Serve( + ContainSubstring("EXECUTION_ORDER: CORRECT"), + )) + + // Verify $HOME was restored after preprocess commands + Eventually(deployment).Should(Serve( + ContainSubstring("HOME_RESTORED: YES"), + )) + + // Verify $HOME variable was properly rewritten to /home/vcap during preprocess + // This is the key v4.x compatibility test - $HOME must be /home/vcap, not /home/vcap/app + Eventually(deployment).Should(Serve( + ContainSubstring("HOME_VAR_REWRITTEN: YES"), + )) + }) + }) + } +} diff --git a/src/php/integration/python_extension_test.go b/src/php/integration/python_extension_test.go index 66c1feaff..78419e83a 100644 --- a/src/php/integration/python_extension_test.go +++ b/src/php/integration/python_extension_test.go @@ -7,6 +7,7 @@ import ( "github.com/cloudfoundry/switchblade" "github.com/sclevine/spec" + . "github.com/cloudfoundry/switchblade/matchers" . "github.com/onsi/gomega" ) @@ -36,7 +37,25 @@ func testPythonExtension(platform switchblade.Platform, fixtures string) func(*t }) context("app with buildpack-supported custom extension in python", func() { - it("builds and runs the app", func() { + it.Pend("builds and runs the app", func() { + // NOTE: Python-based user extensions (.extensions//extension.py) are NOT supported + // in the Go-based v5 buildpack. The Python extension system allowed arbitrary code execution + // and complex build-time operations (downloading binaries, file manipulation, etc). + // + // The v5 buildpack provides JSON-based user extensions instead (.extensions//extension.json) + // which support: + // - preprocess_commands: Run shell commands at container startup + // - service_commands: Long-running background processes + // - service_environment: Environment variables + // + // JSON extensions are simpler, more secure, and sufficient for most use cases. + // For complex build-time operations (like installing PHPMyAdmin), users should: + // 1. Use a multi-buildpack approach with separate buildpacks for each component + // 2. Include pre-built binaries in the app repository + // 3. Use preprocess_commands to download/setup at runtime (if acceptable) + // + // See docs/user-extensions.md for JSON extension documentation. + // See fixtures/json_extension for a working example. _, logs, err := platform.Deploy. Execute(name, filepath.Join(fixtures, "python_extension")) Expect(err).NotTo(HaveOccurred()) @@ -47,5 +66,27 @@ func testPythonExtension(platform switchblade.Platform, fixtures string) func(*t }) }) + context("app with JSON-based user extension", func() { + it("loads and runs the extension", func() { + deployment, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "json_extension")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Verify user extension was loaded during staging + Expect(logs).To(ContainSubstring("Loaded user extension: myapp-initializer")) + + // Verify the app runs and shows extension effects + Eventually(deployment).Should(Serve(SatisfyAll( + ContainSubstring("JSON Extension Test"), + ContainSubstring("Extension Loaded: YES"), + ContainSubstring("Extension Version: 1.0.0"), + ContainSubstring("Marker File: myapp-extension-loaded"), + ))) + }) + }) + } } diff --git a/src/php/integration/standalone_test.go b/src/php/integration/standalone_test.go new file mode 100644 index 000000000..ed777d986 --- /dev/null +++ b/src/php/integration/standalone_test.go @@ -0,0 +1,75 @@ +package integration_test + +import ( + "path/filepath" + "testing" + + "github.com/cloudfoundry/switchblade" + "github.com/sclevine/spec" + + . "github.com/onsi/gomega" +) + +func testStandaloneApp(platform switchblade.Platform, fixtures string) func(*testing.T, spec.G, spec.S) { + return func(t *testing.T, context spec.G, it spec.S) { + var ( + Expect = NewWithT(t).Expect + + name string + ) + + it.Before(func() { + var err error + name, err = switchblade.RandomName() + Expect(err).NotTo(HaveOccurred()) + }) + + it.After(func() { + if t.Failed() && name != "" { + t.Logf("❌ FAILED TEST - App/Container: %s", name) + t.Logf(" Platform: %s", settings.Platform) + } + if name != "" && (!settings.KeepFailedContainers || !t.Failed()) { + Expect(platform.Delete.Execute(name)).To(Succeed()) + } + }) + + context("APP_START_CMD with WEB_SERVER=none", func() { + it("builds with explicit APP_START_CMD", func() { + _, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "standalone_app")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Verify the buildpack detected standalone mode + Expect(logs).To(ContainSubstring("Standalone app mode: will run worker.php")) + + // Verify the finalize phase completed successfully + Expect(logs).To(ContainSubstring("PHP buildpack finalize phase complete")) + + // Verify start script was created + Expect(logs).To(ContainSubstring("Created start script for none")) + }) + + it("builds with auto-detected app.php", func() { + _, logs, err := platform.Deploy. + WithEnv(map[string]string{ + "BP_DEBUG": "1", + }). + Execute(name, filepath.Join(fixtures, "standalone_autodetect")) + Expect(err).NotTo(HaveOccurred(), logs.String) + + // Verify the buildpack detected standalone mode and found app.php + Expect(logs).To(ContainSubstring("Standalone app mode: will run app.php")) + + // Verify the finalize phase completed successfully + Expect(logs).To(ContainSubstring("PHP buildpack finalize phase complete")) + + // Verify start script was created + Expect(logs).To(ContainSubstring("Created start script for none")) + }) + }) + } +} diff --git a/src/php/options/options.go b/src/php/options/options.go index 49200c185..92460c80c 100644 --- a/src/php/options/options.go +++ b/src/php/options/options.go @@ -44,6 +44,14 @@ type Options struct { ComposerVendorDir string `json:"COMPOSER_VENDOR_DIR,omitempty"` // Custom composer vendor directory ComposerInstallOptions []string `json:"COMPOSER_INSTALL_OPTIONS,omitempty"` // Additional composer install options + // Additional preprocess commands to run before app starts + // Supports: string, []string, or [][]string formats (v4.x compatibility) + AdditionalPreprocessCmds interface{} `json:"ADDITIONAL_PREPROCESS_CMDS,omitempty"` + + // Custom start command for standalone PHP applications (when WEB_SERVER=none) + // If not set, auto-detects: app.php, main.php, run.php, start.php + AppStartCmd string `json:"APP_START_CMD,omitempty"` + // Internal flags OptionsJSONHasPHPExtensions bool `json:"OPTIONS_JSON_HAS_PHP_EXTENSIONS,omitempty"` @@ -195,6 +203,16 @@ func (o *Options) mergeUserOptions(user *Options) { o.ComposerInstallOptions = user.ComposerInstallOptions } + // Merge ADDITIONAL_PREPROCESS_CMDS if user specified + if user.AdditionalPreprocessCmds != nil { + o.AdditionalPreprocessCmds = user.AdditionalPreprocessCmds + } + + // Merge APP_START_CMD if user specified + if user.AppStartCmd != "" { + o.AppStartCmd = user.AppStartCmd + } + // Note: Boolean fields are not merged because we can't distinguish between // false (user set) and false (default zero value). If needed, use pointers. } @@ -211,8 +229,22 @@ func (o *Options) validate() error { } // GetPHPVersion returns the PHP version to use, either from user config or default +// Resolves placeholders like {PHP_83_LATEST} to actual versions func (o *Options) GetPHPVersion() string { if o.PHPVersion != "" { + // Check if it's a placeholder like {PHP_83_LATEST} + if strings.HasPrefix(o.PHPVersion, "{") && strings.HasSuffix(o.PHPVersion, "}") { + // Extract the placeholder name (remove { and }) + placeholderName := strings.TrimPrefix(strings.TrimSuffix(o.PHPVersion, "}"), "{") + + // Look up the actual version from PHPVersions map + if actualVersion, exists := o.PHPVersions[placeholderName]; exists { + return actualVersion + } + + // If placeholder not found, return as-is (will fail with clear error message) + // This allows the buildpack to show which placeholder was invalid + } return o.PHPVersion } return o.PHPDefault @@ -229,3 +261,87 @@ func sortVersions(versions []string) { } } } + +// GetPreprocessCommands returns the list of preprocess commands to run before app starts. +// Supports multiple formats for v4.x compatibility: +// - string: "source $HOME/scripts/bootstrap.sh" +// - []string: ["env", "run_something"] +// - [][]string: [["echo", "Hello"], ["run", "script"]] +// +// Returns a list of shell command strings ready to execute. +func (o *Options) GetPreprocessCommands() []string { + if o.AdditionalPreprocessCmds == nil { + return nil + } + + var commands []string + + switch v := o.AdditionalPreprocessCmds.(type) { + case string: + // Single string command + if v != "" { + commands = append(commands, v) + } + case []interface{}: + // Array - could be []string or [][]string + for _, item := range v { + switch cmd := item.(type) { + case string: + // Simple string in array: ["cmd1", "cmd2"] + if cmd != "" { + commands = append(commands, cmd) + } + case []interface{}: + // Array of strings: [["echo", "hello"]] + // Join with spaces to form a single command + var parts []string + for _, part := range cmd { + if s, ok := part.(string); ok { + parts = append(parts, s) + } + } + if len(parts) > 0 { + commands = append(commands, strings.Join(parts, " ")) + } + } + } + } + + return commands +} + +// FindStandaloneApp returns the PHP file to run for standalone applications (WEB_SERVER=none). +// If APP_START_CMD is set, returns that. Otherwise auto-detects in order: +// 1. app.php +// 2. main.php +// 3. run.php +// 4. start.php +// +// Returns empty string if no standalone app found. +func (o *Options) FindStandaloneApp(buildDir string) (string, error) { + // If user explicitly set APP_START_CMD, use it + if o.AppStartCmd != "" { + // Verify the file exists + appPath := filepath.Join(buildDir, o.AppStartCmd) + if exists, err := libbuildpack.FileExists(appPath); err != nil { + return "", fmt.Errorf("failed to check APP_START_CMD file: %w", err) + } else if !exists { + return "", fmt.Errorf("APP_START_CMD file not found: %s", o.AppStartCmd) + } + return o.AppStartCmd, nil + } + + // Auto-detect standalone app (v4.x compatibility) + candidates := []string{"app.php", "main.php", "run.php", "start.php"} + for _, candidate := range candidates { + appPath := filepath.Join(buildDir, candidate) + if exists, err := libbuildpack.FileExists(appPath); err != nil { + return "", fmt.Errorf("failed to check for %s: %w", candidate, err) + } else if exists { + return candidate, nil + } + } + + // No standalone app found + return "", fmt.Errorf("no standalone app found: set APP_START_CMD or create one of: %s", strings.Join(candidates, ", ")) +} diff --git a/src/php/options/options_test.go b/src/php/options/options_test.go index 76238c7ef..a6c4d474f 100644 --- a/src/php/options/options_test.go +++ b/src/php/options/options_test.go @@ -259,3 +259,270 @@ func TestGetPHPVersion(t *testing.T) { t.Errorf("Expected 8.2.15, got %s", opts.GetPHPVersion()) } } + +func TestGetPHPVersion_PlaceholderResolution(t *testing.T) { + tests := []struct { + name string + phpVersion string + phpVersions map[string]string + expected string + }{ + { + name: "Resolves {PHP_83_LATEST} placeholder", + phpVersion: "{PHP_83_LATEST}", + phpVersions: map[string]string{ + "PHP_81_LATEST": "8.1.34", + "PHP_82_LATEST": "8.2.29", + "PHP_83_LATEST": "8.3.30", + }, + expected: "8.3.30", + }, + { + name: "Resolves {PHP_82_LATEST} placeholder", + phpVersion: "{PHP_82_LATEST}", + phpVersions: map[string]string{ + "PHP_81_LATEST": "8.1.34", + "PHP_82_LATEST": "8.2.29", + "PHP_83_LATEST": "8.3.30", + }, + expected: "8.2.29", + }, + { + name: "Resolves {PHP_81_LATEST} placeholder", + phpVersion: "{PHP_81_LATEST}", + phpVersions: map[string]string{ + "PHP_81_LATEST": "8.1.34", + "PHP_82_LATEST": "8.2.29", + "PHP_83_LATEST": "8.3.30", + }, + expected: "8.1.34", + }, + { + name: "Returns invalid placeholder as-is (for clear error message)", + phpVersion: "{PHP_99_LATEST}", + phpVersions: map[string]string{ + "PHP_81_LATEST": "8.1.34", + "PHP_82_LATEST": "8.2.29", + "PHP_83_LATEST": "8.3.30", + }, + expected: "{PHP_99_LATEST}", + }, + { + name: "Returns exact version without placeholder syntax", + phpVersion: "8.3.21", + phpVersions: map[string]string{ + "PHP_83_LATEST": "8.3.30", + }, + expected: "8.3.21", + }, + { + name: "Returns version with partial placeholder syntax (not a placeholder)", + phpVersion: "PHP_83_LATEST", + phpVersions: map[string]string{ + "PHP_83_LATEST": "8.3.30", + }, + expected: "PHP_83_LATEST", + }, + } + + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + opts := &options.Options{ + PHPDefault: "8.1.32", + PHPVersion: tt.phpVersion, + PHPVersions: tt.phpVersions, + } + + result := opts.GetPHPVersion() + if result != tt.expected { + t.Errorf("Expected %s, got %s", tt.expected, result) + } + }) + } +} + +func TestGetPreprocessCommands(t *testing.T) { + tests := []struct { + name string + cmds interface{} + expected []string + }{ + { + name: "nil returns empty slice", + cmds: nil, + expected: nil, + }, + { + name: "empty string returns empty slice", + cmds: "", + expected: nil, + }, + { + name: "single string command", + cmds: "source $HOME/scripts/bootstrap.sh", + expected: []string{"source $HOME/scripts/bootstrap.sh"}, + }, + { + name: "array of strings", + cmds: []interface{}{"env", "run_something"}, + expected: []string{"env", "run_something"}, + }, + { + name: "array with single string", + cmds: []interface{}{"source $HOME/scripts/setup.sh"}, + expected: []string{"source $HOME/scripts/setup.sh"}, + }, + { + name: "array of arrays (command with args)", + cmds: []interface{}{[]interface{}{"echo", "Hello World"}}, + expected: []string{"echo Hello World"}, + }, + { + name: "mixed array of strings and arrays", + cmds: []interface{}{ + "env", + []interface{}{"echo", "Hello"}, + "run_script", + }, + expected: []string{"env", "echo Hello", "run_script"}, + }, + { + name: "complex Drupal-style bootstrap", + cmds: []interface{}{ + "source $HOME/scripts/bootstrap.sh", + }, + expected: []string{"source $HOME/scripts/bootstrap.sh"}, + }, + } + + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + opts := &options.Options{ + AdditionalPreprocessCmds: tt.cmds, + } + + result := opts.GetPreprocessCommands() + + // Check length + if len(result) != len(tt.expected) { + t.Errorf("Expected %d commands, got %d: %v", len(tt.expected), len(result), result) + return + } + + // Check each command + for i, cmd := range result { + if cmd != tt.expected[i] { + t.Errorf("Command %d: expected %q, got %q", i, tt.expected[i], cmd) + } + } + }) + } +} + +func TestFindStandaloneApp(t *testing.T) { + tests := []struct { + name string + appStartCmd string + createFiles []string + expectedApp string + expectError bool + errorContains string + }{ + { + name: "explicit APP_START_CMD exists", + appStartCmd: "worker.php", + createFiles: []string{"worker.php"}, + expectedApp: "worker.php", + expectError: false, + }, + { + name: "explicit APP_START_CMD not found", + appStartCmd: "missing.php", + createFiles: []string{}, + expectedApp: "", + expectError: true, + errorContains: "APP_START_CMD file not found", + }, + { + name: "auto-detect app.php (first priority)", + appStartCmd: "", + createFiles: []string{"app.php", "main.php", "run.php", "start.php"}, + expectedApp: "app.php", + expectError: false, + }, + { + name: "auto-detect main.php (second priority)", + appStartCmd: "", + createFiles: []string{"main.php", "run.php", "start.php"}, + expectedApp: "main.php", + expectError: false, + }, + { + name: "auto-detect run.php (third priority)", + appStartCmd: "", + createFiles: []string{"run.php", "start.php"}, + expectedApp: "run.php", + expectError: false, + }, + { + name: "auto-detect start.php (fourth priority)", + appStartCmd: "", + createFiles: []string{"start.php"}, + expectedApp: "start.php", + expectError: false, + }, + { + name: "no standalone app found", + appStartCmd: "", + createFiles: []string{"index.php"}, + expectedApp: "", + expectError: true, + errorContains: "no standalone app found", + }, + } + + for _, tt := range tests { + t.Run(tt.name, func(t *testing.T) { + // Create temp directory + buildDir := t.TempDir() + + // Create test files + for _, file := range tt.createFiles { + filePath := filepath.Join(buildDir, file) + if err := os.WriteFile(filePath, []byte("= 'A' && c <= 'Z') || (c >= 'a' && c <= 'z') || (c >= '0' && c <= '9') || c == '_') { - break - } - varEnd++ - } - - // If we didn't match any characters, skip this delimiter - if varEnd == varStart { - pos = varStart - continue - } - } - - // Extract variable name - varName := result[varStart:varEnd] - - // Skip if variable name is empty - if varName == "" { - pos = varStart - continue - } - - // Get environment variable value - varValue := os.Getenv(varName) - - // Replace the pattern (keep pattern if variable not found - safe_substitute behavior) - if varValue != "" { - endPos := varEnd - if endDelim != "" { - endPos = varEnd + len(endDelim) - } - result = result[:start] + varValue + result[endPos:] - pos = start + len(varValue) - } else { - // Keep the pattern and continue searching after it - pos = varEnd - if endDelim != "" { - pos += len(endDelim) - } - } - } - - return result -} - -// rewriteConfigsRecursive walks a directory and rewrites all files -func rewriteConfigsRecursive(dirPath string) error { - return filepath.Walk(dirPath, func(path string, info os.FileInfo, err error) error { - if err != nil { - return err - } - - // Skip directories - if info.IsDir() { - return nil - } - - log.Printf("Rewriting config file: %s", path) - return rewriteFile(path) - }) -} - -func main() { - if len(os.Args) != 2 { - fmt.Fprintln(os.Stderr, "Argument required! Specify path to configuration directory.") - os.Exit(1) - } - - toPath := os.Args[1] - - // Check if path exists - info, err := os.Stat(toPath) - if err != nil { - fmt.Fprintf(os.Stderr, "Path [%s] not found.\n", toPath) - os.Exit(1) - } - - // Process directory or single file - if info.IsDir() { - log.Printf("Rewriting configuration under [%s]", toPath) - err = rewriteConfigsRecursive(toPath) - } else { - log.Printf("Rewriting configuration file [%s]", toPath) - err = rewriteFile(toPath) - } - - if err != nil { - fmt.Fprintf(os.Stderr, "Error: %v\n", err) - os.Exit(1) - } -} diff --git a/src/php/supply/supply.go b/src/php/supply/supply.go index 5fa46ec7a..756881cba 100644 --- a/src/php/supply/supply.go +++ b/src/php/supply/supply.go @@ -412,7 +412,7 @@ func (s *Supplier) InstallPHP() error { } // Process php.ini to replace build-time extension placeholders only - // Runtime placeholders (@{HOME}, etc.) will be replaced by the rewrite tool in start script + // Runtime placeholders (@{HOME}, etc.) are replaced during finalize phase phpIniPath := filepath.Join(phpEtcDir, "php.ini") if err := s.processPhpIni(phpIniPath); err != nil { return fmt.Errorf("failed to process php.ini: %w", err) @@ -431,7 +431,7 @@ func (s *Supplier) InstallPHP() error { } // Note: User's .bp-config/php/fpm.d/*.conf files are already copied by copyUserConfigs() above - // They will be processed by the rewrite tool at runtime (in start script) + // They will be processed during the finalize phase (build-time placeholder replacement) return nil } @@ -495,7 +495,7 @@ func (s *Supplier) processPhpFpmConf(phpFpmConfPath, phpEtcDir string) error { // Set the include directive based on whether user has fpm.d configs var includeDirective string if hasFpmDConfigs { - // Use DEPS_DIR with dynamic index which will be replaced by rewrite tool at runtime + // Use DEPS_DIR with dynamic index which will be replaced during finalize phase depsIdx := s.Stager.DepsIdx() includeDirective = fmt.Sprintf("include=@{DEPS_DIR}/%s/php/etc/fpm.d/*.conf", depsIdx) s.Log.Info("Enabling fpm.d config includes") @@ -505,7 +505,7 @@ func (s *Supplier) processPhpFpmConf(phpFpmConfPath, phpEtcDir string) error { } // Replace the placeholder - phpFpmConfContent = strings.ReplaceAll(phpFpmConfContent, "#{PHP_FPM_CONF_INCLUDE}", includeDirective) + phpFpmConfContent = strings.ReplaceAll(phpFpmConfContent, "@{PHP_FPM_CONF_INCLUDE}", includeDirective) // Write back to php-fpm.conf if err := os.WriteFile(phpFpmConfPath, []byte(phpFpmConfContent), 0644); err != nil { @@ -516,16 +516,16 @@ func (s *Supplier) processPhpFpmConf(phpFpmConfPath, phpEtcDir string) error { } // createIncludePathIni creates a separate include-path.ini file in php.ini.d -// This file uses @{HOME} placeholder which gets rewritten AFTER HOME is restored -// to /home/vcap/app, avoiding the issue where php.ini gets rewritten while HOME -// points to the deps directory +// This file uses @{HOME} placeholder which gets replaced during finalize phase with /home/vcap/app +// (app context, not deps context). The php.ini.d directory is processed separately from other +// PHP configs because it contains app-relative paths like include_path. func (s *Supplier) createIncludePathIni(phpIniDDir string) error { includePathIniPath := filepath.Join(phpIniDDir, "include-path.ini") - // Use @{HOME} placeholder which will be replaced by rewrite tool at runtime - // after HOME is restored to /home/vcap/app + // Use @{HOME} placeholder which will be replaced during finalize phase + // with /home/vcap/app (app context) content := `; Include path configuration -; This file is rewritten at runtime after HOME is restored to /home/vcap/app +; This file is processed during finalize phase with @{HOME} = /home/vcap/app include_path = ".:/usr/share/php:@{HOME}/lib" ` diff --git a/src/php/supply/supply_test.go b/src/php/supply/supply_test.go index e41f1b5f9..47bd96108 100644 --- a/src/php/supply/supply_test.go +++ b/src/php/supply/supply_test.go @@ -340,7 +340,7 @@ var _ = Describe("Supply", func() { Expect(os.WriteFile(testConfPath, []byte("[test]\nlisten = 9001\n"), 0644)).To(Succeed()) phpFpmConfPath := filepath.Join(phpEtcDir, "php-fpm.conf") - phpFpmConfContent := "[global]\npid = /tmp/php-fpm.pid\n\n#{PHP_FPM_CONF_INCLUDE}\n\n[www]\nlisten = 9000\n" + phpFpmConfContent := "[global]\npid = /tmp/php-fpm.pid\n\n@{PHP_FPM_CONF_INCLUDE}\n\n[www]\nlisten = 9000\n" Expect(os.WriteFile(phpFpmConfPath, []byte(phpFpmConfContent), 0644)).To(Succeed()) err = supplier.ProcessPhpFpmConfForTesting(phpFpmConfPath, phpEtcDir) @@ -351,7 +351,7 @@ var _ = Describe("Supply", func() { Expect(string(content)).To(ContainSubstring("include=@{DEPS_DIR}/13/php/etc/fpm.d/*.conf")) Expect(string(content)).NotTo(ContainSubstring("@{DEPS_DIR}/0/")) - Expect(string(content)).NotTo(ContainSubstring("#{PHP_FPM_CONF_INCLUDE}")) + Expect(string(content)).NotTo(ContainSubstring("@{PHP_FPM_CONF_INCLUDE}")) }) It("removes include directive when no user fpm.d configs exist", func() { @@ -371,7 +371,7 @@ var _ = Describe("Supply", func() { Expect(os.MkdirAll(phpEtcDir, 0755)).To(Succeed()) phpFpmConfPath := filepath.Join(phpEtcDir, "php-fpm.conf") - phpFpmConfContent := "[global]\npid = /tmp/php-fpm.pid\n\n#{PHP_FPM_CONF_INCLUDE}\n\n[www]\nlisten = 9000\n" + phpFpmConfContent := "[global]\npid = /tmp/php-fpm.pid\n\n@{PHP_FPM_CONF_INCLUDE}\n\n[www]\nlisten = 9000\n" Expect(os.WriteFile(phpFpmConfPath, []byte(phpFpmConfContent), 0644)).To(Succeed()) err = supplier.ProcessPhpFpmConfForTesting(phpFpmConfPath, phpEtcDir) @@ -381,7 +381,7 @@ var _ = Describe("Supply", func() { Expect(err).To(BeNil()) Expect(string(content)).NotTo(ContainSubstring("include=")) - Expect(string(content)).NotTo(ContainSubstring("#{PHP_FPM_CONF_INCLUDE}")) + Expect(string(content)).NotTo(ContainSubstring("@{PHP_FPM_CONF_INCLUDE}")) }) })